Added new relic license key to env.production

- Add console shim to forward log/error/warn/info to New Relic
- Enable application_logging with forwarding in newrelic.cjs
- Import newrelic in server.js for recordLogEvent API
- Update CI workflow with New Relic config

Co-Authored-By: Claude Opus 4.5 <noreply@anthropic.com>

.github/workflows/build.yml

@@ -0,0 +1,75 @@
+name: Build and Deploy
+
+on:
+  push:
+    branches: [ main ]
+  pull_request:
+    branches: [ main ]
+
+jobs:
+  build:
+    runs-on: linux_amd64
+    timeout-minutes: 15
+
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v4
+
+      - name: Install dependencies
+        run: npm ci
+        timeout-minutes: 5
+
+      - name: Build Front End
+        run: npm run build
+        timeout-minutes: 10
+        env:
+          NODE_OPTIONS: '--max-old-space-size=4096'
+          VITE_AUTH0_CLIENTID: ${{ secrets.VITE_AUTH0_CLIENTID }}
+          VITE_AUTH0_DOMAIN: ${{ secrets.VITE_AUTH0_DOMAIN }}
+
+      - name: Stop Service
+        run: |
+          sudo rc-service immersive stop || true
+
+      - name: Deploy to /opt/immersive
+        run: |
+          # Ensure group write so we can delete old files
+          sudo chmod -R g+w /opt/immersive || true
+
+          # Remove old files except data directory and env file
+          find /opt/immersive -mindepth 1 -maxdepth 1 ! -name 'data' ! -name '.env.production' -exec rm -rf {} +
+
+          # Copy built files to target
+          cp -r . /opt/immersive/
+
+          # Remove unnecessary directories
+          rm -rf /opt/immersive/.git /opt/immersive/.github
+
+          # Set permissions on start.sh and ensure group write for future deploys
+          chmod +x /opt/immersive/start.sh
+          sudo chmod -R g+w /opt/immersive
+
+          # Set ownership to immersive user
+          sudo chown -R immersive:immersive /opt/immersive
+
+      - name: Create Environment File
+        env:
+          ANTHROPIC_API_KEY: ${{ secrets.ANTHROPIC_API_KEY }}
+          CLOUDFLARE_ACCOUNT_ID: ${{ secrets.CLOUDFLARE_ACCOUNT_ID }}
+          CLOUDFLARE_API_TOKEN: ${{ secrets.CLOUDFLARE_API_TOKEN }}
+          NEW_RELIC_LICENSE_KEY: ${{ secrets.NEW_RELIC_LICENSE_KEY }}
+        run: |
+          # Create .env.production with secrets (only accessible by immersive user)
+          echo "# Auto-generated by CI/CD - Do not edit manually" > /opt/immersive/.env.production
+          echo "ANTHROPIC_API_KEY=${ANTHROPIC_API_KEY}" >> /opt/immersive/.env.production
+          echo "CLOUDFLARE_ACCOUNT_ID=${CLOUDFLARE_ACCOUNT_ID}" >> /opt/immersive/.env.production
+          echo "CLOUDFLARE_API_TOKEN=${CLOUDFLARE_API_TOKEN}" >> /opt/immersive/.env.production
+          echo "NEW_RELIC_LICENSE_KEY=${NEW_RELIC_LICENSE_KEY}" >> /opt/immersive/.env.production
+
+          # Secure the environment file
+          sudo chown immersive:immersive /opt/immersive/.env.production
+          sudo chmod 600 /opt/immersive/.env.production
+
+      - name: Start Service
+        run: |
+          sudo rc-service immersive start

.github/workflows/main.yml

@@ -0,0 +1,19 @@
+name: Node.js CI
+
+on:
+  push:
+    branches: [ "deepdiagram" ]
+  pull_request:
+    branches: [ "deepdiagram" ]
+
+jobs:
+  build:
+    runs-on: self-hosted
+
+    steps:
+    - uses: actions/checkout@v2
+    - name: Use Node.js 20.x
+      uses: actions/setup-node@v2
+      with:
+        node-version: 20.x
+    - run: cp -r ./dist/* /var/www/deepdiagram

.github/workflows/node.js.yml

@@ -0,0 +1,50 @@
+# This workflow will do a clean installation of node dependencies, cache/restore them, build the source code and run tests across different versions of node
+# For more information see: https://docs.github.com/en/actions/automating-builds-and-tests/building-and-testing-nodejs
+
+name: Node.js Github Side
+
+on:
+  push:
+    branches: [ "deepdiagram" ]
+  pull_request:
+    branches: [ "deepdiagram" ]
+
+jobs:
+  build:
+    name: build app
+    runs-on: ubuntu-latest
+
+    steps:
+    - uses: actions/checkout@v2
+    - name: Use Node.js 20.x
+      uses: actions/setup-node@v2
+      with:
+        node-version: 20.x
+        cache-dependency-path: package-lock.json
+    - run: echo "test"
+    - run: npm ci
+    - run: npm run build
+      env:
+        VITE_SYNCDB_ENDPOINT: ${{ secrets.VITE_SYNCDB_ENDPOINT }}
+        VITE_USER_ENDPOINT: ${{ secrets.VITE_USER_ENDPOINT }}
+        VITE_CREATE_ENDPOINT: ${{ secrets.VITE_CREATE_ENDPOINT }}
+        NODE_OPTIONS: --max-old-space-size=4096
+    - name: Archive production artifacts
+      uses: actions/upload-artifact@v4
+      with:
+        name: upload-dist
+        path: ./dist
+        overwrite: true
+  deploy:
+    name: deploy on linode
+    needs: build
+    runs-on: self-hosted
+    steps:
+      - name: get artifact
+        uses: actions/download-artifact@v4
+        with:
+          name: upload-dist
+          path: dist
+      - run: pwd
+      - run: cp -r ./dist/* /var/www/deepdiagram/
+    

.gitignore

@@ -25,3 +25,5 @@ dist-ssr
 
 # Local Netlify folder
 .netlify
+/data/
+/.env.production

ALPINE_SERVICE.md

@@ -0,0 +1,280 @@
+# Alpine Linux Service Setup
+
+This guide covers installing and running Immersive as a service on Alpine Linux using OpenRC.
+
+## Prerequisites
+
+```bash
+# Update packages
+apk update
+
+# Install Node.js 18+ and npm
+apk add nodejs npm
+
+# Install build dependencies (required for native modules like leveldown)
+apk add python3 make g++ git
+
+# Verify Node version (must be >= 18)
+node --version
+```
+
+## Create Service User
+
+Create a dedicated user to run the service (security best practice):
+
+```bash
+# Create immersive group and user (no login shell, no home directory)
+addgroup -S immersive
+adduser -S -G immersive -H -s /sbin/nologin immersive
+
+# Create directories with proper ownership
+mkdir -p /opt/immersive
+mkdir -p /var/log/immersive
+mkdir -p /var/run/immersive
+
+chown -R immersive:immersive /opt/immersive
+chown -R immersive:immersive /var/log/immersive
+chown -R immersive:immersive /var/run/immersive
+```
+
+## Installation
+
+```bash
+# Create application directory
+mkdir -p /opt/immersive
+cd /opt/immersive
+
+# Clone or copy the application
+git clone <your-repo-url> .
+# OR copy files manually
+
+# Install dependencies
+npm ci --production=false
+
+# Build the application
+NODE_OPTIONS='--max-old-space-size=4096' npm run build
+
+# Copy Havok physics WASM (if not already done by build)
+npm run havok
+
+# Create data directory for PouchDB
+mkdir -p /opt/immersive/data
+
+# Set ownership to immersive user
+chown -R immersive:immersive /opt/immersive
+```
+
+## Start Script
+
+The `start.sh` script is included in the repository. After deployment, ensure it's executable:
+
+```bash
+chmod +x /opt/immersive/start.sh
+```
+
+The script sets up the environment and starts the Node.js server, logging output to `/var/log/immersive/`.
+
+## OpenRC Service
+
+Create `/etc/init.d/immersive`:
+
+```bash
+#!/sbin/openrc-run
+
+name="immersive"
+description="Immersive WebXR Diagramming Application"
+
+command="/opt/immersive/start.sh"
+command_user="immersive:immersive"
+command_background="yes"
+pidfile="/var/run/immersive/immersive.pid"
+
+directory="/opt/immersive"
+output_log="/var/log/immersive/app.log"
+error_log="/var/log/immersive/error.log"
+
+depend() {
+    need net
+    after firewall
+}
+
+start_pre() {
+    checkpath --directory --owner immersive:immersive --mode 0755 /var/log/immersive
+    checkpath --directory --owner immersive:immersive --mode 0755 /var/run/immersive
+    checkpath --file --owner immersive:immersive --mode 0644 /var/log/immersive/app.log
+    checkpath --file --owner immersive:immersive --mode 0644 /var/log/immersive/error.log
+}
+```
+
+Make it executable and enable:
+
+```bash
+chmod +x /etc/init.d/immersive
+rc-update add immersive default
+```
+
+## Service Management
+
+```bash
+# Start the service
+rc-service immersive start
+
+# Stop the service
+rc-service immersive stop
+
+# Restart the service
+rc-service immersive restart
+
+# Check status
+rc-service immersive status
+
+# View logs
+tail -f /var/log/immersive/app.log
+tail -f /var/log/immersive/error.log
+```
+
+## Log Rotation
+
+Create `/etc/logrotate.d/immersive`:
+
+```
+/var/log/immersive/*.log {
+    daily
+    rotate 7
+    compress
+    delaycompress
+    missingok
+    notifempty
+    create 0644 immersive immersive
+    postrotate
+        rc-service immersive restart > /dev/null 2>&1 || true
+    endscript
+}
+```
+
+Install logrotate if not present:
+
+```bash
+apk add logrotate
+```
+
+## Environment Variables
+
+Create `/opt/immersive/.env.production` for production settings:
+
+```bash
+# Server
+NODE_ENV=production
+PORT=3001
+
+# Auth0 (if using authentication)
+# VITE_AUTH0_DOMAIN=your-domain.auth0.com
+# VITE_AUTH0_CLIENT_ID=your-client-id
+
+# Database sync endpoint (optional)
+# VITE_SYNCDB_ENDPOINT=https://your-couchdb-server.com
+```
+
+## Firewall (if using iptables)
+
+```bash
+# Allow port 3001
+iptables -A INPUT -p tcp --dport 3001 -j ACCEPT
+
+# Save rules
+rc-service iptables save
+```
+
+## Reverse Proxy (Optional)
+
+If using nginx as a reverse proxy:
+
+```bash
+apk add nginx
+```
+
+Create `/etc/nginx/http.d/immersive.conf`:
+
+```nginx
+server {
+    listen 80;
+    server_name your-domain.com;
+
+    location / {
+        proxy_pass http://127.0.0.1:3001;
+        proxy_http_version 1.1;
+        proxy_set_header Upgrade $http_upgrade;
+        proxy_set_header Connection 'upgrade';
+        proxy_set_header Host $host;
+        proxy_set_header X-Real-IP $remote_addr;
+        proxy_set_header X-Forwarded-For $proxy_add_x_forwarded_for;
+        proxy_set_header X-Forwarded-Proto $scheme;
+        proxy_cache_bypass $http_upgrade;
+    }
+}
+```
+
+Enable and start nginx:
+
+```bash
+rc-update add nginx default
+rc-service nginx start
+```
+
+## Gitea CI/CD Runner (Optional)
+
+If using a Gitea Actions runner to deploy, grant the runner user write access to `/opt/immersive`:
+
+```bash
+# Add gitea-runner to immersive group
+adduser gitea-runner immersive
+
+# Set group write permissions on /opt/immersive
+chmod -R g+w /opt/immersive
+
+# Ensure new files inherit group ownership
+chmod g+s /opt/immersive
+
+# Allow runner to manage the service
+# Add to /etc/sudoers.d/gitea-runner:
+echo 'gitea-runner ALL=(ALL) NOPASSWD: /sbin/rc-service immersive *' > /etc/sudoers.d/gitea-runner
+echo 'gitea-runner ALL=(ALL) NOPASSWD: /bin/chown -R immersive\:immersive /opt/immersive' >> /etc/sudoers.d/gitea-runner
+chmod 440 /etc/sudoers.d/gitea-runner
+```
+
+The GitHub Actions workflow in `.github/workflows/build.yml` will handle deployment automatically on push to main.
+
+## Troubleshooting
+
+**Service fails to start:**
+```bash
+# Check logs
+cat /var/log/immersive/error.log
+
+# Run manually as immersive user to see errors
+su -s /bin/sh immersive -c "cd /opt/immersive && NODE_ENV=production node server.js"
+```
+
+**Native module errors (leveldown):**
+```bash
+# Rebuild native modules
+cd /opt/immersive
+npm rebuild leveldown
+```
+
+**Permission issues:**
+```bash
+# Ensure proper ownership (must be immersive user)
+chown -R immersive:immersive /opt/immersive
+chown -R immersive:immersive /var/log/immersive
+chown -R immersive:immersive /var/run/immersive
+chmod -R 755 /opt/immersive
+```
+
+**Port already in use:**
+```bash
+# Find process using port 3001
+lsof -i :3001
+# Or
+netstat -tlnp | grep 3001
+```

CLAUDE.md

@@ -0,0 +1,137 @@
+# CLAUDE.md
+
+This file provides guidance to Claude Code (claude.ai/code) when working with code in this repository.
+
+## Project Overview
+
+This is "immersive" - a WebXR/VR diagramming application built with BabylonJS and React. It allows users to create and interact with 3D diagrams in both standard web browsers and VR environments, with real-time collaboration via PouchDB sync.
+
+## Build and Development Commands
+
+### Development
+- `npm run dev` - Start Vite dev server on port 3001 (DO NOT USE per user instructions)
+- `npm run build` - Build production bundle (includes version bump)
+- `npm run preview` - Preview production build on port 3001
+- `npm test` - Run tests with Vitest
+- `npm run socket` - Start WebSocket server for collaboration (port 8080)
+- `npm run serverBuild` - Compile TypeScript server code
+- `npm run havok` - Copy Havok physics WASM files to Vite deps
+
+### Testing
+- Run all tests: `npm test`
+- No single test command is configured; tests use Vitest
+
+## Architecture
+
+### Core Technologies
+- **BabylonJS 8.x**: 3D engine with WebXR support and Havok physics
+- **React + Mantine**: UI framework for 2D interface and settings
+- **PouchDB**: Client-side database with CouchDB sync for collaboration
+- **Auth0**: Authentication provider
+- **Vite**: Build tool and dev server
+
+### Key Architecture Patterns
+
+#### Singleton Scene Management
+The application uses a singleton pattern for the BabylonJS Scene via `DefaultScene` (src/defaultScene.ts). Always access the scene through `DefaultScene.Scene` rather than creating new instances.
+
+#### Observable-Based Event System
+The application heavily uses BabylonJS Observables for event handling:
+- **DiagramManager.onDiagramEventObservable**: Central hub for diagram entity changes
+- **DiagramManager.onUserEventObservable**: User position/state updates for multiplayer
+- **AppConfig.onConfigChangedObservable**: Application settings changes
+- **controllerObservable**: VR controller input events
+
+Event observers use a mask system (`DiagramEventObserverMask`) to distinguish:
+- `FROM_DB`: Events coming from database sync (shouldn't trigger database writes)
+- `TO_DB`: Events that should be persisted to database
+
+#### Diagram Entity System
+All 3D objects in the scene are represented by `DiagramEntity` types (src/diagram/types/diagramEntity.ts):
+- Entities have a template reference (e.g., `#image-template`)
+- Managed by `DiagramManager` which maintains a Map of `DiagramObject` instances
+- Changes propagate through the Observable system to database and other clients
+
+#### VR Controller Architecture
+Controllers inherit from `AbstractController` with specialized implementations:
+- `LeftController`: Menu interactions, navigation
+- `RightController`: Object manipulation, selection
+- Controllers communicate via `controllerObservable` with `ControllerEvent` messages
+- `Rigplatform` manages the player rig and handles locomotion
+
+#### Database & Sync
+- `PouchdbPersistenceManager` (src/integration/database/pouchdbPersistenceManager.ts) handles all persistence
+- Supports optional encryption via `Encryption` class
+- Syncs to remote CouchDB via proxy (configured in vite.config.ts)
+- URL pattern `/db/public/:db` or `/db/private/:db` determines database name
+- Uses `presence.ts` for broadcasting user positions over WebSocket
+
+### Project Structure
+- `src/vrcore/`: Engine initialization and core VR setup
+- `src/controllers/`: VR controller implementations and input handling
+- `src/diagram/`: 3D diagram entities, management, and scene interaction
+- `src/integration/`: Database sync, encryption, and presence system
+- `src/menus/`: In-VR 3D menus (not React components)
+- `src/objects/`: Reusable 3D objects (buttons, handles, avatars)
+- `src/react/`: React UI components for 2D interface
+- `src/util/`: Shared utilities and configuration
+- `server/`: WebSocket server for real-time presence
+
+### Configuration System
+Two configuration systems exist (being migrated):
+1. **AppConfig class** (src/util/appConfig.ts): Observable-based config with typed properties
+2. **ConfigType** (bottom of appConfig.ts): Legacy localStorage-based config
+
+Settings include snapping values, physics toggles, fly mode, and turn snap angles.
+
+## Important Development Notes
+
+### Proxy Configuration
+The dev and preview servers proxy certain routes to production:
+- `/sync/*` - Database sync endpoint
+- `/create-db` - Database creation
+- `/api/images` - Image uploads
+
+### Physics System
+- Uses Havok physics engine (requires WASM file via `npm run havok`)
+- Physics can be enabled/disabled via AppConfig
+- `customPhysics.ts` provides helper functions
+
+### WebGPU Support
+The engine initializer supports both WebGL and WebGPU backends via the `useWebGpu` parameter.
+
+### Encryption
+Databases can be optionally encrypted. The `Encryption` class handles AES encryption with password-derived keys. Salt is stored in metadata document.
+
+### Environment Variables
+- `VITE_USER_ENDPOINT`: User authentication endpoint
+- `VITE_SYNCDB_ENDPOINT`: Remote database sync endpoint
+
+Check `.env.local` for local configuration.
+
+## Naming Conventions
+
+### Tool and Material Naming
+
+**Material Names:** Materials follow the pattern `material-{color}` where `{color}` is the hex color string (e.g., `material-#ff0000` for red).
+
+**Tool Mesh Names:** Tools use the pattern `tool-{toolType}-{color}`:
+- Example: `tool-BOX-#ff0000` (red box tool)
+- ToolTypes: `BOX`, `SPHERE`, `CYLINDER`, `CONE`, `PLANE`, `PERSON`
+
+**Tool Instance Names:** `tool-instance-{toolType}-{color}` (e.g., `tool-instance-BOX-#ff0000`)
+
+**Implementation details:**
+- 16 predefined toolbox colors (see docs/NAMING_CONVENTIONS.md)
+- Materials created in `src/toolbox/functions/buildColor.ts`
+- Tool meshes created in `src/toolbox/functions/buildTool.ts`
+- When extracting colors from materials, use: `emissiveColor || diffuseColor` (priority order)
+
+### Rendering Modes
+
+Three rendering modes affect material properties:
+1. **Lightmap with Lighting**: Uses `diffuseColor` + `lightmapTexture` (expensive)
+2. **Unlit with Emissive Texture** (default): Uses `emissiveColor` + `emissiveTexture` (lightmap)
+3. **Flat Emissive**: Uses only `emissiveColor` (fastest)
+
+See `src/util/renderingMode.ts` and `src/util/lightmapGenerator.ts` for implementation.

EXPRESS_API_PLAN.md

@@ -0,0 +1,403 @@
+# Express.js API Server Plan
+
+## Goal
+Add an Express.js backend server to handle API routes (starting with Claude API), with support for either combined or split deployment.
+
+## Advantages Over Next.js Migration
+- **Minimal frontend changes** - only API URL configuration
+- **No routing changes** - keep react-router-dom as-is
+- **Flexible deployment** - combined or split frontend/backend
+- **Already partially exists** - `server.js` in root has Express + vite-express scaffolding
+
+## Deployment Options
+
+### Option A: Combined (Single Server)
+```
+Express Server (vite-express)
+├── Serves static files from dist/
+└── Handles /api/* routes
+```
+- Simpler setup, one deployment
+- Good for: VPS, Railway, Fly.io, DigitalOcean App Platform
+
+### Option B: Split (Separate Hosts)
+```
+Static Host (CDN)              API Server (Node.js)
+├── Cloudflare Pages           ├── Railway
+├── Netlify                    ├── Fly.io
+├── Vercel                     ├── AWS Lambda
+└── S3 + CloudFront            └── Any VPS
+
+Serves dist/                   Handles /api/*
+```
+- Better scalability, cheaper static hosting
+- Good for: High traffic, global CDN distribution
+
+---
+
+## Current State
+
+### Existing `server.js` (incomplete)
+```javascript
+import express from "express";
+import ViteExpress from "vite-express";
+import dotenv from "dotenv";
+import expressProxy from "express-http-proxy";
+
+dotenv.config();
+const app = express();
+app.use("/api", expressProxy("local.immersiveidea.com"));
+ViteExpress.listen(app, process.env.PORT || 3001, () => console.log("Server is listening..."));
+```
+
+### Missing Dependencies
+The following packages are imported but not in package.json:
+- `express`
+- `vite-express`
+- `express-http-proxy`
+- `dotenv`
+
+---
+
+## Implementation Plan
+
+### Phase 1: Install Dependencies
+
+```bash
+npm install express vite-express dotenv cors
+```
+
+- `express` - Web framework
+- `vite-express` - Vite integration for combined deployment
+- `dotenv` - Environment variable loading
+- `cors` - Cross-origin support for split deployment
+
+### Phase 2: Create API Routes Structure
+
+Create a modular API structure:
+
+```
+server/
+├── server.js              # Existing WebSocket server (keep as-is)
+├── api/
+│   ├── index.js           # Main API router
+│   └── claude.js          # Claude API proxy route
+```
+
+### Phase 3: Update Root `server.js`
+
+Replace the current incomplete server.js with:
+
+```javascript
+import express from "express";
+import ViteExpress from "vite-express";
+import cors from "cors";
+import dotenv from "dotenv";
+import apiRoutes from "./server/api/index.js";
+
+dotenv.config();
+
+const app = express();
+
+// CORS configuration for split deployment
+// In combined mode, same-origin requests don't need CORS
+const allowedOrigins = process.env.ALLOWED_ORIGINS?.split(",") || [];
+if (allowedOrigins.length > 0) {
+  app.use(cors({
+    origin: allowedOrigins,
+    credentials: true,
+  }));
+}
+
+app.use(express.json());
+
+// API routes
+app.use("/api", apiRoutes);
+
+// Check if running in API-only mode (split deployment)
+const apiOnly = process.env.API_ONLY === "true";
+
+if (apiOnly) {
+  // API-only mode: no static file serving
+  app.listen(process.env.PORT || 3000, () => {
+    console.log(`API server running on port ${process.env.PORT || 3000}`);
+  });
+} else {
+  // Combined mode: Vite handles static files + SPA
+  ViteExpress.listen(app, process.env.PORT || 3001, () => {
+    console.log(`Server running on port ${process.env.PORT || 3001}`);
+  });
+}
+```
+
+### Phase 4: Create API Router
+
+**`server/api/index.js`**:
+```javascript
+import { Router } from "express";
+import claudeRouter from "./claude.js";
+
+const router = Router();
+
+// Claude API proxy
+router.use("/claude", claudeRouter);
+
+// Health check
+router.get("/health", (req, res) => {
+  res.json({ status: "ok" });
+});
+
+export default router;
+```
+
+**`server/api/claude.js`**:
+```javascript
+import { Router } from "express";
+
+const router = Router();
+const ANTHROPIC_API_URL = "https://api.anthropic.com";
+
+router.post("/*", async (req, res) => {
+  const apiKey = process.env.ANTHROPIC_API_KEY;
+
+  if (!apiKey) {
+    return res.status(500).json({ error: "API key not configured" });
+  }
+
+  // Get the path after /api/claude (e.g., /v1/messages)
+  const path = req.params[0] || req.path;
+
+  try {
+    const response = await fetch(`${ANTHROPIC_API_URL}${path}`, {
+      method: "POST",
+      headers: {
+        "Content-Type": "application/json",
+        "x-api-key": apiKey,
+        "anthropic-version": "2023-06-01",
+      },
+      body: JSON.stringify(req.body),
+    });
+
+    const data = await response.json();
+    res.status(response.status).json(data);
+  } catch (error) {
+    console.error("Claude API error:", error);
+    res.status(500).json({ error: "Failed to proxy request to Claude API" });
+  }
+});
+
+export default router;
+```
+
+### Phase 5: Update Vite Config
+
+Remove the Claude proxy from `vite.config.ts` since Express handles it now.
+
+**Before** (lines 41-56):
+```javascript
+'^/api/claude': {
+    target: 'https://api.anthropic.com',
+    changeOrigin: true,
+    rewrite: (path) => path.replace(/^\/api\/claude/, ''),
+    configure: (proxy) => {
+        proxy.on('proxyReq', (proxyReq) => {
+            const apiKey = env.ANTHROPIC_API_KEY;
+            // ...
+        });
+    }
+}
+```
+
+**After**: Remove this block entirely. The Express server handles `/api/claude/*`.
+
+Keep the other proxies (`/sync/*`, `/create-db`, `/api/images`) - they still proxy to deepdiagram.com in dev mode.
+
+### Phase 6: Add API URL Configuration (for Split Deployment)
+
+Create a utility to get the API base URL:
+
+**`src/util/apiConfig.ts`**:
+```typescript
+// API base URL - empty string for same-origin (combined deployment)
+// Set VITE_API_URL for split deployment (e.g., "https://api.yourdomain.com")
+export const API_BASE_URL = import.meta.env.VITE_API_URL || '';
+
+export function apiUrl(path: string): string {
+  return `${API_BASE_URL}${path}`;
+}
+```
+
+**Update `src/react/services/diagramAI.ts`**:
+```typescript
+import { apiUrl } from '../../util/apiConfig';
+
+// Change from:
+const response = await fetch('/api/claude/v1/messages', { ... });
+
+// To:
+const response = await fetch(apiUrl('/api/claude/v1/messages'), { ... });
+```
+
+This change is backward-compatible:
+- **Combined deployment**: `VITE_API_URL` is empty, calls go to same origin
+- **Split deployment**: `VITE_API_URL=https://api.example.com`, calls go to API server
+
+### Phase 7: Update package.json Scripts
+
+```json
+"scripts": {
+  "dev": "node server.js",
+  "build": "node versionBump.js && vite build",
+  "start": "NODE_ENV=production node server.js",
+  "start:api": "API_ONLY=true node server.js",
+  "test": "vitest",
+  "socket": "node server/server.js",
+  "serverBuild": "cd server && tsc"
+}
+```
+
+**Changes:**
+- `dev`: Runs Express + vite-express (serves Vite in dev mode)
+- `start`: Combined mode - serves dist/ + API
+- `start:api`: API-only mode for split deployment
+- Removed `preview` (use `start` instead)
+
+---
+
+## File Changes Summary
+
+| Action | File | Description |
+|--------|------|-------------|
+| Modify | `package.json` | Add dependencies, update scripts |
+| Modify | `server.js` | Full Express server with CORS + API routes |
+| Create | `server/api/index.js` | Main API router |
+| Create | `server/api/claude.js` | Claude API proxy endpoint |
+| Create | `src/util/apiConfig.ts` | API URL configuration utility |
+| Modify | `src/react/services/diagramAI.ts` | Use apiUrl() for API calls |
+| Modify | `vite.config.ts` | Remove `/api/claude` proxy block |
+
+---
+
+## How vite-express Works
+
+`vite-express` is a simple integration that:
+
+1. **Development**: Runs Vite's dev server as middleware, providing HMR
+2. **Production**: Serves the built `dist/` folder as static files
+
+This means:
+- One server handles both API and frontend
+- No CORS issues (same origin)
+- HMR works in development
+- Production-ready with `vite build`
+
+---
+
+## Production Deployment
+
+### Option A: Combined Deployment
+
+Single server handles both frontend and API:
+
+```bash
+# Build frontend
+npm run build
+
+# Start combined server (serves dist/ + API)
+npm run start
+```
+
+**Environment variables (.env)**:
+```bash
+PORT=3001
+ANTHROPIC_API_KEY=sk-ant-...
+```
+
+The Express server will:
+1. Handle `/api/*` routes directly
+2. Serve static files from `dist/`
+3. Fall back to `dist/index.html` for SPA routing
+
+### Option B: Split Deployment
+
+Separate hosting for frontend (CDN) and API (Node server):
+
+**API Server:**
+```bash
+# Start API-only server
+npm run start:api
+```
+
+**Environment variables (.env for API server)**:
+```bash
+PORT=3000
+API_ONLY=true
+ANTHROPIC_API_KEY=sk-ant-...
+ALLOWED_ORIGINS=https://your-frontend.com,https://www.your-frontend.com
+```
+
+**Frontend (Static Host):**
+```bash
+# Build with API URL configured
+VITE_API_URL=https://api.yourdomain.com npm run build
+
+# Deploy dist/ to your static host (Cloudflare Pages, Netlify, etc.)
+```
+
+**Environment variables (.env.production for frontend build)**:
+```bash
+VITE_API_URL=https://api.yourdomain.com
+```
+
+### Deployment Examples
+
+| Deployment | Frontend | API Server | Cost |
+|------------|----------|------------|------|
+| Combined | Railway | (same) | ~$5/mo |
+| Combined | Fly.io | (same) | Free tier |
+| Split | Cloudflare Pages (free) | Railway ($5/mo) | ~$5/mo |
+| Split | Netlify (free) | Fly.io (free) | Free |
+| Split | Vercel (free) | AWS Lambda | Pay-per-use |
+
+---
+
+## Future API Routes
+
+To add more API routes, create new files in `server/api/`:
+
+```javascript
+// server/api/index.js
+import claudeRouter from "./claude.js";
+import imagesRouter from "./images.js";  // future
+import authRouter from "./auth.js";      // future
+
+router.use("/claude", claudeRouter);
+router.use("/images", imagesRouter);
+router.use("/auth", authRouter);
+```
+
+---
+
+## Migration Order
+
+1. `npm install express vite-express dotenv cors`
+2. Create `server/api/index.js`
+3. Create `server/api/claude.js`
+4. Create `src/util/apiConfig.ts`
+5. Update `src/react/services/diagramAI.ts` to use `apiUrl()`
+6. Update `server.js` (root) with full Express + CORS setup
+7. Remove `/api/claude` proxy from `vite.config.ts`
+8. Update `package.json` scripts
+9. Test combined: `npm run dev` and verify Claude API works
+10. (Optional) Test split: Set `VITE_API_URL` and `API_ONLY=true`
+
+---
+
+## Notes
+
+- **WebSocket server unchanged**: `server/server.js` (port 8080) runs separately
+- **Minimal frontend changes**: Only `diagramAI.ts` updated to use `apiUrl()`
+- **Environment variables**: `ANTHROPIC_API_KEY` already in `.env.local`
+- **Node version**: Requires Node 18+ for native `fetch`
+- **CORS**: Only enabled when `ALLOWED_ORIGINS` is set (split deployment)
+- **Backward compatible**: Works as combined deployment by default

LICENSE.txt

@@ -0,0 +1,30 @@
+
+Permissions	Conditions	Limitations
+ Commercial use
+ Distribution
+ Modification
+ Private use
+ License and copyright notice
+ Liability
+ Warranty
+MIT License
+
+Copyright (c) [2024] [Michael Mainguy]
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

NEXT_MIGRATION_PLAN.md

@@ -0,0 +1,167 @@
+# Vite to Next.js Migration Plan
+
+## Goal
+Migrate from Vite to Next.js App Router to get proper API route support, with minimal changes to existing code.
+
+## Configuration
+- **Router**: App Router with `'use client'` on all pages
+- **Rendering**: CSR only (no SSR) - simplifies migration since BabylonJS can't SSR
+- **API Routes**: Claude API now, structured for future expansion
+- **External Proxies**: Keep sync/create-db/images as Next.js rewrites to deepdiagram.com
+
+---
+
+## Phase 1: Setup (No Breaking Changes)
+
+### 1.1 Install Next.js
+```bash
+npm install next
+```
+
+### 1.2 Create `next.config.js`
+```javascript
+/** @type {import('next').NextConfig} */
+const nextConfig = {
+  async rewrites() {
+    return [
+      { source: '/sync/:path*', destination: 'https://www.deepdiagram.com/sync/:path*' },
+      { source: '/create-db', destination: 'https://www.deepdiagram.com/create-db' },
+      { source: '/api/images', destination: 'https://www.deepdiagram.com/api/images' },
+    ];
+  },
+  webpack: (config, { isServer }) => {
+    config.experiments = { ...config.experiments, asyncWebAssembly: true };
+    return config;
+  },
+};
+module.exports = nextConfig;
+```
+
+### 1.3 Update `tsconfig.json`
+Add path alias:
+```json
+"baseUrl": ".",
+"paths": { "@/*": ["./*"] }
+```
+
+---
+
+## Phase 2: Create New Files
+
+### 2.1 `src/react/providers.tsx` (extract from webApp.tsx)
+- Move Auth0Provider and FeatureProvider wrapping here
+- Add `'use client'` directive
+- Handle window/document checks for SSR safety
+
+### 2.2 `app/layout.tsx`
+- Root layout with html/body tags
+- Metadata (title, favicon from current index.html)
+- Import global CSS
+
+### 2.3 `app/globals.css`
+```css
+@import '../src/react/styles.css';
+@import '@mantine/core/styles.css';
+```
+
+### 2.4 `app/api/claude/[...path]/route.ts`
+- POST handler that proxies to api.anthropic.com
+- Injects `ANTHROPIC_API_KEY` from env
+- Adds `x-api-key` and `anthropic-version` headers
+
+### 2.5 Page files (all with `'use client'`)
+| Route | File | Component |
+|-------|------|-----------|
+| `/` | `app/page.tsx` | About |
+| `/documentation` | `app/documentation/page.tsx` | Documentation |
+| `/examples` | `app/examples/page.tsx` | Examples |
+| `/pricing` | `app/pricing/page.tsx` | Pricing |
+| `/db/[visibility]/[db]` | `app/db/[visibility]/[db]/page.tsx` | VrExperience |
+| 404 | `app/not-found.tsx` | NotFound |
+
+### 2.6 `src/react/components/ProtectedPage.tsx`
+- Next.js version of route protection
+- Uses `useRouter` from `next/navigation` for redirects
+
+---
+
+## Phase 3: Modify Existing Files
+
+### 3.1 `src/react/pages/vrExperience.tsx`
+**Changes:**
+- Remove `useParams()` from react-router-dom
+- Accept `visibility` and `db` as props instead
+- Replace `useNavigate()` with `useRouter()` from `next/navigation`
+
+### 3.2 `src/react/pageHeader.tsx`
+**Changes:**
+- Replace `import {Link} from "react-router-dom"` with `import Link from "next/link"`
+- Change `to={item.href}` to `href={item.href}` on Link components
+
+### 3.3 `src/react/marketing/about.tsx`
+**Changes:**
+- Replace `useNavigate()` with `useRouter()` from `next/navigation`
+- Change `navigate('/path')` to `router.push('/path')`
+
+### 3.4 `package.json`
+```json
+"scripts": {
+  "dev": "next dev -p 3001",
+  "build": "node versionBump.js && next build",
+  "start": "next start -p 3001",
+  "test": "vitest",
+  "socket": "node server/server.js",
+  "serverBuild": "cd server && tsc"
+}
+```
+
+---
+
+## Phase 4: Delete Old Files
+
+| File | Reason |
+|------|--------|
+| `vite.config.ts` | Replaced by next.config.js |
+| `index.html` | Next.js generates HTML |
+| `src/webApp.ts` | Entry point no longer needed |
+| `src/react/webRouter.tsx` | Replaced by app/ routing |
+| `src/react/webApp.tsx` | Logic moved to providers.tsx |
+| `src/react/components/ProtectedRoute.tsx` | Replaced by ProtectedPage.tsx |
+
+---
+
+## Critical Files to Modify
+
+- `src/react/pages/vrExperience.tsx` - useParams -> props
+- `src/react/pageHeader.tsx` - react-router Link -> Next.js Link
+- `src/react/marketing/about.tsx` - useNavigate -> useRouter
+- `src/react/webApp.tsx` - extract to providers.tsx
+- `package.json` - scripts update
+- `tsconfig.json` - path aliases
+
+---
+
+## Migration Order
+
+1. Install next, create next.config.js
+2. Update tsconfig.json
+3. Create app/globals.css
+4. Create src/react/providers.tsx
+5. Create app/layout.tsx
+6. Create app/api/claude/[...path]/route.ts
+7. Create src/react/components/ProtectedPage.tsx
+8. Modify vrExperience.tsx (accept props)
+9. Create all app/*/page.tsx files
+10. Modify pageHeader.tsx (Next.js Link)
+11. Modify about.tsx (useRouter)
+12. Update package.json scripts
+13. Delete old files (vite.config.ts, index.html, webApp.ts, webRouter.tsx, webApp.tsx)
+14. Test all routes
+
+---
+
+## Notes
+
+- **Havok WASM**: Move `HavokPhysics.wasm` to `public/` folder
+- **react-router-dom**: Can be removed from dependencies after migration
+- **vite devDependencies**: Can be removed (vite, vite-plugin-cp)

ROADMAP.md

@@ -0,0 +1,224 @@
+# Immersive - Product Roadmap
+
+## Vision
+Transform immersive into an accessible, intuitive WebXR diagramming platform that delivers a frictionless onboarding experience and sustainable growth path.
+
+---
+
+## Phase 1: Onboarding & User Experience (Q1 2025)
+
+### 1.1 Frictionless Entry
+**Goal:** Reduce barriers to entry for new users
+
+- [ ] Redesign landing page to clearly guide users to immersive experience
+- [ ] Create one-click "Enter VR" / "Try Demo" workflow
+- [ ] Optimize initial load time and progressive loading
+- [ ] Add clear device compatibility messaging (desktop/VR)
+- [ ] Implement guest mode with no sign-in required for basic exploration
+
+### 1.2 Marketing Content
+**Goal:** Communicate value proposition effectively
+
+- [ ] Create 3-5 demo videos showcasing key features (30-60 seconds each)
+  - Creating a basic diagram
+  - VR interaction showcase
+  - Collaboration features
+  - Template usage
+- [ ] Develop tutorial video (2-3 minutes) explaining core workflows
+- [ ] Autoplay video carousel on landing page
+- [ ] Write marketing copy for landing page
+  - Hero section with clear value proposition
+  - Feature highlights
+  - Use case examples
+  - Call-to-action
+
+### 1.3 In-Experience Tutorial
+**Goal:** Replace external tutorial with immersive learning
+
+- [ ] Remove existing external tutorial system
+- [ ] Design in-VR tutorial experience with interactive steps
+- [ ] Implement progressive disclosure (teach as users interact)
+- [ ] Add contextual tooltips and hints in 3D space
+- [ ] Create "first-time user" detection and guided walkthrough
+- [ ] Add skip/replay tutorial options
+
+### 1.4 Template System
+**Goal:** Provide starting points for new users
+
+- [ ] Design template/example diagram system
+- [ ] Create 5-10 starter templates:
+  - Simple organizational chart
+  - Project workflow diagram
+  - Concept mapping example
+  - Architecture diagram
+  - Spatial layout example
+- [ ] Build template browser UI (2D and VR)
+- [ ] Implement "New from Template" workflow
+- [ ] Add template preview/thumbnail generation
+
+---
+
+## Phase 2: Collaboration & Sync (Q2 2025)
+
+### 2.1 Cross-Device Sharing
+**Goal:** Enable seamless content sharing between desktop and Quest
+
+- [ ] Research device-to-device sync options (WebRTC, local network)
+- [ ] Design sync architecture without backend dependency
+- [ ] Implement user content sync for signed-in users
+- [ ] Add fallback to server-based sync when needed
+- [ ] Create device pairing UI/workflow
+- [ ] Test sync reliability across desktop ↔ Quest
+- [ ] Add conflict resolution for simultaneous edits
+
+---
+
+## Phase 3: Immersion & Environment (Q2-Q3 2025)
+
+### 3.1 Audio Integration
+**Goal:** Enhance presence with ambient soundscapes
+
+- [ ] Source/create ambient audio assets
+  - Nature sounds (birds, wind, water)
+  - Office ambience
+  - Abstract/focus music
+- [ ] Implement spatial audio system
+- [ ] Add audio settings (volume, on/off, environment selection)
+- [ ] Create audio manager for seamless transitions
+- [ ] Add positional audio for collaboration (optional user voices)
+
+### 3.2 Environment System
+**Goal:** Provide varied immersive environments
+
+- [ ] Design environment switching architecture
+- [ ] Create environment presets:
+  - Outdoor/nature scene
+  - Modern office
+  - Abstract/minimal space
+  - Workshop/studio
+- [ ] Implement skybox and lighting variations
+- [ ] Build environment selector UI (2D and VR)
+- [ ] Optimize environment assets for performance
+- [ ] Add environment-specific audio pairing
+
+---
+
+## Phase 4: User Feedback & Polish (Q3 2025)
+
+### 4.1 In-VR Feedback Mechanism
+**Goal:** Enable users to provide feedback without leaving VR
+
+- [ ] Design in-VR feedback form/interface
+- [ ] Implement voice-to-text option (VR accessibility)
+- [ ] Add screenshot/recording attachment capability
+- [ ] Create feedback submission backend
+- [ ] Build feedback review dashboard
+- [ ] Add "Report Bug" quick action in VR menu
+
+### 4.2 Keyboard Improvements
+**Goal:** Improve text input experience
+
+- [ ] Test system keyboard integration (Quest/desktop)
+- [ ] Evaluate custom keyboard vs. native keyboard UX
+- [ ] Implement system keyboard fallback where supported
+- [ ] Optimize keyboard positioning in VR space
+- [ ] Add keyboard shortcuts for power users (desktop)
+
+---
+
+## Phase 5: Growth & Monetization (Q4 2025)
+
+### 5.1 Marketing Roadmap
+**Goal:** Build sustainable user acquisition
+
+- [ ] Define target audience segments
+  - Educators
+  - Remote teams
+  - Designers/architects
+  - Knowledge workers
+- [ ] Create content marketing strategy
+  - Blog posts on use cases
+  - Social media showcase
+  - Community building (Discord/Reddit)
+- [ ] Develop SEO optimization plan
+- [ ] Plan partnership outreach (VR communities, productivity tools)
+- [ ] Create referral/sharing incentives
+- [ ] Build analytics dashboard for user metrics
+
+### 5.2 Monetization Strategy
+**Goal:** Establish path to sustainability
+
+**Potential Revenue Streams:**
+- [ ] Freemium model research
+  - Free tier: Limited diagrams, basic features
+  - Pro tier: Unlimited diagrams, advanced features, collaboration
+- [ ] Team/Enterprise pricing
+  - Private deployment options
+  - Admin controls
+  - Priority support
+- [ ] Template marketplace
+  - Premium templates
+  - Community submissions (revenue share)
+- [ ] Educational licensing
+  - Institutional pricing
+  - Classroom management features
+
+**Implementation:**
+- [ ] Define pricing tiers and feature gates
+- [ ] Integrate payment processing (Stripe)
+- [ ] Build subscription management UI
+- [ ] Implement feature flags for tier differentiation
+- [ ] Create upgrade prompts and conversion flow
+- [ ] Add usage analytics for pricing optimization
+
+---
+
+## Success Metrics
+
+### Phase 1-2 (Onboarding)
+- Time to first diagram creation < 2 minutes
+- Tutorial completion rate > 60%
+- Return user rate (7-day) > 30%
+
+### Phase 3-4 (Engagement)
+- Average session duration > 15 minutes
+- User satisfaction score > 4/5
+- Feedback submission rate (active users) > 10%
+
+### Phase 5 (Growth)
+- Monthly active users growth > 20% MoM
+- Free-to-paid conversion rate > 5%
+- Customer acquisition cost < lifetime value
+
+---
+
+## Technical Debt & Infrastructure
+
+### Ongoing Priorities
+- [ ] Migration from legacy ConfigType to AppConfig
+- [ ] Performance optimization (target 90fps in VR)
+- [ ] Accessibility improvements (WCAG compliance)
+- [ ] Testing coverage > 70%
+- [ ] Documentation for contributors
+- [ ] CI/CD pipeline enhancements
+
+---
+
+## Notes
+
+**Dependencies:**
+- Auth0 for user authentication
+- PouchDB/CouchDB for data persistence
+- BabylonJS 8.x for rendering
+- Vite for build tooling
+
+**Platform Support:**
+- Desktop browsers (Chrome, Firefox, Edge)
+- Meta Quest 2/3/Pro
+- Future: PSVR2, Vision Pro (evaluate demand)
+
+**Review Cadence:** Quarterly roadmap review and adjustment based on user feedback and metrics.
+
+---
+
+*Last Updated: 2025-11-19*

SHARING_PLAN.md

@@ -0,0 +1,150 @@
+# Self-Hosted Diagram Sharing with Express-PouchDB
+
+## Requirements (Confirmed)
+- **Storage**: In-memory (ephemeral) - lost on server restart
+- **Content**: Copy current diagram entities when creating share
+- **Expiration**: No expiration - links work until server restart
+- **Encryption**: None - keep it simple, anyone with link can access
+
+## Architecture
+
+```
+┌─────────────────────────────────────────────────┐
+│           Express Server (port 3001)             │
+├─────────────────────────────────────────────────┤
+│  /api/share/*     → Share management API         │
+│  /pouchdb/*       → express-pouchdb (sync)       │
+│  /share/:uuid     → Client share route           │
+│  /api/*           → Existing API routes          │
+│  /*               → Vite static files            │
+└─────────────────────────────────────────────────┘
+         │
+         └── In-Memory PouchDB (per share UUID)
+```
+
+## Implementation Steps
+
+### Phase 1: Server-Side Setup
+
+#### 1.1 Add Dependencies
+```bash
+npm install express-pouchdb pouchdb-adapter-memory
+```
+
+#### 1.2 Create PouchDB Server Service
+**New file: `server/services/pouchdbServer.js`**
+- Initialize PouchDB with memory adapter
+- Track active share databases in a Map
+- Export `getShareDB(shareId)`, `shareExists(shareId)`, `createPouchDBMiddleware()`
+
+#### 1.3 Create Share API
+**New file: `server/api/share.js`**
+- `POST /api/share/create` - Generate UUID, create in-memory DB, copy entities
+- `GET /api/share/:id/exists` - Check if share exists
+- `GET /api/share/stats` - Debug endpoint for active shares
+
+#### 1.4 Update API Router
+**Edit: `server/api/index.js`**
+- Add `import shareRouter from "./share.js"`
+- Mount at `router.use("/share", shareRouter)`
+
+#### 1.5 Mount Express-PouchDB
+**Edit: `server.js`**
+- Import `createPouchDBMiddleware` from pouchdbServer.js
+- Mount at `app.use("/pouchdb", createPouchDBMiddleware())`
+
+---
+
+### Phase 2: Client-Side Integration
+
+#### 2.1 Update URL Parsing
+**Edit: `src/util/functions/getPath.ts`**
+- Add `getPathInfo()` function returning `{ dbName, isShare, shareId }`
+- Detect `/share/:uuid` pattern
+
+#### 2.2 Update PouchDB Persistence Manager
+**Edit: `src/integration/database/pouchdbPersistenceManager.ts`**
+
+In `initLocal()`:
+- Call `getPathInfo()` to detect share URLs
+- If share: use `share-{uuid}` as local DB name, call `beginShareSync()`
+
+Add new method `beginShareSync(shareId)`:
+- Check share exists via `/api/share/:id/exists`
+- Connect to `${origin}/pouchdb/share-${shareId}`
+- Set up presence with `share-${shareId}` as DB name
+- Begin live sync (no encryption)
+
+#### 2.3 Add React Route
+**Edit: `src/react/webRouter.tsx`**
+- Add route `{ path: "/share/:uuid", element: <VrExperience isShare={true} /> }`
+- No ProtectedRoute wrapper (public access)
+
+#### 2.4 Add Share Button Handler
+**Edit: `src/react/pages/vrExperience.tsx`**
+- Add `isShare` prop
+- Add `handleShare()` function:
+  1. Get all entities from local PouchDB
+  2. POST to `/api/share/create` with entities
+  3. Copy resulting URL to clipboard
+  4. Show confirmation
+
+---
+
+### Phase 3: Presence Integration
+
+The WebSocket presence system already routes by database name. Since shares use `share-{uuid}` as the database name, presence works automatically.
+
+**Edit: `server/server.js`** (WebSocket server)
+- Update `originIsAllowed()` to allow localhost for development
+
+---
+
+## Files to Modify
+
+| File | Action | Purpose |
+|------|--------|---------|
+| `package.json` | Edit | Add express-pouchdb, pouchdb-adapter-memory |
+| `server.js` | Edit | Mount /pouchdb middleware |
+| `server/api/index.js` | Edit | Add share router |
+| `server/services/pouchdbServer.js` | Create | PouchDB memory initialization |
+| `server/api/share.js` | Create | Share API endpoints |
+| `server/server.js` | Edit | Allow localhost origins |
+| `src/util/functions/getPath.ts` | Edit | Add getPathInfo() |
+| `src/integration/database/pouchdbPersistenceManager.ts` | Edit | Add share sync logic |
+| `src/react/webRouter.tsx` | Edit | Add /share/:uuid route |
+| `src/react/pages/vrExperience.tsx` | Edit | Add share button handler |
+| `src/util/featureConfig.ts` | Edit | Enable shareCollaborate feature |
+
+---
+
+## User Flow
+
+### Creating a Share
+1. User has a diagram open at `/db/public/mydiagram`
+2. Clicks "Share" button
+3. Client fetches all entities from local PouchDB
+4. POSTs to `/api/share/create` with entities
+5. Server creates in-memory DB, copies entities, returns UUID
+6. Client copies `https://server.com/share/{uuid}` to clipboard
+7. User shares link with collaborators
+
+### Joining a Share
+1. User navigates to `https://server.com/share/{uuid}`
+2. React Router renders VrExperience with `isShare=true`
+3. PouchdbPersistenceManager detects share URL
+4. Checks `/api/share/:uuid/exists` - returns true
+5. Creates local PouchDB `share-{uuid}`
+6. Connects to `/pouchdb/share-{uuid}` for sync
+7. Entities replicate to local, render in scene
+8. Presence WebSocket connects with `share-{uuid}` as room
+
+---
+
+## Future Authentication (Not Implemented Now)
+
+Structure allows easy addition later:
+- express-pouchdb middleware can be wrapped with auth middleware
+- Share API can require JWT/session tokens
+- Could add password-protected shares
+- Could add read-only vs read-write permissions

SYNC_PLAN.md

@@ -0,0 +1,179 @@
+# Future Sync Strategy: Keeping Local and Public Clones in Sync
+
+## Current State (v1)
+
+- Sharing creates a **ONE-TIME COPY** from local to public
+- Copies diverge independently after sharing
+- No automatic sync between local and public versions
+- Local diagrams are browser-only (IndexedDB via PouchDB)
+- Public diagrams sync with server via express-pouchdb
+
+### URL Scheme
+
+| Route | Sync | Access | Status |
+|-------|------|--------|--------|
+| `/db/local/:id` | None | Browser-only | Implemented |
+| `/db/public/:id` | Yes | Anyone | Implemented |
+| `/db/private/:id` | Yes | Authorized users | Route only (no auth) |
+
+## Future Options
+
+### Option 1: Manual Push/Pull (Recommended for v2)
+
+Add explicit user-triggered sync between local and public copies.
+
+**Features:**
+- "Push to Public" button - sends local changes to public copy
+- "Pull from Public" button - gets public changes into local
+- Track `lastSyncedAt` timestamp
+- Show indicator when copies have diverged
+- Conflict resolution: Last write wins (simple) or user choice (advanced)
+
+**Pros:**
+- User stays in control
+- Clear mental model
+- Simple to implement incrementally
+
+**Cons:**
+- Manual effort required
+- Risk of forgetting to sync
+
+### Option 2: Automatic Background Sync
+
+Continuous bidirectional sync between local and public copies.
+
+**Features:**
+- Real-time sync like Google Docs
+- Works across devices
+- Offline-first with automatic merge
+
+**Pros:**
+- Seamless experience
+- Always up to date
+
+**Cons:**
+- Complex conflict resolution (may need CRDTs)
+- Higher performance overhead
+- Harder to reason about state
+
+### Option 3: Fork/Branch Model
+
+One-way relationship: local is "draft", public is "published".
+
+**Features:**
+- Push only (local → public)
+- No pull mechanism
+- Public is the "source of truth" once published
+
+**Pros:**
+- Clear mental model
+- No merge conflicts
+- Simple implementation
+
+**Cons:**
+- Cannot incorporate public changes back to local
+- Multiple people can't collaborate on draft
+
+## Recommended Implementation (v2)
+
+Implement **Option 1 (Manual Push/Pull)** as it provides the best balance of user control and simplicity.
+
+### Data Model Changes
+
+Add to diagram directory entry:
+```typescript
+interface DiagramEntry {
+  _id: string;
+  name: string;
+  description: string;
+  storageType: 'local' | 'public' | 'private';
+  createdAt: string;
+
+  // New fields for sync tracking
+  publicCopyId?: string;      // ID of the public clone (if shared)
+  lastPushedAt?: string;      // When changes were last pushed to public
+  lastPulledAt?: string;      // When public changes were last pulled
+  publicVersion?: number;     // Version number of public copy at last sync
+}
+```
+
+### API Endpoints
+
+```typescript
+// Push local changes to public
+POST /api/sync/push
+Body: { localDbName: string, publicDbName: string }
+Response: { success: boolean, documentsUpdated: number }
+
+// Pull public changes to local
+POST /api/sync/pull
+Body: { localDbName: string, publicDbName: string }
+Response: { success: boolean, documentsUpdated: number }
+
+// Check if copies have diverged
+GET /api/sync/status?local={localDbName}&public={publicDbName}
+Response: {
+  diverged: boolean,
+  localChanges: number,
+  publicChanges: number,
+  lastSyncedAt: string
+}
+```
+
+### UI Components
+
+1. **Sync Status Indicator**
+   - Shows in header when viewing a local diagram that has a public copy
+   - Green check: In sync
+   - Orange dot: Changes pending
+   - Red warning: Conflicts detected
+
+2. **Push/Pull Buttons**
+   - In hamburger menu under "Share" section
+   - "Push to Public" - shows confirmation with change count
+   - "Pull from Public" - shows confirmation with change count
+
+3. **Divergence Warning Badge**
+   - Shows on diagram card in Manage Diagrams modal
+   - Indicates when local and public have diverged
+
+4. **Conflict Resolution Dialog**
+   - Shows when both local and public have changes to same entity
+   - Options: Keep Local, Keep Public, Keep Both (creates duplicate)
+
+### Implementation Phases
+
+**Phase 1: Tracking**
+- Add `publicCopyId` when sharing local → public
+- Track sharing relationship in directory
+
+**Phase 2: Push**
+- Implement push from local to public
+- Overwrite public with local changes
+- Update `lastPushedAt` timestamp
+
+**Phase 3: Pull**
+- Implement pull from public to local
+- Merge public changes into local
+- Update `lastPulledAt` timestamp
+
+**Phase 4: Status**
+- Implement divergence detection
+- Add UI indicators
+- Show sync status in Manage Diagrams
+
+**Phase 5: Conflict Resolution**
+- Detect entity-level conflicts
+- Show resolution dialog
+- Allow user to choose resolution strategy
+
+## Migration Notes
+
+Existing diagrams without `storageType` are treated as `public` for backwards compatibility. When such diagrams are loaded, the UI should work correctly but sync tracking features won't be available until the diagram metadata is updated.
+
+## Security Considerations
+
+- Push/pull operations should validate that the user has access to both databases
+- Public databases remain world-readable/writable
+- Private database sync will require authentication tokens
+- Rate limiting should be applied to sync operations

VRCONFIGPLAN.md

@@ -0,0 +1,297 @@
+# VR Configuration Panel Implementation Plan
+
+## Overview
+
+Create an immersive WebXR configuration panel that mirrors the 2D ConfigModal functionality using BabylonJS AdvancedDynamicTexture (ADT). The panel will allow users to adjust all application settings directly in VR.
+
+## Recommended Approach: AdvancedDynamicTexture (ADT)
+
+**Why ADT?**
+- Most common approach for WebXR UI in BabylonJS
+- Existing pattern in codebase (see `src/menus/configMenu.ts`)
+- Good balance of simplicity and functionality
+- Native support for text, buttons, sliders, and dropdowns
+- Easy integration with existing Handle pattern
+
+**Estimated Effort**: 150-200 lines of code, 4-8 hours implementation time
+
+## File Structure
+
+```
+src/menus/
+├── vrConfigPanel.ts (NEW - main implementation)
+└── configMenu.ts (REFERENCE - existing VR config example)
+
+src/diagram/
+└── diagramMenuManager.ts (MODIFY - add toolbox button)
+
+src/util/
+└── appConfig.ts (USE - singleton for config management)
+```
+
+## Implementation Phases
+
+### Phase 1: Core Panel Setup
+- [ ] Create `src/menus/vrConfigPanel.ts` file
+- [ ] Implement class structure following Handle pattern:
+  ```typescript
+  export class VRConfigPanel {
+      private _scene: Scene;
+      private _handleMesh: Mesh;
+      private _advancedTexture: AdvancedDynamicTexture;
+      private _configObserver: Observer<AppConfigType>;
+
+      constructor(scene: Scene) {
+          // Initialize panel
+      }
+
+      public get handleMesh(): Mesh {
+          return this._handleMesh;
+      }
+
+      public show(): void {
+          this._handleMesh.setEnabled(true);
+      }
+
+      public hide(): void {
+          this._handleMesh.setEnabled(false);
+      }
+
+      public dispose(): void {
+          // Cleanup
+      }
+  }
+  ```
+- [ ] Create base mesh (plane) for panel backing
+- [ ] Set up AdvancedDynamicTexture with appropriate resolution (1024x1024 or 2048x2048)
+- [ ] Position panel at comfortable viewing distance (0.5-0.7m from camera)
+- [ ] Make panel grabbable via Handle pattern
+
+**Reference Files**:
+- `src/menus/inputTextView.ts` - Handle pattern implementation
+- `src/menus/configMenu.ts` - ADT usage example
+
+### Phase 2: UI Layout Structure
+- [ ] Create main container (StackPanel for vertical layout)
+- [ ] Add title text at top ("Configuration")
+- [ ] Create 5 section containers (one for each config group):
+  1. Location Snap
+  2. Rotation Snap
+  3. Fly Mode
+  4. Snap Turn
+  5. Label Rendering Mode
+- [ ] Style containers with padding and spacing
+- [ ] Add visual separators between sections
+
+**ADT Components to Use**:
+- `StackPanel` - Main vertical container
+- `TextBlock` - Labels and section titles
+- `Rectangle` - Containers and separators
+
+**Reference**: `src/menus/configMenu.ts:44-89` for existing layout patterns
+
+### Phase 3: Location Snap Section
+- [ ] Add "Location Snap" label
+- [ ] Create enable/disable toggle button
+  - Shows "Enabled" or "Disabled"
+  - Updates `appConfigInstance` on click
+- [ ] Add RadioGroup for snap values:
+  - Options: 1cm (.01), 5cm (.05), 10cm (.1), 50cm (.5), 1m (1)
+  - Default: 10cm (.1)
+  - Disable when snap is off
+- [ ] Wire up to `appConfigInstance.setGridSnap(value)`
+- [ ] Subscribe to config changes to update UI
+
+**ADT Components**:
+- `Button` - Toggle switch
+- `RadioButton` + `TextBlock` - Value selection
+- Color coding: enabled (green/myColor), disabled (gray)
+
+**Reference ConfigModal**: `src/react/pages/configModal.tsx:83-94`
+
+### Phase 4: Rotation Snap Section
+- [ ] Add "Rotation Snap" label
+- [ ] Create enable/disable toggle button
+- [ ] Add RadioGroup for rotation values:
+  - Options: 22.5°, 45°, 90°, 180°, 360°
+  - Default: 90°
+  - Disable when snap is off
+- [ ] Wire up to `appConfigInstance.setRotateSnap(value)`
+- [ ] Subscribe to config changes to update UI
+
+**Reference ConfigModal**: `src/react/pages/configModal.tsx:96-108`
+
+### Phase 5: Fly Mode Section
+- [ ] Add "Fly Mode" label
+- [ ] Create toggle button
+  - Shows "Fly Mode Enabled" or "Fly Mode Disabled"
+- [ ] Wire up to `appConfigInstance.setFlyMode(value)`
+- [ ] Subscribe to config changes to update UI
+
+**Reference ConfigModal**: `src/react/pages/configModal.tsx:109-112`
+
+### Phase 6: Snap Turn Section
+- [ ] Add "Snap Turn" label
+- [ ] Create enable/disable toggle button
+- [ ] Add RadioGroup for snap turn angles:
+  - Options: 22.5°, 45°, 90°, 180°, 360°
+  - Default: 45°
+  - Disable when snap is off
+- [ ] Wire up to `appConfigInstance.setTurnSnap(value)`
+- [ ] Subscribe to config changes to update UI
+
+**Reference ConfigModal**: `src/react/pages/configModal.tsx:113-125`
+
+### Phase 7: Label Rendering Mode Section
+- [ ] Add "Label Rendering Mode" label
+- [ ] Create RadioGroup for rendering modes:
+  - Fixed
+  - Billboard (Always Face Camera)
+  - Dynamic (Coming Soon) - disabled
+  - Distance-based (Coming Soon) - disabled
+- [ ] Wire up to `appConfigInstance.setLabelRenderingMode(value)`
+- [ ] Subscribe to config changes to update UI
+- [ ] Style disabled options with gray text
+
+**Reference ConfigModal**: `src/react/pages/configModal.tsx:126-135`
+
+### Phase 8: Integration with Toolbox
+- [ ] Modify `src/diagram/diagramMenuManager.ts` to instantiate VRConfigPanel
+- [ ] Add "Config" button to toolbox (similar to "Exit VR" button pattern)
+- [ ] Wire up button click to show/hide panel
+- [ ] Position panel relative to camera when shown (see `positionComponentsRelativeToCamera`)
+- [ ] Add parent relationship to platform for movement tracking
+
+**Reference**:
+- `src/diagram/diagramMenuManager.ts:85-97` - Exit button creation
+- `src/util/functions/groundMeshObserver.ts:127-222` - Component positioning
+
+### Phase 9: Observable Integration
+- [ ] Subscribe to `appConfigInstance.onConfigChangedObservable` in constructor
+- [ ] Update all UI elements when config changes externally
+- [ ] Ensure Observable cleanup in dispose() method
+- [ ] Test config changes from both VR panel and 2D ConfigModal
+
+**Pattern**:
+```typescript
+this._configObserver = appConfigInstance.onConfigChangedObservable.add((config) => {
+    // Update UI elements to reflect new config
+    this.updateLocationSnapUI(config.locationSnap);
+    this.updateRotationSnapUI(config.rotateSnap);
+    // ... etc
+});
+```
+
+### Phase 10: Testing & Polish
+- [ ] Test all toggle switches update config correctly
+- [ ] Test all radio button selections update config correctly
+- [ ] Verify config changes propagate to DiagramObjects (label mode, snap behavior)
+- [ ] Test panel positioning in VR (comfortable viewing distance)
+- [ ] Test panel grabbability via Handle
+- [ ] Verify panel follows platform movement
+- [ ] Test config persistence (localStorage)
+- [ ] Test config synchronization between VR panel and 2D ConfigModal
+- [ ] Add visual feedback for button clicks (color changes, animations)
+- [ ] Ensure proper cleanup on panel disposal
+- [ ] Test in both WebXR and desktop modes
+
+## Code Patterns to Follow
+
+### 1. Toggle Button Pattern
+```typescript
+const toggleButton = Button.CreateSimpleButton("toggle", "Enabled");
+toggleButton.width = "200px";
+toggleButton.height = "40px";
+toggleButton.color = "white";
+toggleButton.background = "green";
+toggleButton.onPointerClickObservable.add(() => {
+    const newValue = !currentValue;
+    toggleButton.textBlock.text = newValue ? "Enabled" : "Disabled";
+    toggleButton.background = newValue ? "green" : "gray";
+    appConfigInstance.setSomeSetting(newValue);
+});
+```
+
+### 2. RadioGroup Pattern
+```typescript
+const radioGroup = new SelectionPanel("snapValues");
+const options = [
+    { value: 0.01, label: "1cm" },
+    { value: 0.1, label: "10cm" },
+    // ... more options
+];
+
+options.forEach(option => {
+    const radio = new RadioButton();
+    radio.width = "20px";
+    radio.height = "20px";
+    radio.isChecked = (option.value === currentValue);
+    radio.onIsCheckedChangedObservable.add((checked) => {
+        if (checked) {
+            appConfigInstance.setGridSnap(option.value);
+        }
+    });
+    // Add label next to radio button
+});
+```
+
+### 3. Config Observer Pattern
+```typescript
+this._configObserver = appConfigInstance.onConfigChangedObservable.add((config) => {
+    this.updateUIFromConfig(config);
+});
+
+// In dispose():
+if (this._configObserver) {
+    appConfigInstance.onConfigChangedObservable.remove(this._configObserver);
+}
+```
+
+## Key Integration Points
+
+### AppConfig Singleton
+- Import: `import {appConfigInstance} from "../util/appConfig";`
+- Read: `appConfigInstance.current.locationSnap`
+- Write: `appConfigInstance.setGridSnap(0.1)`
+- Subscribe: `appConfigInstance.onConfigChangedObservable.add(callback)`
+
+### DiagramMenuManager
+- Instantiate panel: `this._vrConfigPanel = new VRConfigPanel(this._scene);`
+- Add button to toolbox: Follow exit button pattern in `setupExitButton()`
+- Show panel: `this._vrConfigPanel.show();`
+- Position panel: Follow pattern in `groundMeshObserver.ts:127-222`
+
+### Handle Pattern
+- Make panel grabbable by controllers
+- Parent to platform for world movement
+- Use `_handleMesh` as root for entire panel UI
+
+## Reference Files
+
+1. **src/menus/configMenu.ts** - Existing VR config implementation with ADT
+2. **src/menus/inputTextView.ts** - Handle pattern and ADT setup
+3. **src/react/pages/configModal.tsx** - UI structure and config sections
+4. **src/util/appConfig.ts** - Config singleton and setter methods
+5. **src/diagram/diagramMenuManager.ts** - Toolbox button creation
+6. **src/util/functions/groundMeshObserver.ts** - Component positioning
+
+## Success Criteria
+
+- [ ] All 5 config sections implemented and functional
+- [ ] Config changes in VR panel update appConfigInstance
+- [ ] Config changes propagate to all DiagramObjects
+- [ ] Panel is grabbable and repositionable
+- [ ] Panel follows platform movement
+- [ ] Config persists to localStorage
+- [ ] Synchronized with 2D ConfigModal
+- [ ] Comfortable viewing experience in VR
+- [ ] No memory leaks (proper Observable cleanup)
+
+## Notes
+
+- Start hidden (only show when user clicks toolbox button)
+- Position at ~0.5m in front of camera when opened
+- Use Y-axis billboard mode to keep panel upright but allow rotation
+- Consider adding "Close" button at bottom of panel
+- Match color scheme with existing UI (myColor theme)
+- Test with both left and right controller grabbing

docs/NAMING_CONVENTIONS.md

@@ -0,0 +1,138 @@
+# Naming Conventions
+
+## Tool and Material Naming
+
+This document describes the naming conventions used for tools, materials, and related entities in the immersive WebXR application.
+
+## Material Naming
+
+Materials follow a consistent naming pattern based on their color:
+
+**Format:** `material-{color}`
+
+**Where:**
+- `{color}` is the hex string representation of the material's color (e.g., `#ff0000` for red)
+
+**Examples:**
+- `material-#ff0000` - Red material
+- `material-#00ff00` - Green material
+- `material-#222222` - Dark gray material
+
+**Implementation:**
+```typescript
+const material = new StandardMaterial("material-" + color.toHexString(), scene);
+```
+
+**Location:** Materials are created in:
+- `src/toolbox/functions/buildColor.ts` - For toolbox color swatches
+- `src/diagram/functions/buildMeshFromDiagramEntity.ts` - Fallback material creation via `buildMissingMaterial()`
+
+## Tool Mesh Naming
+
+Tool meshes use a compound naming pattern that includes both the tool type and color:
+
+**Format:** `tool-{toolId}`
+
+**Where:**
+- `{toolId}` = `{toolType}-{color}`
+- `{toolType}` is a value from the `ToolType` enum (e.g., `BOX`, `SPHERE`, `CYLINDER`, `CONE`, `PLANE`, `PERSON`)
+- `{color}` is the hex string representation of the tool's color
+
+**Examples:**
+- `tool-BOX-#ff0000` - Red box tool
+- `tool-SPHERE-#00ff00` - Green sphere tool
+- `tool-CYLINDER-#0000ff` - Blue cylinder tool
+- `tool-PLANE-#ffff00` - Yellow plane tool
+
+**Implementation:**
+```typescript
+function toolId(tool: ToolType, color: Color3) {
+    return tool + "-" + color.toHexString();
+}
+
+const newItem = await buildMesh(tool, `tool-${id}`, colorParent.getScene());
+// For example: `tool-BOX-#ff0000`
+```
+
+**Location:** Tool meshes are created in `src/toolbox/functions/buildTool.ts`
+
+## Tool Colors
+
+The application uses 16 predefined colors for the toolbox:
+
+```typescript
+const colors: string[] = [
+    "#222222", "#8b4513", "#006400", "#778899",  // Row 1: Dark gray, Brown, Dark green, Light slate gray
+    "#4b0082", "#ff0000", "#ffa500", "#ffff00",  // Row 2: Indigo, Red, Orange, Yellow
+    "#00ff00", "#00ffff", "#0000ff", "#ff00ff",  // Row 3: Green, Cyan, Blue, Magenta
+    "#1e90ff", "#98fb98", "#ffe4b5", "#ff69b4"   // Row 4: Dodger blue, Pale green, Moccasin, Hot pink
+]
+```
+
+## Tool Types
+
+Available tool types from the `ToolType` enum:
+- `BOX` - Cube mesh
+- `SPHERE` - Sphere mesh
+- `CYLINDER` - Cylinder mesh
+- `CONE` - Cone mesh
+- `PLANE` - Flat plane mesh
+- `PERSON` - Person/avatar mesh
+
+## Material Color Access
+
+When accessing material colors, use this priority order to handle both current and legacy materials:
+
+```typescript
+// For StandardMaterial
+const stdMat = material as StandardMaterial;
+const materialColor = stdMat.emissiveColor || stdMat.diffuseColor;
+
+// Current rendering uses emissiveColor
+// Legacy materials may have diffuseColor instead
+```
+
+## Rendering Modes
+
+Materials can be rendered in three different modes, affecting how color properties are used:
+
+### 1. Lightmap with Lighting
+- Uses `diffuseColor` + `lightmapTexture`
+- `disableLighting = false`
+- Most expensive performance-wise
+- Provides lighting illusion with actual lighting calculations
+
+### 2. Unlit with Emissive Texture (Default)
+- Uses `emissiveColor` + `emissiveTexture` (lightmap)
+- `disableLighting = true`
+- Best balance of visual quality and performance
+- Provides lighting illusion without lighting calculations
+
+### 3. Flat Emissive
+- Uses only `emissiveColor`
+- `disableLighting = true`
+- Best performance
+- No lighting illusion, flat shading
+
+## Instance Naming
+
+Instanced meshes (created from tool templates) follow this pattern:
+
+**Format:** `tool-instance-{toolId}`
+
+**Example:**
+```typescript
+const instance = new InstancedMesh("tool-instance-" + id, newItem);
+// For example: `tool-instance-BOX-#ff0000`
+```
+
+These instances share materials with their source mesh and are used for visual feedback before creating actual diagram entities.
+
+## Related Files
+
+- `src/toolbox/functions/buildTool.ts` - Tool mesh creation and naming
+- `src/toolbox/functions/buildColor.ts` - Material creation and color management
+- `src/diagram/functions/buildMeshFromDiagramEntity.ts` - Diagram entity instantiation
+- `src/toolbox/types/toolType.ts` - ToolType enum definition
+- `src/util/lightmapGenerator.ts` - Lightmap texture generation and caching
+- `src/util/renderingMode.ts` - Rendering mode enum and labels

index.html

@@ -2,95 +2,58 @@
 <html>
 <head>
     <meta charset="UTF-8">
-  <title>Deep Diagram</title>
+    <meta content="width=device-width, initial-scale=1" name="viewport"/>
+    <meta content="An immersive vr diagramming experience based using webxr version 0.0.8-14 (2024-12-29Z)"
+          name="description">
+    <meta content="width=device-width, initial-scale=1, height=device-height" name="viewport">
+    <!--<link href="/styles.css" rel="stylesheet"> -->
+    <link href="/assets/dasfad/favicon-32x32.png" rel="icon" sizes="32x32" type="image/png">
+    <link href="/assets/dasfad/favicon-16x16.png" rel="icon" sizes="16x16" type="image/png">
+    <link href="/assets/dasfad/favicon-96x96.png" rel="icon" sizes="96x96" type="image/png">
+    <link as="fetch" href="/node_modules/.vite/deps/HavokPhysics.wasm" rel="preload">
+    <title>DASFAD</title>
+    <!--    <link as="script" href="/newRelic.js" rel="preload">
+        <script defer src="/newRelic.js"></script> -->
+
+
+    <link href="/manifest.webmanifest" rel="manifest"/>
+    <!--<script src='/niceware.js'></script>-->
     <style>
-    body {
-
-    }
-
-    .loader {
-      position: fixed;
-      left: 0px;
-      top: 0px;
-      width: 200px;
-      height: 200px;
-      display: flex;
-      justify-content: center;
-      align-content: center;
-      flex-direction: column;
-      z-index: -1;
-      /*noinspection CssUnknownTarget*/
-      background: url("/spinner.gif");
-      background-position: center;
-      background-repeat: no-repeat;
-      text-align: center;
-
-    }
-
-    #questLaunch {
-      position: fixed;
-      top: 30px;
-      right: 30px;
-      padding: 10px;
-      background: #000;
-      color: #fff;
-      font-size: 1.5em;
-      z-index: 100;
-    }
-
-    #download {
-      position: fixed;
-      z-index: 11;
-      width: 200px;
-      height: 20px;
-      position: absolute;
-      bottom: 50px;
-      left: 16px;
-      padding: 10px;
-      background: #000;
-      color: #fff;
-    }
 
     </style>
-  <link as="script" href="/newRelic.js" rel="preload">
-  <script src="/newRelic.js"></script>
-  <meta content="width=device-width, initial-scale=1, height=device-height" name="viewport">
-  <meta content="An immersive vr diagramming experience based on a-frame and webxr" name="description">
-  <link href="/assets/favicon-16x16.png" rel=icon sizes="16x16" type="image/png">
-  <link href="/assets/favicon-32x32.png" rel=icon sizes="32x32" type="image/png">
-  <link href="/assets/favicon-96x96.png" rel=icon sizes="96x96" type="image/png">
-  <link href="/manifest.webmanifest" rel="manifest"/>
-  <script src='/niceware.js'></script>
 </head>
 <body>
-<!--<div class="loader" id="loader">Loading...</div> -->
+
-<div id="questLaunch"><a href="https://www.oculus.com/open_url/?url=https://www.deepdiagram.com/" target="_blank">Launch
-  On Quest</a>
-</div>
-<div id="download"><a href="#" id="downloadLink">Download Model</a></div>
 <script>
-  /*
+
-  var SpeechRecognition = SpeechRecognition || webkitSpeechRecognition
+    /* if (typeof navigator.serviceWorker !== 'undefined') {
-  var SpeechGrammarList = SpeechGrammarList || window.webkitSpeechGrammarList
+
-  var SpeechRecognitionEvent = SpeechRecognitionEvent || webkitSpeechRecognitionEvent
+
-  var recognition = new SpeechRecognition();
+         if (localStorage.getItem('serviceWorkerVersion') !== '11') {
-  recognition.continuous = false;
+             caches.keys().then(cacheNames => {
-  recognition.lang = 'en-US';
+                 cacheNames.forEach(cacheName => {
-  recognition.interimResults = true;
+                     caches.delete(cacheName);
-  recognition.maxAlternatives = 1;
+                 });
-  recognition.onresult = function(event) {
+             });
-    console.log(event.results[0][0].transcript);
+             localStorage.setItem('serviceWorkerVersion', '11');
          }
-  recognition.onend = function() {
+         navigator.serviceWorker.register('/sw.js', {updateViaCache: 'none'});
-    console.log("recognition ended");
-    recognition.start();
      }
-  console.log("starting recognition");
-  recognition.start();
 
      */
-
 </script>
-<script type="module" src="./src/app.ts"></script>
+<div class="webApp" id="webApp">
+
+</div>
+<script defer src="/src/webApp.ts" type="module"></script>
+
+<!--<video id="feed" controls="" autoplay="" name="media"><source src="https://listen.broadcastify.com/1drb2xhywkg8nvz.mp3?nc=49099&amp;xan=xtf9912b41c" type="audio/mpeg"></video> -->
+<!--
+<div class="scene">
+    <canvas id="gameCanvas"></canvas>
+</div>
+-->
+<!--<script defer src="/src/vrApp.ts" type="module"></script>-->
 </body>
+
 </html>

netlify/functions/nerdgraph/nerdgraph.ts

@@ -1,49 +0,0 @@
-import {Handler, HandlerContext, HandlerEvent} from "@netlify/functions";
-import axios from 'axios';
-
-export const handler: Handler = async (event: HandlerEvent, context: HandlerContext) => {
-    try {
-        switch (event.httpMethod) {
-            case 'POST':
-                const apiKey = event.headers['api-key'];
-                const query = event.body;
-                const response = await axios.post('https://api.newrelic.com/graphql',
-                    query,
-                    {headers: {'Api-Key': apiKey, 'Content-Type': 'application/json'}});
-                const data = await response.data;
-                return {
-                    headers: {
-                        'Content-Type': 'application/json',
-                        'Access-Control-Allow-Origin': 'https://cameras.immersiveidea.com',
-                        'Access-Control-Allow-Credentials': 'true'
-                    },
-                    statusCode: 200,
-                    body: JSON.stringify(data)
-                }
-                break;
-            case 'OPTIONS':
-                const headers = {
-                    'Access-Control-Allow-Origin': 'https://cameras.immersiveidea.com',
-                    'Access-Control-Allow-Credentials': 'true',
-                    'Access-Control-Allow-Headers': 'content-type, api-key',
-                    'Access-Control-Allow-Methods': 'GET, POST, PUT, DELETE'
-                };
-                return {
-                    statusCode: 204,
-                    headers
-                }
-                break;
-            default:
-                return {
-                    statusCode: 405,
-                    body: 'Method Not Allowed'
-                }
-        }
-    } catch (error) {
-        console.log(error);
-        return {
-            statusCode: 500,
-            body: JSON.stringify(error)
-        }
-    }
-};

netlify/functions/tsconfig.json

@@ -1,13 +0,0 @@
-{
-  "compilerOptions": {
-    "target": "esnext",
-    "module": "esnext",
-    "moduleResolution": "Node",
-    "lib": [
-      "esnext"
-    ],
-    "types": [
-      "@cloudflare/workers-types"
-    ]
-  }
-}

netlify/functions/voice/voice.ts

@@ -1,22 +0,0 @@
-import {Handler, HandlerContext, HandlerEvent} from "@netlify/functions";
-import axios from 'axios';
-
-export const handler: Handler = async (event: HandlerEvent, context: HandlerContext) => {
-    try {
-        const response = await axios.post('https://api.assemblyai.com/v2/realtime/token', // use account token to get a temp user token
-            {expires_in: 3600}, // can set a TTL timer in seconds.
-            {headers: {authorization: process.env.VOICE_TOKEN}});
-
-        const data = await response.data;
-        return {
-            headers: {'Content-Type': 'application/json'},
-            statusCode: 200,
-            body: JSON.stringify(data)
-        }
-    } catch (error) {
-        return {
-            statusCode: 500,
-            body: JSON.stringify(error)
-        }
-    }
-};

newrelic.cjs

@@ -0,0 +1,48 @@
+'use strict'
+// Load .env.local first (has the secrets), then .env as fallback
+require('dotenv').config({ path: '.env.local' });
+require('dotenv').config();
+/**
+ * New Relic Node.js APM Configuration
+ *
+ * This file configures the New Relic agent for backend monitoring.
+ * Requires NEW_RELIC_LICENSE_KEY environment variable to be set.
+ *
+ * Distributed tracing is enabled to correlate with browser agent traces.
+ */
+
+exports.config = {
+  app_name: ['dasfad-backend'],
+  license_key: process.env.NEW_RELIC_LICENSE_KEY,
+  distributed_tracing: {
+    enabled: true
+  },
+  logging: {
+    level: 'info'
+  },
+  application_logging: {
+    enabled: true,
+    forwarding: {
+      enabled: true,
+      max_samples_stored: 10000
+    },
+    local_decorating: {
+      enabled: true
+    }
+  },
+  allow_all_headers: true,
+  attributes: {
+    exclude: [
+      'request.headers.cookie',
+      'request.headers.authorization',
+      'request.headers.proxyAuthorization',
+      'request.headers.setCookie*',
+      'request.headers.x*',
+      'response.headers.cookie',
+      'response.headers.authorization',
+      'response.headers.proxyAuthorization',
+      'response.headers.setCookie*',
+      'response.headers.x*'
+    ]
+  }
+}

package.json

@@ -1,48 +1,82 @@
 {
   "name": "immersive",
   "private": true,
-  "version": "0.0.1",
+  "version": "0.0.8-48",
   "type": "module",
+  "license": "MIT",
   "engines": {
     "node": ">=18.0.0"
   },
   "scripts": {
-    "dev": "vite",
+    "dev": "node -r newrelic server.js",
-    "build": "vite build",
+    "test": "vitest",
-    "preview": "vite preview",
+    "build": "node versionBump.js && vite build",
-    "serve": "node server.js",
+    "start": "NODE_ENV=production node -r newrelic server.js",
+    "start:api": "API_ONLY=true node -r newrelic server.js",
+    "socket": "node server/server.js",
     "serverBuild": "cd server && tsc",
     "havok": "cp ./node_modules/@babylonjs/havok/lib/esm/HavokPhysics.wasm ./node_modules/.vite/deps"
   },
   "dependencies": {
-    "@babylonjs/core": "^6.21.2",
+    "@auth0/auth0-react": "^2.2.4",
-    "@babylonjs/gui": "^6.21.2",
+    "@babylonjs/core": "^8.16.2",
-    "@babylonjs/havok": "1.1.4",
+    "@babylonjs/gui": "^8.16.2",
-    "@babylonjs/inspector": "^6.21.2",
+    "@babylonjs/havok": "1.3.4",
-    "@babylonjs/loaders": "^6.21.2",
+    "@babylonjs/inspector": "^8.16.2",
-    "@babylonjs/serializers": "^6.21.2",
+    "@babylonjs/loaders": "^8.16.2",
-    "@cloudflare/workers-types": "^4.20230821.0",
+    "@babylonjs/materials": "^8.16.2",
-    "@netlify/functions": "^1.6.0",
+    "@babylonjs/serializers": "^8.16.2",
-    "@typed-mxgraph/typed-mxgraph": "^1.0.8",
+    "@emotion/react": "^11.13.0",
+    "@giphy/js-fetch-api": "^5.6.0",
+    "@giphy/react-components": "^9.6.0",
+    "@mantine/core": "^7.17.8",
+    "@mantine/form": "^7.17.8",
+    "@mantine/hooks": "^7.17.8",
+    "@maptiler/client": "1.8.1",
+    "@newrelic/browser-agent": "^1.306.0",
+    "@picovoice/cobra-web": "^2.0.3",
+    "@picovoice/eagle-web": "^1.0.0",
+    "@picovoice/web-voice-processor": "^4.0.9",
+    "@tabler/icons-react": "^3.14.0",
     "@types/node": "^18.14.0",
-    "dexie": "^3.2.4",
+    "@types/react": "^18.2.72",
-    "dexie-observable": "^4.0.1-beta.13",
+    "@types/react-dom": "^18.2.22",
-    "earcut": "^2.2.4",
+    "axios": "^1.10.0",
+    "canvas-hypertxt": "1.0.3",
+    "cors": "^2.8.5",
+    "dotenv": "^17.2.3",
+    "events": "^3.3.0",
+    "express": "^5.2.1",
+    "express-pouchdb": "^4.2.0",
+    "hash-wasm": "4.11.0",
     "hls.js": "^1.1.4",
-    "loglevel": "^1.8.1",
+    "js-crypto-aes": "1.0.6",
-    "mxgraph": "^4.2.2",
+    "leveldown": "^6.1.1",
-    "niceware": "^4.0.0",
+    "loglevel": "^1.9.1",
-    "p2p-data-channel": "^1.10.7",
+    "meaningful-string": "^1.4.0",
+    "newrelic": "^13.9.1",
+    "peer-lite": "2.0.2",
+    "pouchdb": "^8.0.1",
+    "pouchdb-adapter-leveldb": "^9.0.0",
+    "pouchdb-adapter-memory": "^9.0.0",
+    "pouchdb-find": "^8.0.1",
     "query-string": "^8.1.0",
-    "recordrtc": "^5.6.2",
+    "react-router-dom": "^6.26.1",
-    "ring-client-api": "11.7.7",
+    "recordrtc": "^5.6.0",
+    "rfc4648": "^1.5.3",
     "round": "^2.0.1",
-    "uuid": "^9.0.0"
+    "uint8-to-b64": "^1.0.2",
+    "use-pouchdb": "^2.0.2",
+    "uuid": "^9.0.1",
+    "vite-express": "^0.21.1",
+    "websocket": "^1.0.34",
+    "websocket-ts": "^2.1.5"
   },
   "devDependencies": {
+    "@types/dom-to-image": "^2.6.7",
     "typescript": "^4.9.5",
-    "vite": "^4.4.9",
+    "vite": "^5.2.9",
-    "vite-plugin-api": "^0.1.11",
+    "vite-plugin-cp": "^1.0.0",
-    "vite-plugin-cp": "^1.0.0"
+    "vitest": "^1.4.0"
   }
 }

public/_redirects

@@ -0,0 +1 @@
+/db/* /index.html 200

public/assets/dasfad-logo.svg

@@ -0,0 +1,40 @@
+<svg xmlns="http://www.w3.org/2000/svg" version="1.1" width="3200"
+     height="1355.480324331485" viewBox="0 0 3200 1355.480324331485">
+
+    <g transform="scale(10) translate(10, 10)">
+        <defs id="SvgjsDefs1385">
+            <linearGradient id="SvgjsLinearGradient1390">
+                <stop id="SvgjsStop1391" stop-color="#905e26" offset="0"></stop>
+                <stop id="SvgjsStop1392" stop-color="#f5ec9b" offset="0.5"></stop>
+                <stop id="SvgjsStop1393" stop-color="#905e26" offset="1"></stop>
+            </linearGradient>
+            <linearGradient id="SvgjsLinearGradient1394">
+                <stop id="SvgjsStop1395" stop-color="#905e26" offset="0"></stop>
+                <stop id="SvgjsStop1396" stop-color="#f5ec9b" offset="0.5"></stop>
+                <stop id="SvgjsStop1397" stop-color="#905e26" offset="1"></stop>
+            </linearGradient>
+        </defs>
+        <g id="SvgjsG1386" featureKey="aMgJeN-0"
+           transform="matrix(1.5610770874511997,0,0,1.5610770874511997,71.94613967240352,-53.841545411371435)"
+           fill="url(#SvgjsLinearGradient1390)">
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.399,57.112c0.615,0.308,1.077,0.846,1.077,1.383c0,1.039-1.038,1.961-1.999,1.462l-15.223-7.881  c-0.846-0.499-1.576-0.808-1.576-1.884c0-1.115,0.692-1.385,1.576-1.922l15.223-7.881c1.038-0.346,1.999,0.424,1.999,1.462  c0,0.575-0.461,1.114-1.077,1.423l-13.761,6.918L29.399,57.112z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.033,60.209c-0.208,0-0.413-0.052-0.608-0.152l-15.223-7.881c-0.086-0.05-0.165-0.095-0.242-0.141  c-0.748-0.431-1.395-0.804-1.395-1.843c0-1.057,0.594-1.406,1.346-1.849c0.093-0.054,0.187-0.11,0.284-0.169l15.229-7.885  c0.195-0.066,0.377-0.097,0.558-0.097c0.9,0,1.606,0.728,1.606,1.658c0,0.587-0.437,1.172-1.139,1.522l-13.562,6.818l13.562,6.818  c0.691,0.346,1.139,0.93,1.139,1.484C30.588,59.407,29.861,60.209,29.033,60.209z M28.982,40.419c-0.156,0-0.314,0.026-0.47,0.078  L13.306,48.37c-0.091,0.057-0.188,0.113-0.281,0.167c-0.743,0.439-1.234,0.728-1.234,1.655c0,0.91,0.537,1.219,1.281,1.648  c0.079,0.045,0.158,0.09,0.239,0.139l15.217,7.877c0.162,0.084,0.332,0.127,0.504,0.127c0.697,0,1.33-0.709,1.33-1.488  c0-0.465-0.407-0.98-1.014-1.283l-13.962-7.02l13.962-7.02c0.616-0.308,1.014-0.828,1.014-1.321  C30.363,41.048,29.756,40.419,28.982,40.419z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M46.385,64.416c-0.231,0.691-0.922,1.077-1.614,0.961c-0.769-0.153-1.269-0.885-1.154-1.692  c0-0.076,0.039-0.191,0.077-0.307l9.88-27.831c0.23-0.692,0.922-1.038,1.614-0.923c0.73,0.154,1.269,0.885,1.153,1.652  c0,0.078-0.039,0.193-0.077,0.27L46.385,64.416z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M45.016,65.511c-0.088,0-0.177-0.008-0.263-0.022c-0.837-0.167-1.371-0.949-1.247-1.819  c-0.001-0.076,0.038-0.193,0.079-0.318l9.883-27.842c0.207-0.618,0.778-1.02,1.457-1.02c0.094,0,0.188,0.009,0.281,0.023  c0.812,0.172,1.369,0.97,1.247,1.781c0.001,0.086-0.047,0.22-0.087,0.302l-9.875,27.856C46.281,65.084,45.688,65.511,45.016,65.511z   M54.925,34.715c-0.58,0-1.068,0.34-1.244,0.867l-9.88,27.833c-0.035,0.104-0.07,0.213-0.07,0.27  c-0.108,0.767,0.349,1.439,1.062,1.582c0.071,0.012,0.147,0.018,0.223,0.018c0.575,0,1.083-0.363,1.263-0.904l9.881-27.872  c0.041-0.085,0.07-0.182,0.07-0.231c0.105-0.712-0.373-1.396-1.064-1.543C55.089,34.722,55.007,34.715,54.925,34.715z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M84.362,50.192L70.6,43.274c-0.614-0.309-1.075-0.848-1.075-1.423c0-1.038,1.037-1.962,1.998-1.462l15.223,7.881  c0.885,0.537,1.576,0.807,1.576,1.922c0,1.076-0.73,1.385-1.576,1.884l-15.223,7.881c-0.961,0.499-1.998-0.423-1.998-1.462  c0-0.537,0.461-1.075,1.075-1.383L84.362,50.192z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M70.967,60.209c-0.828,0-1.556-0.802-1.556-1.714c0-0.555,0.447-1.139,1.139-1.484l13.562-6.818L70.55,43.374  c-0.702-0.352-1.139-0.936-1.139-1.522c0-0.913,0.728-1.714,1.556-1.714c0.209,0,0.413,0.051,0.608,0.152l15.223,7.881  c0.104,0.062,0.198,0.119,0.29,0.173c0.753,0.442,1.347,0.792,1.347,1.849c0,1.039-0.646,1.412-1.395,1.843  c-0.078,0.046-0.157,0.091-0.237,0.138l-15.228,7.884C71.38,60.157,71.176,60.209,70.967,60.209z M70.967,40.363  c-0.696,0-1.33,0.709-1.33,1.488c0,0.493,0.397,1.013,1.014,1.321l13.962,7.02l-13.962,7.02c-0.606,0.305-1.014,0.82-1.014,1.283  c0,0.779,0.634,1.488,1.33,1.488c0.172,0,0.342-0.043,0.504-0.127l15.223-7.88c0.075-0.046,0.155-0.091,0.233-0.136  c0.744-0.43,1.282-0.738,1.282-1.648c0-0.928-0.491-1.216-1.235-1.655c-0.093-0.054-0.188-0.11-0.287-0.17l-15.216-7.876  C71.309,40.405,71.139,40.363,70.967,40.363z"></path>
+        </g>
+        <g id="SvgjsG1387" featureKey="8L6ael-0"
+           transform="matrix(3.168568052463937,0,0,3.168568052463937,-5.1330821487142195,52.17667742743372)"
+           fill="url(#SvgjsLinearGradient1394)">
+            <path d="M10.56 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z M32.208 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M45.535999999999994 12.42 q0.86 0.54 1.31 1.32 t0.45 1.74 q0 2.26 -1.72 3.46 q-1.16 0.84 -3.14 1.06 l-0.08 0 q-0.28 0 -0.46 -0.18 q-0.24 -0.22 -0.24 -0.52 l0 -1.44 q0 -0.26 0.18 -0.46 t0.44 -0.24 q0.94 -0.1 1.46 -0.44 q0.4 -0.24 0.54 -0.62 q0.08 -0.22 0.08 -0.56 q0 -0.22 -0.08 -0.38 t-0.28 -0.3 q-0.58 -0.4 -1.5 -0.68 l-0.32 -0.1 q-1 -0.28 -1.84 -0.46 q-0.18 -0.04 -0.58 -0.14 l-0.22 -0.06 q-0.72 -0.18 -1.52 -0.5 q-1.18 -0.5 -1.94 -1.26 q-0.88 -0.88 -0.88 -2.32 q0 -1.98 1.52 -3.22 q1.04 -0.88 2.92 -1.12 q0.32 -0.04 0.55 0.18 t0.23 0.52 l0 1.44 q0 0.26 -0.16 0.46 t-0.41 0.23 t-0.51 0.11 q-0.58 0.22 -0.82 0.43 t-0.34 0.43 q-0.1 0.34 -0.1 0.64 q0 0.16 0.18 0.34 q0.28 0.28 0.82 0.5 q0.24 0.1 0.84 0.3 l2.5 0.62 l0.12 0.04 q0.94 0.26 1.36 0.4 q0.94 0.32 1.64 0.78 z M42.196 7.9 q-0.24 -0.06 -0.39 -0.25 t-0.15 -0.45 l0 -1.46 q0 -0.32 0.26 -0.54 q0.1 -0.1 0.26 -0.13 t0.3 -0.01 q1.76 0.28 2.86 1.2 q1.5 1.24 1.6 3.16 q0.02 0.28 -0.19 0.51 t-0.51 0.23 l-1.56 0 q-0.26 0 -0.46 -0.18 t-0.22 -0.44 q-0.08 -0.52 -0.34 -0.86 q-0.42 -0.5 -1.3 -0.76 q-0.06 0 -0.08 -0.02 l-0.08 0 z M39.855999999999995 17.08 q0.24 0.04 0.4 0.24 t0.16 0.44 l0 1.48 q0 0.32 -0.24 0.54 q-0.2 0.16 -0.46 0.16 l-0.1 0 q-1.86 -0.28 -3.06 -1.22 q-1.56 -1.24 -1.76 -3.46 q-0.04 -0.32 0.18 -0.55 t0.52 -0.23 l1.58 0 q0.28 0 0.48 0.19 t0.22 0.47 q0.06 1 0.98 1.54 q0.42 0.24 1.1 0.4 z M60.88399999999999 11.12 q0.3 0 0.51 0.21 t0.21 0.51 l0 1.48 q0 0.28 -0.21 0.49 t-0.51 0.21 l-6.58 0 l0 5.12 q0 0.28 -0.2 0.49 t-0.5 0.21 l-1.52 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -7.3 q0 -0.3 0.21 -0.51 t0.49 -0.21 l8.8 0 z M61.78399999999999 5 q0.28 0 0.49 0.21 t0.21 0.49 l0 1.46 q0 0.3 -0.21 0.51 t-0.49 0.21 l-9.7 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.46 q0 -0.28 0.21 -0.49 t0.49 -0.21 l9.7 0 z M79.512 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M92 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z"></path>
+        </g>
+    </g>
+</svg>
+	

public/assets/dasfad/Logo Files/For Print/eps/Black logo - no background.eps

@@ -0,0 +1,912 @@
+%!PS-Adobe-3.0 EPSF-3.0
+%Produced by poppler pdftops version: 22.05.0 (http://poppler.freedesktop.org)
+%%Creator: Chromium
+%%LanguageLevel: 3
+%%DocumentSuppliedResources: (atend)
+%%BoundingBox: 0 0 2400 1018
+%%HiResBoundingBox: 0 0 2400 1017.12
+%%DocumentSuppliedResources: (atend)
+%%EndComments
+%%BeginProlog
+%%BeginResource: procset xpdf 3.00 0
+%%Copyright: Copyright 1996-2011, 2022 Glyph & Cog, LLC
+/xpdf 75 dict def xpdf begin
+% PDF special state
+/pdfDictSize 15 def
+/pdfSetup {
+  /setpagedevice where {
+    pop 2 dict begin
+      /Policies 1 dict dup begin /PageSize 6 def end def
+      { /Duplex true def } if
+    currentdict end setpagedevice
+  } {
+    pop
+  } ifelse
+} def
+/pdfSetupPaper {
+  % Change paper size, but only if different from previous paper size otherwise
+  % duplex fails. PLRM specifies a tolerance of 5 pts when matching paper size
+  % so we use the same when checking if the size changes.
+  /setpagedevice where {
+    pop currentpagedevice
+    /PageSize known {
+      2 copy
+      currentpagedevice /PageSize get aload pop
+      exch 4 1 roll
+      sub abs 5 gt
+      3 1 roll
+      sub abs 5 gt
+      or
+    } {
+      true
+    } ifelse
+    {
+      2 array astore
+      2 dict begin
+        /PageSize exch def
+        /ImagingBBox null def
+      currentdict end
+      setpagedevice
+    } {
+      pop pop
+    } ifelse
+  } {
+    pop
+  } ifelse
+} def
+/pdfStartPage {
+  pdfDictSize dict begin
+  /pdfFillCS [] def
+  /pdfFillXform {} def
+  /pdfStrokeCS [] def
+  /pdfStrokeXform {} def
+  /pdfFill [0] def
+  /pdfStroke [0] def
+  /pdfFillOP false def
+  /pdfStrokeOP false def
+  /pdfOPM false def
+  /pdfLastFill false def
+  /pdfLastStroke false def
+  /pdfTextMat [1 0 0 1 0 0] def
+  /pdfFontSize 0 def
+  /pdfCharSpacing 0 def
+  /pdfTextRender 0 def
+  /pdfPatternCS false def
+  /pdfTextRise 0 def
+  /pdfWordSpacing 0 def
+  /pdfHorizScaling 1 def
+  /pdfTextClipPath [] def
+} def
+/pdfEndPage { end } def
+% PDF color state
+/opm { dup /pdfOPM exch def
+      /setoverprintmode where{pop setoverprintmode}{pop}ifelse  } def
+/cs { /pdfFillXform exch def dup /pdfFillCS exch def
+      setcolorspace } def
+/CS { /pdfStrokeXform exch def dup /pdfStrokeCS exch def
+      setcolorspace } def
+/sc { pdfLastFill not { pdfFillCS setcolorspace } if
+      dup /pdfFill exch def aload pop pdfFillXform setcolor
+     /pdfLastFill true def /pdfLastStroke false def } def
+/SC { pdfLastStroke not { pdfStrokeCS setcolorspace } if
+      dup /pdfStroke exch def aload pop pdfStrokeXform setcolor
+     /pdfLastStroke true def /pdfLastFill false def } def
+/op { /pdfFillOP exch def
+      pdfLastFill { pdfFillOP setoverprint } if } def
+/OP { /pdfStrokeOP exch def
+      pdfLastStroke { pdfStrokeOP setoverprint } if } def
+/fCol {
+  pdfLastFill not {
+    pdfFillCS setcolorspace
+    pdfFill aload pop pdfFillXform setcolor
+    pdfFillOP setoverprint
+    /pdfLastFill true def /pdfLastStroke false def
+  } if
+} def
+/sCol {
+  pdfLastStroke not {
+    pdfStrokeCS setcolorspace
+    pdfStroke aload pop pdfStrokeXform setcolor
+    pdfStrokeOP setoverprint
+    /pdfLastStroke true def /pdfLastFill false def
+  } if
+} def
+% build a font
+/pdfMakeFont {
+  4 3 roll findfont
+  4 2 roll matrix scale makefont
+  dup length dict begin
+    { 1 index /FID ne { def } { pop pop } ifelse } forall
+    /Encoding exch def
+    currentdict
+  end
+  definefont pop
+} def
+/pdfMakeFont16 {
+  exch findfont
+  dup length dict begin
+    { 1 index /FID ne { def } { pop pop } ifelse } forall
+    /WMode exch def
+    currentdict
+  end
+  definefont pop
+} def
+/pdfMakeFont16L3 {
+  1 index /CIDFont resourcestatus {
+    pop pop 1 index /CIDFont findresource /CIDFontType known
+  } {
+    false
+  } ifelse
+  {
+    0 eq { /Identity-H } { /Identity-V } ifelse
+    exch 1 array astore composefont pop
+  } {
+    pdfMakeFont16
+  } ifelse
+} def
+% graphics state operators
+/q { gsave pdfDictSize dict begin } def
+/Q {
+  end grestore
+  /pdfLastFill where {
+    pop
+    pdfLastFill {
+      pdfFillOP setoverprint
+    } {
+      pdfStrokeOP setoverprint
+    } ifelse
+  } if
+  /pdfOPM where {
+    pop
+    pdfOPM /setoverprintmode where{pop setoverprintmode}{pop}ifelse 
+  } if
+} def
+/cm { concat } def
+/d { setdash } def
+/i { setflat } def
+/j { setlinejoin } def
+/J { setlinecap } def
+/M { setmiterlimit } def
+/w { setlinewidth } def
+% path segment operators
+/m { moveto } def
+/l { lineto } def
+/c { curveto } def
+/re { 4 2 roll moveto 1 index 0 rlineto 0 exch rlineto
+      neg 0 rlineto closepath } def
+/h { closepath } def
+% path painting operators
+/S { sCol stroke } def
+/Sf { fCol stroke } def
+/f { fCol fill } def
+/f* { fCol eofill } def
+% clipping operators
+/W { clip newpath } def
+/W* { eoclip newpath } def
+/Ws { strokepath clip newpath } def
+% text state operators
+/Tc { /pdfCharSpacing exch def } def
+/Tf { dup /pdfFontSize exch def
+      dup pdfHorizScaling mul exch matrix scale
+      pdfTextMat matrix concatmatrix dup 4 0 put dup 5 0 put
+      exch findfont exch makefont setfont } def
+/Tr { /pdfTextRender exch def } def
+/Tp { /pdfPatternCS exch def } def
+/Ts { /pdfTextRise exch def } def
+/Tw { /pdfWordSpacing exch def } def
+/Tz { /pdfHorizScaling exch def } def
+% text positioning operators
+/Td { pdfTextMat transform moveto } def
+/Tm { /pdfTextMat exch def } def
+% text string operators
+/xyshow where {
+  pop
+  /xyshow2 {
+    dup length array
+    0 2 2 index length 1 sub {
+      2 index 1 index 2 copy get 3 1 roll 1 add get
+      pdfTextMat dtransform
+      4 2 roll 2 copy 6 5 roll put 1 add 3 1 roll dup 4 2 roll put
+    } for
+    exch pop
+    xyshow
+  } def
+}{
+  /xyshow2 {
+    currentfont /FontType get 0 eq {
+      0 2 3 index length 1 sub {
+        currentpoint 4 index 3 index 2 getinterval show moveto
+        2 copy get 2 index 3 2 roll 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } {
+      0 1 3 index length 1 sub {
+        currentpoint 4 index 3 index 1 getinterval show moveto
+        2 copy 2 mul get 2 index 3 2 roll 2 mul 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } ifelse
+    pop pop
+  } def
+} ifelse
+/cshow where {
+  pop
+  /xycp {
+    0 3 2 roll
+    {
+      pop pop currentpoint 3 2 roll
+      1 string dup 0 4 3 roll put false charpath moveto
+      2 copy get 2 index 2 index 1 add get
+      pdfTextMat dtransform rmoveto
+      2 add
+    } exch cshow
+    pop pop
+  } def
+}{
+  /xycp {
+    currentfont /FontType get 0 eq {
+      0 2 3 index length 1 sub {
+        currentpoint 4 index 3 index 2 getinterval false charpath moveto
+        2 copy get 2 index 3 2 roll 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } {
+      0 1 3 index length 1 sub {
+        currentpoint 4 index 3 index 1 getinterval false charpath moveto
+        2 copy 2 mul get 2 index 3 2 roll 2 mul 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } ifelse
+    pop pop
+  } def
+} ifelse
+/Tj {
+  fCol
+  0 pdfTextRise pdfTextMat dtransform rmoveto
+  currentpoint 4 2 roll
+  pdfTextRender 1 and 0 eq {
+    2 copy xyshow2
+  } if
+  pdfTextRender 3 and dup 1 eq exch 2 eq or {
+    3 index 3 index moveto
+    2 copy
+    currentfont /FontType get 3 eq { fCol } { sCol } ifelse
+    xycp currentpoint stroke moveto
+  } if
+  pdfTextRender 4 and 0 ne {
+    4 2 roll moveto xycp
+    /pdfTextClipPath [ pdfTextClipPath aload pop
+      {/moveto cvx}
+      {/lineto cvx}
+      {/curveto cvx}
+      {/closepath cvx}
+    pathforall ] def
+    currentpoint newpath moveto
+  } {
+    pop pop pop pop
+  } ifelse
+  0 pdfTextRise neg pdfTextMat dtransform rmoveto
+} def
+/TJm { 0.001 mul pdfFontSize mul pdfHorizScaling mul neg 0
+       pdfTextMat dtransform rmoveto } def
+/TJmV { 0.001 mul pdfFontSize mul neg 0 exch
+        pdfTextMat dtransform rmoveto } def
+/Tclip { pdfTextClipPath cvx exec clip newpath
+         /pdfTextClipPath [] def } def
+/Tclip* { pdfTextClipPath cvx exec eoclip newpath
+         /pdfTextClipPath [] def } def
+% Level 2/3 image operators
+/pdfImBuf 100 string def
+/pdfImStr {
+  2 copy exch length lt {
+    2 copy get exch 1 add exch
+  } {
+    ()
+  } ifelse
+} def
+/skipEOD {
+  { currentfile pdfImBuf readline
+    not { pop exit } if
+    (%-EOD-) eq { exit } if } loop
+} def
+/pdfIm { image skipEOD } def
+/pdfMask {
+  /ReusableStreamDecode filter
+  skipEOD
+  /maskStream exch def
+} def
+/pdfMaskEnd { maskStream closefile } def
+/pdfMaskInit {
+  /maskArray exch def
+  /maskIdx 0 def
+} def
+/pdfMaskSrc {
+  maskIdx maskArray length lt {
+    maskArray maskIdx get
+    /maskIdx maskIdx 1 add def
+  } {
+    ()
+  } ifelse
+} def
+/pdfImM { fCol imagemask skipEOD } def
+/pr { 2 index 2 index 3 2 roll putinterval 4 add } def
+/pdfImClip {
+  gsave
+  0 2 4 index length 1 sub {
+    dup 4 index exch 2 copy
+    get 5 index div put
+    1 add 3 index exch 2 copy
+    get 3 index div put
+  } for
+  pop pop rectclip
+} def
+/pdfImClipEnd { grestore } def
+% shading operators
+/colordelta {
+  false 0 1 3 index length 1 sub {
+    dup 4 index exch get 3 index 3 2 roll get sub abs 0.004 gt {
+      pop true
+    } if
+  } for
+  exch pop exch pop
+} def
+/funcCol { func n array astore } def
+/funcSH {
+  dup 0 eq {
+    true
+  } {
+    dup 6 eq {
+      false
+    } {
+      4 index 4 index funcCol dup
+      6 index 4 index funcCol dup
+      3 1 roll colordelta 3 1 roll
+      5 index 5 index funcCol dup
+      3 1 roll colordelta 3 1 roll
+      6 index 8 index funcCol dup
+      3 1 roll colordelta 3 1 roll
+      colordelta or or or
+    } ifelse
+  } ifelse
+  {
+    1 add
+    4 index 3 index add 0.5 mul exch 4 index 3 index add 0.5 mul exch
+    6 index 6 index 4 index 4 index 4 index funcSH
+    2 index 6 index 6 index 4 index 4 index funcSH
+    6 index 2 index 4 index 6 index 4 index funcSH
+    5 3 roll 3 2 roll funcSH pop pop
+  } {
+    pop 3 index 2 index add 0.5 mul 3 index  2 index add 0.5 mul
+    funcCol sc
+    dup 4 index exch mat transform m
+    3 index 3 index mat transform l
+    1 index 3 index mat transform l
+    mat transform l pop pop h f*
+  } ifelse
+} def
+/axialCol {
+  dup 0 lt {
+    pop t0
+  } {
+    dup 1 gt {
+      pop t1
+    } {
+      dt mul t0 add
+    } ifelse
+  } ifelse
+  func n array astore
+} def
+/axialSH {
+  dup 0 eq {
+    true
+  } {
+    dup 8 eq {
+      false
+    } {
+      2 index axialCol 2 index axialCol colordelta
+    } ifelse
+  } ifelse
+  {
+    1 add 3 1 roll 2 copy add 0.5 mul
+    dup 4 3 roll exch 4 index axialSH
+    exch 3 2 roll axialSH
+  } {
+    pop 2 copy add 0.5 mul
+    axialCol sc
+    exch dup dx mul x0 add exch dy mul y0 add
+    3 2 roll dup dx mul x0 add exch dy mul y0 add
+    dx abs dy abs ge {
+      2 copy yMin sub dy mul dx div add yMin m
+      yMax sub dy mul dx div add yMax l
+      2 copy yMax sub dy mul dx div add yMax l
+      yMin sub dy mul dx div add yMin l
+      h f*
+    } {
+      exch 2 copy xMin sub dx mul dy div add xMin exch m
+      xMax sub dx mul dy div add xMax exch l
+      exch 2 copy xMax sub dx mul dy div add xMax exch l
+      xMin sub dx mul dy div add xMin exch l
+      h f*
+    } ifelse
+  } ifelse
+} def
+/radialCol {
+  dup t0 lt {
+    pop t0
+  } {
+    dup t1 gt {
+      pop t1
+    } if
+  } ifelse
+  func n array astore
+} def
+/radialSH {
+  dup 0 eq {
+    true
+  } {
+    dup 8 eq {
+      false
+    } {
+      2 index dt mul t0 add radialCol
+      2 index dt mul t0 add radialCol colordelta
+    } ifelse
+  } ifelse
+  {
+    1 add 3 1 roll 2 copy add 0.5 mul
+    dup 4 3 roll exch 4 index radialSH
+    exch 3 2 roll radialSH
+  } {
+    pop 2 copy add 0.5 mul dt mul t0 add
+    radialCol sc
+    encl {
+      exch dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      0 360 arc h
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      360 0 arcn h f
+    } {
+      2 copy
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a1 a2 arcn
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a2 a1 arcn h
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a1 a2 arc
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a2 a1 arc h f
+    } ifelse
+  } ifelse
+} def
+end
+%%EndResource
+/CIDInit /ProcSet findresource begin
+10 dict begin
+  begincmap
+  /CMapType 1 def
+  /CMapName /Identity-H def
+  /CIDSystemInfo 3 dict dup begin
+    /Registry (Adobe) def
+    /Ordering (Identity) def
+    /Supplement 0 def
+  end def
+  1 begincodespacerange
+    <0000> <ffff>
+  endcodespacerange
+  0 usefont
+  1 begincidrange
+    <0000> <ffff> 0
+  endcidrange
+  endcmap
+  currentdict CMapName exch /CMap defineresource pop
+end
+10 dict begin
+  begincmap
+  /CMapType 1 def
+  /CMapName /Identity-V def
+  /CIDSystemInfo 3 dict dup begin
+    /Registry (Adobe) def
+    /Ordering (Identity) def
+    /Supplement 0 def
+  end def
+  /WMode 1 def
+  1 begincodespacerange
+    <0000> <ffff>
+  endcodespacerange
+  0 usefont
+  1 begincidrange
+    <0000> <ffff> 0
+  endcidrange
+  endcmap
+  currentdict CMapName exch /CMap defineresource pop
+end
+end
+%%EndProlog
+%%BeginSetup
+xpdf begin
+%%EndSetup
+pdfStartPage
+%%EndPageSetup
+[] 0 d
+1 i
+0 j
+0 J
+10 M
+1 w
+/DeviceGray {} cs
+[0] sc
+/DeviceGray {} CS
+[0] SC
+false op
+false OP
+{} settransfer
+0 0 2400 1017.12 re
+W
+q
+[0.24 0 0 -0.24 0 1017.12] cm
+q
+0 0 10000 4234.375 re
+W*
+q
+[48.783241 0 0 48.766369 2560.8376 -1369.56274] cm
+29.399 57.112 m
+30.014 57.419998 30.476 57.958 30.476 58.494999 c
+30.476 59.534 29.438 60.455997 28.476999 59.957001 c
+13.254 52.076 l
+12.408 51.577 11.678 51.268002 11.678 50.192001 c
+11.678 49.077 12.37 48.807003 13.254 48.27 c
+28.476999 40.389 l
+29.514999 40.042999 30.476 40.813 30.476 41.851002 c
+30.476 42.426003 30.014999 42.965 29.399 43.274002 c
+15.638 50.192001 l
+29.399 57.112 l
+h
+f
+29.033001 60.209 m
+28.825001 60.209 28.620001 60.157001 28.425001 60.056999 c
+13.202002 52.175999 l
+13.116001 52.125999 13.037002 52.080997 12.960002 52.035 c
+12.212002 51.604 11.565002 51.230999 11.565002 50.192001 c
+11.565002 49.135002 12.159002 48.786003 12.911002 48.343002 c
+13.004003 48.289001 13.098002 48.233002 13.195003 48.174004 c
+28.424004 40.289001 l
+28.619003 40.223 28.801004 40.192001 28.982004 40.192001 c
+29.882004 40.192001 30.588005 40.920002 30.588005 41.850002 c
+30.588005 42.437004 30.151005 43.022003 29.449005 43.372002 c
+15.887005 50.190002 l
+29.449005 57.008003 l
+30.140005 57.354004 30.588005 57.938004 30.588005 58.492004 c
+30.587999 59.407001 29.861 60.209 29.033001 60.209 c
+h
+28.982 40.418999 m
+28.826 40.418999 28.668001 40.445 28.512001 40.496998 c
+13.306 48.369999 l
+13.215 48.426998 13.118 48.482998 13.025 48.536999 c
+12.282 48.975998 11.790999 49.264999 11.790999 50.191998 c
+11.790999 51.101997 12.327999 51.410999 13.072 51.839996 c
+13.151 51.884995 13.23 51.929996 13.311 51.978996 c
+28.528 59.855995 l
+28.690001 59.939995 28.860001 59.982994 29.032 59.982994 c
+29.729 59.982994 30.362 59.273994 30.362 58.494995 c
+30.362 58.029995 29.955 57.514996 29.348 57.211994 c
+15.386 50.191994 l
+29.348 43.171993 l
+29.963999 42.863995 30.362 42.343994 30.362 41.850994 c
+30.363001 41.048 29.756001 40.418999 28.982 40.418999 c
+h
+f
+46.384998 64.416 m
+46.153999 65.107002 45.462997 65.493004 44.771 65.376999 c
+44.001999 65.223999 43.501999 64.491997 43.617001 63.684998 c
+43.617001 63.608997 43.656002 63.493996 43.694 63.377998 c
+53.574001 35.546997 l
+53.804001 34.854996 54.496002 34.508999 55.188 34.623997 c
+55.917999 34.777996 56.457001 35.508995 56.341 36.275997 c
+56.341 36.353996 56.301998 36.468998 56.264 36.545998 c
+46.384998 64.416 l
+h
+f
+45.015999 65.511002 m
+44.927998 65.511002 44.839001 65.502998 44.752998 65.488998 c
+43.915997 65.321999 43.382 64.540001 43.505997 63.669998 c
+43.504997 63.593998 43.543995 63.476997 43.584995 63.351997 c
+53.467995 35.509998 l
+53.674995 34.891998 54.245995 34.489998 54.924995 34.489998 c
+55.018997 34.489998 55.112995 34.498997 55.205994 34.512997 c
+56.017994 34.684998 56.574993 35.482998 56.452995 36.293995 c
+56.453995 36.379993 56.405994 36.513996 56.365993 36.595993 c
+46.490993 64.451996 l
+46.280998 65.084 45.688 65.511002 45.015999 65.511002 c
+h
+54.924999 34.715 m
+54.344997 34.715 53.856998 35.055 53.681 35.582001 c
+43.800999 63.415001 l
+43.765999 63.519001 43.730999 63.628002 43.730999 63.685001 c
+43.622997 64.452003 44.079998 65.124001 44.792999 65.266998 c
+44.863998 65.278999 44.939999 65.284996 45.015999 65.284996 c
+45.591 65.284996 46.098999 64.921997 46.278999 64.380997 c
+56.16 36.508995 l
+56.201 36.423996 56.23 36.326996 56.23 36.277996 c
+56.334999 35.565994 55.856998 34.881996 55.166 34.734997 c
+55.089001 34.722 55.007 34.715 54.924999 34.715 c
+h
+f
+84.362 50.192001 m
+70.599998 43.273998 l
+69.986 42.964996 69.525002 42.425999 69.525002 41.850998 c
+69.525002 40.813 70.562004 39.888996 71.523003 40.388996 c
+86.746002 48.269997 l
+87.631004 48.806995 88.321999 49.076996 88.321999 50.191998 c
+88.321999 51.267998 87.591995 51.576996 86.746002 52.075996 c
+71.523003 59.956997 l
+70.562004 60.455997 69.525002 59.533997 69.525002 58.494995 c
+69.525002 57.957996 69.986 57.419994 70.599998 57.111996 c
+84.362 50.192001 l
+h
+f
+70.967003 60.209 m
+70.139 60.209 69.411003 59.407001 69.411003 58.494999 c
+69.411003 57.939999 69.858002 57.355999 70.550003 57.010998 c
+84.112 50.192997 l
+70.550003 43.374001 l
+69.848 43.021999 69.411003 42.438 69.411003 41.852001 c
+69.411003 40.939003 70.139 40.138 70.967003 40.138 c
+71.176003 40.138 71.380005 40.188999 71.575005 40.290001 c
+86.798004 48.171001 l
+86.902 48.233002 86.996002 48.290001 87.088005 48.344002 c
+87.841003 48.786003 88.435005 49.136002 88.435005 50.193001 c
+88.435005 51.232002 87.789001 51.605 87.040009 52.035999 c
+86.962006 52.082001 86.883011 52.126999 86.803009 52.174 c
+71.575012 60.057999 l
+71.379997 60.157001 71.176003 60.209 70.967003 60.209 c
+h
+70.967003 40.362999 m
+70.271004 40.362999 69.637001 41.071999 69.637001 41.850998 c
+69.637001 42.343998 70.034004 42.863998 70.651001 43.171997 c
+84.612999 50.191998 l
+70.651001 57.211998 l
+70.044998 57.516998 69.637001 58.031998 69.637001 58.494999 c
+69.637001 59.273998 70.271004 59.982998 70.967003 59.982998 c
+71.139 59.982998 71.309006 59.939999 71.471001 59.855999 c
+86.694 51.975998 l
+86.768997 51.929996 86.848999 51.884998 86.927002 51.839996 c
+87.671005 51.409996 88.209 51.101997 88.209 50.191998 c
+88.209 49.263996 87.718002 48.975998 86.973999 48.536999 c
+86.880997 48.482998 86.785995 48.426998 86.686996 48.367001 c
+71.470993 40.491001 l
+71.308998 40.404999 71.139 40.362999 70.967003 40.362999 c
+h
+f
+Q
+q
+[99.016907 0 0 98.982658 152.13266 1942.3326] cm
+10.56 5.52 m
+11.373334 5.826667 12.106668 6.32 12.76 7 c
+14.160001 8.413333 14.860001 10.216666 14.860001 12.41 c
+14.860001 14.603334 14.160001 16.413334 12.76 17.84 c
+12.106668 18.52 11.373334 19.013334 10.56 19.32 c
+9.72 19.666666 8.860001 19.84 7.980001 19.84 c
+2.320001 19.84 l
+2.133334 19.84 1.970001 19.77 1.830001 19.630001 c
+1.690001 19.490002 1.620001 19.326668 1.620001 19.140001 c
+1.620001 17.700001 l
+1.620001 17.500002 1.690001 17.330002 1.830001 17.190001 c
+1.970001 17.049999 2.133334 16.98 2.320001 16.980001 c
+7.920001 16.980001 l
+9.106668 16.980001 10.070001 16.546669 10.81 15.680001 c
+11.55 14.813335 11.92 13.726667 11.92 12.420001 c
+11.92 11.113335 11.55 10.026668 10.81 9.160001 c
+10.070001 8.293334 9.106668 7.860001 7.920001 7.860001 c
+2.320001 7.860001 l
+2.133334 7.860001 1.970001 7.79 1.830001 7.650001 c
+1.690001 7.510001 1.620001 7.340001 1.620001 7.14 c
+1.620001 5.7 l
+1.620001 5.513333 1.690001 5.35 1.830001 5.21 c
+1.970001 5.07 2.133334 5 2.320001 5 c
+7.980001 5 l
+8.860001 5 9.72 5.173333 10.56 5.52 c
+h
+32.208 18.860001 m
+32.301334 19.073334 32.278 19.290001 32.138 19.51 c
+31.998001 19.73 31.808001 19.84 31.568001 19.84 c
+18.248001 19.84 l
+18.128 19.84 18.014668 19.809999 17.908001 19.75 c
+17.801334 19.690001 17.721334 19.613333 17.668001 19.52 c
+17.521336 19.306667 17.501335 19.086668 17.608002 18.860001 c
+18.228003 17.400002 l
+18.281336 17.266668 18.368002 17.160002 18.488003 17.080002 c
+18.608004 17.000002 18.734669 16.960003 18.868002 16.960001 c
+28.188002 16.960001 l
+24.908001 9.120001 l
+22.228001 15.520001 l
+22.174667 15.653334 22.091333 15.756667 21.978001 15.830001 c
+21.864668 15.903335 21.734667 15.940002 21.588001 15.940001 c
+19.908001 15.940001 l
+19.654669 15.940001 19.454668 15.833334 19.308001 15.620001 c
+19.254667 15.526668 19.221334 15.420001 19.208 15.300001 c
+19.194666 15.180001 19.208 15.066669 19.248001 14.960001 c
+23.308001 5.440001 l
+23.361334 5.306667 23.444668 5.200001 23.558001 5.12 c
+23.671333 5.04 23.801334 5 23.948 5.000001 c
+25.868 5.000001 l
+26.014666 5.000001 26.144667 5.04 26.257999 5.12 c
+26.371332 5.2 26.454666 5.306667 26.507999 5.440001 c
+32.208 18.860001 l
+h
+45.535999 12.42 m
+46.109333 12.78 46.546001 13.22 46.846001 13.74 c
+47.146 14.259999 47.296001 14.839999 47.296001 15.48 c
+47.296001 16.986666 46.722668 18.139999 45.576 18.939999 c
+44.802666 19.499998 43.756001 19.853333 42.436001 19.999998 c
+42.355999 19.999998 l
+42.169334 19.999998 42.015999 19.939999 41.896 19.819998 c
+41.736 19.673332 41.655998 19.499998 41.655998 19.299997 c
+41.655998 17.859997 l
+41.655998 17.686663 41.716 17.533331 41.835999 17.399998 c
+41.955997 17.266665 42.102665 17.186665 42.275997 17.159998 c
+42.902664 17.09333 43.389328 16.946665 43.735996 16.719997 c
+44.002663 16.559998 44.182663 16.353331 44.275997 16.099997 c
+44.32933 15.95333 44.355999 15.766663 44.355999 15.539996 c
+44.355999 15.39333 44.32933 15.266663 44.275997 15.159996 c
+44.222664 15.05333 44.12933 14.953329 43.995998 14.859996 c
+43.609329 14.593329 43.109329 14.366663 42.495998 14.179996 c
+42.175999 14.079995 l
+41.509331 13.893329 40.896 13.739995 40.335999 13.619995 c
+40.216 13.593328 40.022663 13.546661 39.755997 13.479995 c
+39.535995 13.419994 l
+39.055996 13.299995 38.549328 13.133327 38.015995 12.919994 c
+37.229328 12.586661 36.582661 12.166661 36.075996 11.659994 c
+35.48933 11.073327 35.195995 10.299995 35.195995 9.339994 c
+35.195995 8.019995 35.702663 6.946661 36.715996 6.119994 c
+37.409328 5.533328 38.382664 5.159994 39.635994 4.999994 c
+39.849327 4.973328 40.032661 5.033328 40.185993 5.179994 c
+40.339325 5.326661 40.415993 5.499994 40.415993 5.699994 c
+40.415993 7.139994 l
+40.415993 7.313327 40.362659 7.466661 40.255993 7.599994 c
+40.149326 7.733328 40.012661 7.809994 39.845993 7.829994 c
+39.679325 7.849994 39.509327 7.886661 39.335995 7.939994 c
+38.949326 8.08666 38.675995 8.229994 38.515995 8.369994 c
+38.355995 8.509995 38.242664 8.653328 38.175995 8.799995 c
+38.109329 9.026661 38.075996 9.239995 38.075996 9.439995 c
+38.075996 9.546661 38.135998 9.659995 38.255997 9.779995 c
+38.442661 9.966662 38.715996 10.133328 39.075996 10.279995 c
+39.235996 10.346662 39.515999 10.446662 39.915997 10.579995 c
+42.415997 11.199995 l
+42.535995 11.239995 l
+43.162663 11.413328 43.615993 11.546661 43.895996 11.639995 c
+44.522663 11.853328 45.069328 12.113328 45.535995 12.419994 c
+45.535999 12.42 l
+h
+42.195999 7.9 m
+42.035999 7.86 41.905998 7.776667 41.806 7.65 c
+41.706001 7.523334 41.656002 7.373334 41.655998 7.2 c
+41.655998 5.74 l
+41.655998 5.526667 41.742664 5.346667 41.915997 5.2 c
+41.982662 5.133334 42.069328 5.09 42.175995 5.07 c
+42.282661 5.05 42.38266 5.046667 42.475994 5.06 c
+43.649326 5.246667 44.602661 5.646667 45.335995 6.26 c
+46.335995 7.086667 46.869328 8.14 46.935993 9.42 c
+46.949326 9.606667 46.885994 9.776667 46.745995 9.93 c
+46.605995 10.083334 46.435997 10.160001 46.235996 10.16 c
+44.675995 10.16 l
+44.502663 10.16 44.349331 10.099999 44.215996 9.98 c
+44.082661 9.86 44.009327 9.713333 43.995995 9.54 c
+43.942661 9.193334 43.829327 8.906667 43.655994 8.68 c
+43.375996 8.346667 42.942661 8.093333 42.355995 7.92 c
+42.315994 7.92 42.289326 7.913333 42.275993 7.9 c
+42.195992 7.9 l
+42.195999 7.9 l
+h
+39.855999 17.08 m
+40.015999 17.106667 40.149334 17.186666 40.256001 17.32 c
+40.362667 17.453333 40.416 17.599998 40.416 17.76 c
+40.416 19.24 l
+40.416 19.453333 40.335999 19.633333 40.175999 19.780001 c
+40.042664 19.886667 39.889332 19.940001 39.716 19.940001 c
+39.616001 19.940001 l
+38.375999 19.753334 37.355999 19.346666 36.556 18.720001 c
+35.515999 17.893335 34.929333 16.740002 34.796001 15.260001 c
+34.769333 15.046668 34.829334 14.863335 34.976002 14.710001 c
+35.122669 14.556667 35.296001 14.480001 35.496002 14.480001 c
+37.076004 14.480001 l
+37.262669 14.480001 37.422668 14.543335 37.556004 14.670001 c
+37.689339 14.796667 37.762672 14.953334 37.776005 15.140001 c
+37.816006 15.806668 38.142673 16.320002 38.756004 16.68 c
+39.036003 16.84 39.402668 16.973333 39.856003 17.08 c
+39.855999 17.08 l
+h
+60.883999 11.12 m
+61.084 11.12 61.253998 11.19 61.393997 11.33 c
+61.533997 11.47 61.603996 11.64 61.603996 11.84 c
+61.603996 13.32 l
+61.603996 13.506666 61.533997 13.669999 61.393997 13.81 c
+61.253998 13.95 61.084 14.02 60.883999 14.02 c
+54.304001 14.02 l
+54.304001 19.139999 l
+54.304001 19.326666 54.237335 19.49 54.104 19.629999 c
+53.970665 19.769999 53.804001 19.839998 53.604 19.839998 c
+52.084 19.839998 l
+51.897335 19.839998 51.734001 19.769999 51.593998 19.629999 c
+51.453995 19.49 51.383995 19.326666 51.383999 19.139999 c
+51.383999 11.839999 l
+51.383999 11.639999 51.453999 11.469999 51.593998 11.329999 c
+51.733997 11.189999 51.897331 11.119999 52.084 11.119999 c
+60.883999 11.119999 l
+60.883999 11.12 l
+h
+61.784 5 m
+61.970665 5 62.133999 5.07 62.274002 5.21 c
+62.414005 5.35 62.484005 5.513333 62.484001 5.7 c
+62.484001 7.16 l
+62.484001 7.36 62.414001 7.53 62.274002 7.67 c
+62.134003 7.81 61.970669 7.88 61.784 7.88 c
+52.084 7.88 l
+51.897335 7.88 51.734001 7.81 51.593998 7.67 c
+51.453995 7.53 51.383995 7.36 51.383999 7.16 c
+51.383999 5.7 l
+51.383999 5.513333 51.453999 5.35 51.593998 5.21 c
+51.733997 5.07 51.897331 5.000001 52.084 5 c
+61.784 5 l
+h
+79.512001 18.860001 m
+79.605331 19.073334 79.582001 19.290001 79.442001 19.51 c
+79.302002 19.73 79.112 19.84 78.872002 19.84 c
+65.552002 19.84 l
+65.431999 19.84 65.318672 19.809999 65.212006 19.75 c
+65.105339 19.690001 65.025345 19.613333 64.972008 19.52 c
+64.82534 19.306667 64.805344 19.086668 64.91201 18.860001 c
+65.532013 17.400002 l
+65.58535 17.266668 65.672012 17.160002 65.792015 17.080002 c
+65.912018 17.000002 66.038681 16.960003 66.172012 16.960001 c
+75.492012 16.960001 l
+72.212013 9.120001 l
+69.532013 15.520001 l
+69.478676 15.653334 69.395348 15.756667 69.282013 15.830001 c
+69.168678 15.903335 69.038681 15.940002 68.892014 15.940001 c
+67.212013 15.940001 l
+66.958679 15.940001 66.758682 15.833334 66.612015 15.620001 c
+66.558678 15.526668 66.525345 15.420001 66.512016 15.300001 c
+66.498688 15.180001 66.512016 15.066669 66.552017 14.960001 c
+70.612015 5.440001 l
+70.665352 5.306667 70.74868 5.200001 70.862015 5.12 c
+70.975349 5.04 71.105347 5 71.252014 5.000001 c
+73.172012 5.000001 l
+73.31868 5.000001 73.448677 5.04 73.562012 5.12 c
+73.675346 5.2 73.758675 5.306667 73.812012 5.440001 c
+79.512001 18.860001 l
+h
+92 5.52 m
+92.813332 5.826667 93.546669 6.32 94.199997 7 c
+95.599998 8.413333 96.299995 10.216666 96.299995 12.41 c
+96.299995 14.603334 95.599998 16.413334 94.199997 17.84 c
+93.546661 18.52 92.813332 19.013334 92 19.32 c
+91.159996 19.666666 90.299995 19.84 89.419998 19.84 c
+83.759995 19.84 l
+83.573326 19.84 83.409996 19.77 83.269997 19.630001 c
+83.129997 19.490002 83.059998 19.326668 83.059998 19.140001 c
+83.059998 17.700001 l
+83.059998 17.500002 83.129997 17.330002 83.269997 17.190001 c
+83.409996 17.049999 83.573326 16.98 83.759995 16.980001 c
+89.359993 16.980001 l
+90.546661 16.980001 91.509995 16.546669 92.249992 15.680001 c
+92.98999 14.813335 93.359993 13.726667 93.359993 12.420001 c
+93.359993 11.113335 92.98999 10.026668 92.249992 9.160001 c
+91.509995 8.293334 90.546661 7.860001 89.359993 7.860001 c
+83.759995 7.860001 l
+83.573326 7.860001 83.409996 7.79 83.269997 7.650001 c
+83.129997 7.510001 83.059998 7.340001 83.059998 7.14 c
+83.059998 5.7 l
+83.059998 5.513333 83.129997 5.35 83.269997 5.21 c
+83.409996 5.07 83.573326 5 83.759995 5 c
+89.419998 5 l
+90.299995 5 91.159996 5.173333 92 5.52 c
+h
+f
+Q
+Q
+Q
+showpage
+%%PageTrailer
+pdfEndPage
+%%Trailer
+end
+%%DocumentSuppliedResources:
+%%EOF

public/assets/dasfad/Logo Files/For Print/eps/White logo - no background.eps

@@ -0,0 +1,920 @@
+%!PS-Adobe-3.0 EPSF-3.0
+%Produced by poppler pdftops version: 22.05.0 (http://poppler.freedesktop.org)
+%%Creator: Chromium
+%%LanguageLevel: 3
+%%DocumentSuppliedResources: (atend)
+%%BoundingBox: 0 0 2400 1018
+%%HiResBoundingBox: 0 0 2400 1017.12
+%%DocumentSuppliedResources: (atend)
+%%EndComments
+%%BeginProlog
+%%BeginResource: procset xpdf 3.00 0
+%%Copyright: Copyright 1996-2011, 2022 Glyph & Cog, LLC
+/xpdf 75 dict def xpdf begin
+% PDF special state
+/pdfDictSize 15 def
+/pdfSetup {
+  /setpagedevice where {
+    pop 2 dict begin
+      /Policies 1 dict dup begin /PageSize 6 def end def
+      { /Duplex true def } if
+    currentdict end setpagedevice
+  } {
+    pop
+  } ifelse
+} def
+/pdfSetupPaper {
+  % Change paper size, but only if different from previous paper size otherwise
+  % duplex fails. PLRM specifies a tolerance of 5 pts when matching paper size
+  % so we use the same when checking if the size changes.
+  /setpagedevice where {
+    pop currentpagedevice
+    /PageSize known {
+      2 copy
+      currentpagedevice /PageSize get aload pop
+      exch 4 1 roll
+      sub abs 5 gt
+      3 1 roll
+      sub abs 5 gt
+      or
+    } {
+      true
+    } ifelse
+    {
+      2 array astore
+      2 dict begin
+        /PageSize exch def
+        /ImagingBBox null def
+      currentdict end
+      setpagedevice
+    } {
+      pop pop
+    } ifelse
+  } {
+    pop
+  } ifelse
+} def
+/pdfStartPage {
+  pdfDictSize dict begin
+  /pdfFillCS [] def
+  /pdfFillXform {} def
+  /pdfStrokeCS [] def
+  /pdfStrokeXform {} def
+  /pdfFill [0] def
+  /pdfStroke [0] def
+  /pdfFillOP false def
+  /pdfStrokeOP false def
+  /pdfOPM false def
+  /pdfLastFill false def
+  /pdfLastStroke false def
+  /pdfTextMat [1 0 0 1 0 0] def
+  /pdfFontSize 0 def
+  /pdfCharSpacing 0 def
+  /pdfTextRender 0 def
+  /pdfPatternCS false def
+  /pdfTextRise 0 def
+  /pdfWordSpacing 0 def
+  /pdfHorizScaling 1 def
+  /pdfTextClipPath [] def
+} def
+/pdfEndPage { end } def
+% PDF color state
+/opm { dup /pdfOPM exch def
+      /setoverprintmode where{pop setoverprintmode}{pop}ifelse  } def
+/cs { /pdfFillXform exch def dup /pdfFillCS exch def
+      setcolorspace } def
+/CS { /pdfStrokeXform exch def dup /pdfStrokeCS exch def
+      setcolorspace } def
+/sc { pdfLastFill not { pdfFillCS setcolorspace } if
+      dup /pdfFill exch def aload pop pdfFillXform setcolor
+     /pdfLastFill true def /pdfLastStroke false def } def
+/SC { pdfLastStroke not { pdfStrokeCS setcolorspace } if
+      dup /pdfStroke exch def aload pop pdfStrokeXform setcolor
+     /pdfLastStroke true def /pdfLastFill false def } def
+/op { /pdfFillOP exch def
+      pdfLastFill { pdfFillOP setoverprint } if } def
+/OP { /pdfStrokeOP exch def
+      pdfLastStroke { pdfStrokeOP setoverprint } if } def
+/fCol {
+  pdfLastFill not {
+    pdfFillCS setcolorspace
+    pdfFill aload pop pdfFillXform setcolor
+    pdfFillOP setoverprint
+    /pdfLastFill true def /pdfLastStroke false def
+  } if
+} def
+/sCol {
+  pdfLastStroke not {
+    pdfStrokeCS setcolorspace
+    pdfStroke aload pop pdfStrokeXform setcolor
+    pdfStrokeOP setoverprint
+    /pdfLastStroke true def /pdfLastFill false def
+  } if
+} def
+% build a font
+/pdfMakeFont {
+  4 3 roll findfont
+  4 2 roll matrix scale makefont
+  dup length dict begin
+    { 1 index /FID ne { def } { pop pop } ifelse } forall
+    /Encoding exch def
+    currentdict
+  end
+  definefont pop
+} def
+/pdfMakeFont16 {
+  exch findfont
+  dup length dict begin
+    { 1 index /FID ne { def } { pop pop } ifelse } forall
+    /WMode exch def
+    currentdict
+  end
+  definefont pop
+} def
+/pdfMakeFont16L3 {
+  1 index /CIDFont resourcestatus {
+    pop pop 1 index /CIDFont findresource /CIDFontType known
+  } {
+    false
+  } ifelse
+  {
+    0 eq { /Identity-H } { /Identity-V } ifelse
+    exch 1 array astore composefont pop
+  } {
+    pdfMakeFont16
+  } ifelse
+} def
+% graphics state operators
+/q { gsave pdfDictSize dict begin } def
+/Q {
+  end grestore
+  /pdfLastFill where {
+    pop
+    pdfLastFill {
+      pdfFillOP setoverprint
+    } {
+      pdfStrokeOP setoverprint
+    } ifelse
+  } if
+  /pdfOPM where {
+    pop
+    pdfOPM /setoverprintmode where{pop setoverprintmode}{pop}ifelse 
+  } if
+} def
+/cm { concat } def
+/d { setdash } def
+/i { setflat } def
+/j { setlinejoin } def
+/J { setlinecap } def
+/M { setmiterlimit } def
+/w { setlinewidth } def
+% path segment operators
+/m { moveto } def
+/l { lineto } def
+/c { curveto } def
+/re { 4 2 roll moveto 1 index 0 rlineto 0 exch rlineto
+      neg 0 rlineto closepath } def
+/h { closepath } def
+% path painting operators
+/S { sCol stroke } def
+/Sf { fCol stroke } def
+/f { fCol fill } def
+/f* { fCol eofill } def
+% clipping operators
+/W { clip newpath } def
+/W* { eoclip newpath } def
+/Ws { strokepath clip newpath } def
+% text state operators
+/Tc { /pdfCharSpacing exch def } def
+/Tf { dup /pdfFontSize exch def
+      dup pdfHorizScaling mul exch matrix scale
+      pdfTextMat matrix concatmatrix dup 4 0 put dup 5 0 put
+      exch findfont exch makefont setfont } def
+/Tr { /pdfTextRender exch def } def
+/Tp { /pdfPatternCS exch def } def
+/Ts { /pdfTextRise exch def } def
+/Tw { /pdfWordSpacing exch def } def
+/Tz { /pdfHorizScaling exch def } def
+% text positioning operators
+/Td { pdfTextMat transform moveto } def
+/Tm { /pdfTextMat exch def } def
+% text string operators
+/xyshow where {
+  pop
+  /xyshow2 {
+    dup length array
+    0 2 2 index length 1 sub {
+      2 index 1 index 2 copy get 3 1 roll 1 add get
+      pdfTextMat dtransform
+      4 2 roll 2 copy 6 5 roll put 1 add 3 1 roll dup 4 2 roll put
+    } for
+    exch pop
+    xyshow
+  } def
+}{
+  /xyshow2 {
+    currentfont /FontType get 0 eq {
+      0 2 3 index length 1 sub {
+        currentpoint 4 index 3 index 2 getinterval show moveto
+        2 copy get 2 index 3 2 roll 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } {
+      0 1 3 index length 1 sub {
+        currentpoint 4 index 3 index 1 getinterval show moveto
+        2 copy 2 mul get 2 index 3 2 roll 2 mul 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } ifelse
+    pop pop
+  } def
+} ifelse
+/cshow where {
+  pop
+  /xycp {
+    0 3 2 roll
+    {
+      pop pop currentpoint 3 2 roll
+      1 string dup 0 4 3 roll put false charpath moveto
+      2 copy get 2 index 2 index 1 add get
+      pdfTextMat dtransform rmoveto
+      2 add
+    } exch cshow
+    pop pop
+  } def
+}{
+  /xycp {
+    currentfont /FontType get 0 eq {
+      0 2 3 index length 1 sub {
+        currentpoint 4 index 3 index 2 getinterval false charpath moveto
+        2 copy get 2 index 3 2 roll 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } {
+      0 1 3 index length 1 sub {
+        currentpoint 4 index 3 index 1 getinterval false charpath moveto
+        2 copy 2 mul get 2 index 3 2 roll 2 mul 1 add get
+        pdfTextMat dtransform rmoveto
+      } for
+    } ifelse
+    pop pop
+  } def
+} ifelse
+/Tj {
+  fCol
+  0 pdfTextRise pdfTextMat dtransform rmoveto
+  currentpoint 4 2 roll
+  pdfTextRender 1 and 0 eq {
+    2 copy xyshow2
+  } if
+  pdfTextRender 3 and dup 1 eq exch 2 eq or {
+    3 index 3 index moveto
+    2 copy
+    currentfont /FontType get 3 eq { fCol } { sCol } ifelse
+    xycp currentpoint stroke moveto
+  } if
+  pdfTextRender 4 and 0 ne {
+    4 2 roll moveto xycp
+    /pdfTextClipPath [ pdfTextClipPath aload pop
+      {/moveto cvx}
+      {/lineto cvx}
+      {/curveto cvx}
+      {/closepath cvx}
+    pathforall ] def
+    currentpoint newpath moveto
+  } {
+    pop pop pop pop
+  } ifelse
+  0 pdfTextRise neg pdfTextMat dtransform rmoveto
+} def
+/TJm { 0.001 mul pdfFontSize mul pdfHorizScaling mul neg 0
+       pdfTextMat dtransform rmoveto } def
+/TJmV { 0.001 mul pdfFontSize mul neg 0 exch
+        pdfTextMat dtransform rmoveto } def
+/Tclip { pdfTextClipPath cvx exec clip newpath
+         /pdfTextClipPath [] def } def
+/Tclip* { pdfTextClipPath cvx exec eoclip newpath
+         /pdfTextClipPath [] def } def
+% Level 2/3 image operators
+/pdfImBuf 100 string def
+/pdfImStr {
+  2 copy exch length lt {
+    2 copy get exch 1 add exch
+  } {
+    ()
+  } ifelse
+} def
+/skipEOD {
+  { currentfile pdfImBuf readline
+    not { pop exit } if
+    (%-EOD-) eq { exit } if } loop
+} def
+/pdfIm { image skipEOD } def
+/pdfMask {
+  /ReusableStreamDecode filter
+  skipEOD
+  /maskStream exch def
+} def
+/pdfMaskEnd { maskStream closefile } def
+/pdfMaskInit {
+  /maskArray exch def
+  /maskIdx 0 def
+} def
+/pdfMaskSrc {
+  maskIdx maskArray length lt {
+    maskArray maskIdx get
+    /maskIdx maskIdx 1 add def
+  } {
+    ()
+  } ifelse
+} def
+/pdfImM { fCol imagemask skipEOD } def
+/pr { 2 index 2 index 3 2 roll putinterval 4 add } def
+/pdfImClip {
+  gsave
+  0 2 4 index length 1 sub {
+    dup 4 index exch 2 copy
+    get 5 index div put
+    1 add 3 index exch 2 copy
+    get 3 index div put
+  } for
+  pop pop rectclip
+} def
+/pdfImClipEnd { grestore } def
+% shading operators
+/colordelta {
+  false 0 1 3 index length 1 sub {
+    dup 4 index exch get 3 index 3 2 roll get sub abs 0.004 gt {
+      pop true
+    } if
+  } for
+  exch pop exch pop
+} def
+/funcCol { func n array astore } def
+/funcSH {
+  dup 0 eq {
+    true
+  } {
+    dup 6 eq {
+      false
+    } {
+      4 index 4 index funcCol dup
+      6 index 4 index funcCol dup
+      3 1 roll colordelta 3 1 roll
+      5 index 5 index funcCol dup
+      3 1 roll colordelta 3 1 roll
+      6 index 8 index funcCol dup
+      3 1 roll colordelta 3 1 roll
+      colordelta or or or
+    } ifelse
+  } ifelse
+  {
+    1 add
+    4 index 3 index add 0.5 mul exch 4 index 3 index add 0.5 mul exch
+    6 index 6 index 4 index 4 index 4 index funcSH
+    2 index 6 index 6 index 4 index 4 index funcSH
+    6 index 2 index 4 index 6 index 4 index funcSH
+    5 3 roll 3 2 roll funcSH pop pop
+  } {
+    pop 3 index 2 index add 0.5 mul 3 index  2 index add 0.5 mul
+    funcCol sc
+    dup 4 index exch mat transform m
+    3 index 3 index mat transform l
+    1 index 3 index mat transform l
+    mat transform l pop pop h f*
+  } ifelse
+} def
+/axialCol {
+  dup 0 lt {
+    pop t0
+  } {
+    dup 1 gt {
+      pop t1
+    } {
+      dt mul t0 add
+    } ifelse
+  } ifelse
+  func n array astore
+} def
+/axialSH {
+  dup 0 eq {
+    true
+  } {
+    dup 8 eq {
+      false
+    } {
+      2 index axialCol 2 index axialCol colordelta
+    } ifelse
+  } ifelse
+  {
+    1 add 3 1 roll 2 copy add 0.5 mul
+    dup 4 3 roll exch 4 index axialSH
+    exch 3 2 roll axialSH
+  } {
+    pop 2 copy add 0.5 mul
+    axialCol sc
+    exch dup dx mul x0 add exch dy mul y0 add
+    3 2 roll dup dx mul x0 add exch dy mul y0 add
+    dx abs dy abs ge {
+      2 copy yMin sub dy mul dx div add yMin m
+      yMax sub dy mul dx div add yMax l
+      2 copy yMax sub dy mul dx div add yMax l
+      yMin sub dy mul dx div add yMin l
+      h f*
+    } {
+      exch 2 copy xMin sub dx mul dy div add xMin exch m
+      xMax sub dx mul dy div add xMax exch l
+      exch 2 copy xMax sub dx mul dy div add xMax exch l
+      xMin sub dx mul dy div add xMin exch l
+      h f*
+    } ifelse
+  } ifelse
+} def
+/radialCol {
+  dup t0 lt {
+    pop t0
+  } {
+    dup t1 gt {
+      pop t1
+    } if
+  } ifelse
+  func n array astore
+} def
+/radialSH {
+  dup 0 eq {
+    true
+  } {
+    dup 8 eq {
+      false
+    } {
+      2 index dt mul t0 add radialCol
+      2 index dt mul t0 add radialCol colordelta
+    } ifelse
+  } ifelse
+  {
+    1 add 3 1 roll 2 copy add 0.5 mul
+    dup 4 3 roll exch 4 index radialSH
+    exch 3 2 roll radialSH
+  } {
+    pop 2 copy add 0.5 mul dt mul t0 add
+    radialCol sc
+    encl {
+      exch dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      0 360 arc h
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      360 0 arcn h f
+    } {
+      2 copy
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a1 a2 arcn
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a2 a1 arcn h
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a1 a2 arc
+      dup dx mul x0 add exch dup dy mul y0 add exch dr mul r0 add
+      a2 a1 arc h f
+    } ifelse
+  } ifelse
+} def
+end
+%%EndResource
+/CIDInit /ProcSet findresource begin
+10 dict begin
+  begincmap
+  /CMapType 1 def
+  /CMapName /Identity-H def
+  /CIDSystemInfo 3 dict dup begin
+    /Registry (Adobe) def
+    /Ordering (Identity) def
+    /Supplement 0 def
+  end def
+  1 begincodespacerange
+    <0000> <ffff>
+  endcodespacerange
+  0 usefont
+  1 begincidrange
+    <0000> <ffff> 0
+  endcidrange
+  endcmap
+  currentdict CMapName exch /CMap defineresource pop
+end
+10 dict begin
+  begincmap
+  /CMapType 1 def
+  /CMapName /Identity-V def
+  /CIDSystemInfo 3 dict dup begin
+    /Registry (Adobe) def
+    /Ordering (Identity) def
+    /Supplement 0 def
+  end def
+  /WMode 1 def
+  1 begincodespacerange
+    <0000> <ffff>
+  endcodespacerange
+  0 usefont
+  1 begincidrange
+    <0000> <ffff> 0
+  endcidrange
+  endcmap
+  currentdict CMapName exch /CMap defineresource pop
+end
+end
+%%EndProlog
+%%BeginSetup
+xpdf begin
+%%EndSetup
+pdfStartPage
+%%EndPageSetup
+[] 0 d
+1 i
+0 j
+0 J
+10 M
+1 w
+/DeviceGray {} cs
+[0] sc
+/DeviceGray {} CS
+[0] SC
+false op
+false OP
+{} settransfer
+0 0 2400 1017.12 re
+W
+q
+[0.24 0 0 -0.24 0 1017.12] cm
+q
+0 0 10000 4234.375 re
+W*
+q
+[48.783241 0 0 48.766369 2560.8376 -1369.56274] cm
+/DeviceRGB {} CS
+[1 1 1] SC
+/DeviceRGB {} cs
+[1 1 1] sc
+29.399 57.112 m
+30.014 57.419998 30.476 57.958 30.476 58.494999 c
+30.476 59.534 29.438 60.455997 28.476999 59.957001 c
+13.254 52.076 l
+12.408 51.577 11.678 51.268002 11.678 50.192001 c
+11.678 49.077 12.37 48.807003 13.254 48.27 c
+28.476999 40.389 l
+29.514999 40.042999 30.476 40.813 30.476 41.851002 c
+30.476 42.426003 30.014999 42.965 29.399 43.274002 c
+15.638 50.192001 l
+29.399 57.112 l
+h
+f
+29.033001 60.209 m
+28.825001 60.209 28.620001 60.157001 28.425001 60.056999 c
+13.202002 52.175999 l
+13.116001 52.125999 13.037002 52.080997 12.960002 52.035 c
+12.212002 51.604 11.565002 51.230999 11.565002 50.192001 c
+11.565002 49.135002 12.159002 48.786003 12.911002 48.343002 c
+13.004003 48.289001 13.098002 48.233002 13.195003 48.174004 c
+28.424004 40.289001 l
+28.619003 40.223 28.801004 40.192001 28.982004 40.192001 c
+29.882004 40.192001 30.588005 40.920002 30.588005 41.850002 c
+30.588005 42.437004 30.151005 43.022003 29.449005 43.372002 c
+15.887005 50.190002 l
+29.449005 57.008003 l
+30.140005 57.354004 30.588005 57.938004 30.588005 58.492004 c
+30.587999 59.407001 29.861 60.209 29.033001 60.209 c
+h
+28.982 40.418999 m
+28.826 40.418999 28.668001 40.445 28.512001 40.496998 c
+13.306 48.369999 l
+13.215 48.426998 13.118 48.482998 13.025 48.536999 c
+12.282 48.975998 11.790999 49.264999 11.790999 50.191998 c
+11.790999 51.101997 12.327999 51.410999 13.072 51.839996 c
+13.151 51.884995 13.23 51.929996 13.311 51.978996 c
+28.528 59.855995 l
+28.690001 59.939995 28.860001 59.982994 29.032 59.982994 c
+29.729 59.982994 30.362 59.273994 30.362 58.494995 c
+30.362 58.029995 29.955 57.514996 29.348 57.211994 c
+15.386 50.191994 l
+29.348 43.171993 l
+29.963999 42.863995 30.362 42.343994 30.362 41.850994 c
+30.363001 41.048 29.756001 40.418999 28.982 40.418999 c
+h
+f
+46.384998 64.416 m
+46.153999 65.107002 45.462997 65.493004 44.771 65.376999 c
+44.001999 65.223999 43.501999 64.491997 43.617001 63.684998 c
+43.617001 63.608997 43.656002 63.493996 43.694 63.377998 c
+53.574001 35.546997 l
+53.804001 34.854996 54.496002 34.508999 55.188 34.623997 c
+55.917999 34.777996 56.457001 35.508995 56.341 36.275997 c
+56.341 36.353996 56.301998 36.468998 56.264 36.545998 c
+46.384998 64.416 l
+h
+f
+45.015999 65.511002 m
+44.927998 65.511002 44.839001 65.502998 44.752998 65.488998 c
+43.915997 65.321999 43.382 64.540001 43.505997 63.669998 c
+43.504997 63.593998 43.543995 63.476997 43.584995 63.351997 c
+53.467995 35.509998 l
+53.674995 34.891998 54.245995 34.489998 54.924995 34.489998 c
+55.018997 34.489998 55.112995 34.498997 55.205994 34.512997 c
+56.017994 34.684998 56.574993 35.482998 56.452995 36.293995 c
+56.453995 36.379993 56.405994 36.513996 56.365993 36.595993 c
+46.490993 64.451996 l
+46.280998 65.084 45.688 65.511002 45.015999 65.511002 c
+h
+54.924999 34.715 m
+54.344997 34.715 53.856998 35.055 53.681 35.582001 c
+43.800999 63.415001 l
+43.765999 63.519001 43.730999 63.628002 43.730999 63.685001 c
+43.622997 64.452003 44.079998 65.124001 44.792999 65.266998 c
+44.863998 65.278999 44.939999 65.284996 45.015999 65.284996 c
+45.591 65.284996 46.098999 64.921997 46.278999 64.380997 c
+56.16 36.508995 l
+56.201 36.423996 56.23 36.326996 56.23 36.277996 c
+56.334999 35.565994 55.856998 34.881996 55.166 34.734997 c
+55.089001 34.722 55.007 34.715 54.924999 34.715 c
+h
+f
+84.362 50.192001 m
+70.599998 43.273998 l
+69.986 42.964996 69.525002 42.425999 69.525002 41.850998 c
+69.525002 40.813 70.562004 39.888996 71.523003 40.388996 c
+86.746002 48.269997 l
+87.631004 48.806995 88.321999 49.076996 88.321999 50.191998 c
+88.321999 51.267998 87.591995 51.576996 86.746002 52.075996 c
+71.523003 59.956997 l
+70.562004 60.455997 69.525002 59.533997 69.525002 58.494995 c
+69.525002 57.957996 69.986 57.419994 70.599998 57.111996 c
+84.362 50.192001 l
+h
+f
+70.967003 60.209 m
+70.139 60.209 69.411003 59.407001 69.411003 58.494999 c
+69.411003 57.939999 69.858002 57.355999 70.550003 57.010998 c
+84.112 50.192997 l
+70.550003 43.374001 l
+69.848 43.021999 69.411003 42.438 69.411003 41.852001 c
+69.411003 40.939003 70.139 40.138 70.967003 40.138 c
+71.176003 40.138 71.380005 40.188999 71.575005 40.290001 c
+86.798004 48.171001 l
+86.902 48.233002 86.996002 48.290001 87.088005 48.344002 c
+87.841003 48.786003 88.435005 49.136002 88.435005 50.193001 c
+88.435005 51.232002 87.789001 51.605 87.040009 52.035999 c
+86.962006 52.082001 86.883011 52.126999 86.803009 52.174 c
+71.575012 60.057999 l
+71.379997 60.157001 71.176003 60.209 70.967003 60.209 c
+h
+70.967003 40.362999 m
+70.271004 40.362999 69.637001 41.071999 69.637001 41.850998 c
+69.637001 42.343998 70.034004 42.863998 70.651001 43.171997 c
+84.612999 50.191998 l
+70.651001 57.211998 l
+70.044998 57.516998 69.637001 58.031998 69.637001 58.494999 c
+69.637001 59.273998 70.271004 59.982998 70.967003 59.982998 c
+71.139 59.982998 71.309006 59.939999 71.471001 59.855999 c
+86.694 51.975998 l
+86.768997 51.929996 86.848999 51.884998 86.927002 51.839996 c
+87.671005 51.409996 88.209 51.101997 88.209 50.191998 c
+88.209 49.263996 87.718002 48.975998 86.973999 48.536999 c
+86.880997 48.482998 86.785995 48.426998 86.686996 48.367001 c
+71.470993 40.491001 l
+71.308998 40.404999 71.139 40.362999 70.967003 40.362999 c
+h
+f
+Q
+q
+[99.016907 0 0 98.982658 152.13266 1942.3326] cm
+/DeviceRGB {} CS
+[1 1 1] SC
+/DeviceRGB {} cs
+[1 1 1] sc
+10.56 5.52 m
+11.373334 5.826667 12.106668 6.32 12.76 7 c
+14.160001 8.413333 14.860001 10.216666 14.860001 12.41 c
+14.860001 14.603334 14.160001 16.413334 12.76 17.84 c
+12.106668 18.52 11.373334 19.013334 10.56 19.32 c
+9.72 19.666666 8.860001 19.84 7.980001 19.84 c
+2.320001 19.84 l
+2.133334 19.84 1.970001 19.77 1.830001 19.630001 c
+1.690001 19.490002 1.620001 19.326668 1.620001 19.140001 c
+1.620001 17.700001 l
+1.620001 17.500002 1.690001 17.330002 1.830001 17.190001 c
+1.970001 17.049999 2.133334 16.98 2.320001 16.980001 c
+7.920001 16.980001 l
+9.106668 16.980001 10.070001 16.546669 10.81 15.680001 c
+11.55 14.813335 11.92 13.726667 11.92 12.420001 c
+11.92 11.113335 11.55 10.026668 10.81 9.160001 c
+10.070001 8.293334 9.106668 7.860001 7.920001 7.860001 c
+2.320001 7.860001 l
+2.133334 7.860001 1.970001 7.79 1.830001 7.650001 c
+1.690001 7.510001 1.620001 7.340001 1.620001 7.14 c
+1.620001 5.7 l
+1.620001 5.513333 1.690001 5.35 1.830001 5.21 c
+1.970001 5.07 2.133334 5 2.320001 5 c
+7.980001 5 l
+8.860001 5 9.72 5.173333 10.56 5.52 c
+h
+32.208 18.860001 m
+32.301334 19.073334 32.278 19.290001 32.138 19.51 c
+31.998001 19.73 31.808001 19.84 31.568001 19.84 c
+18.248001 19.84 l
+18.128 19.84 18.014668 19.809999 17.908001 19.75 c
+17.801334 19.690001 17.721334 19.613333 17.668001 19.52 c
+17.521336 19.306667 17.501335 19.086668 17.608002 18.860001 c
+18.228003 17.400002 l
+18.281336 17.266668 18.368002 17.160002 18.488003 17.080002 c
+18.608004 17.000002 18.734669 16.960003 18.868002 16.960001 c
+28.188002 16.960001 l
+24.908001 9.120001 l
+22.228001 15.520001 l
+22.174667 15.653334 22.091333 15.756667 21.978001 15.830001 c
+21.864668 15.903335 21.734667 15.940002 21.588001 15.940001 c
+19.908001 15.940001 l
+19.654669 15.940001 19.454668 15.833334 19.308001 15.620001 c
+19.254667 15.526668 19.221334 15.420001 19.208 15.300001 c
+19.194666 15.180001 19.208 15.066669 19.248001 14.960001 c
+23.308001 5.440001 l
+23.361334 5.306667 23.444668 5.200001 23.558001 5.12 c
+23.671333 5.04 23.801334 5 23.948 5.000001 c
+25.868 5.000001 l
+26.014666 5.000001 26.144667 5.04 26.257999 5.12 c
+26.371332 5.2 26.454666 5.306667 26.507999 5.440001 c
+32.208 18.860001 l
+h
+45.535999 12.42 m
+46.109333 12.78 46.546001 13.22 46.846001 13.74 c
+47.146 14.259999 47.296001 14.839999 47.296001 15.48 c
+47.296001 16.986666 46.722668 18.139999 45.576 18.939999 c
+44.802666 19.499998 43.756001 19.853333 42.436001 19.999998 c
+42.355999 19.999998 l
+42.169334 19.999998 42.015999 19.939999 41.896 19.819998 c
+41.736 19.673332 41.655998 19.499998 41.655998 19.299997 c
+41.655998 17.859997 l
+41.655998 17.686663 41.716 17.533331 41.835999 17.399998 c
+41.955997 17.266665 42.102665 17.186665 42.275997 17.159998 c
+42.902664 17.09333 43.389328 16.946665 43.735996 16.719997 c
+44.002663 16.559998 44.182663 16.353331 44.275997 16.099997 c
+44.32933 15.95333 44.355999 15.766663 44.355999 15.539996 c
+44.355999 15.39333 44.32933 15.266663 44.275997 15.159996 c
+44.222664 15.05333 44.12933 14.953329 43.995998 14.859996 c
+43.609329 14.593329 43.109329 14.366663 42.495998 14.179996 c
+42.175999 14.079995 l
+41.509331 13.893329 40.896 13.739995 40.335999 13.619995 c
+40.216 13.593328 40.022663 13.546661 39.755997 13.479995 c
+39.535995 13.419994 l
+39.055996 13.299995 38.549328 13.133327 38.015995 12.919994 c
+37.229328 12.586661 36.582661 12.166661 36.075996 11.659994 c
+35.48933 11.073327 35.195995 10.299995 35.195995 9.339994 c
+35.195995 8.019995 35.702663 6.946661 36.715996 6.119994 c
+37.409328 5.533328 38.382664 5.159994 39.635994 4.999994 c
+39.849327 4.973328 40.032661 5.033328 40.185993 5.179994 c
+40.339325 5.326661 40.415993 5.499994 40.415993 5.699994 c
+40.415993 7.139994 l
+40.415993 7.313327 40.362659 7.466661 40.255993 7.599994 c
+40.149326 7.733328 40.012661 7.809994 39.845993 7.829994 c
+39.679325 7.849994 39.509327 7.886661 39.335995 7.939994 c
+38.949326 8.08666 38.675995 8.229994 38.515995 8.369994 c
+38.355995 8.509995 38.242664 8.653328 38.175995 8.799995 c
+38.109329 9.026661 38.075996 9.239995 38.075996 9.439995 c
+38.075996 9.546661 38.135998 9.659995 38.255997 9.779995 c
+38.442661 9.966662 38.715996 10.133328 39.075996 10.279995 c
+39.235996 10.346662 39.515999 10.446662 39.915997 10.579995 c
+42.415997 11.199995 l
+42.535995 11.239995 l
+43.162663 11.413328 43.615993 11.546661 43.895996 11.639995 c
+44.522663 11.853328 45.069328 12.113328 45.535995 12.419994 c
+45.535999 12.42 l
+h
+42.195999 7.9 m
+42.035999 7.86 41.905998 7.776667 41.806 7.65 c
+41.706001 7.523334 41.656002 7.373334 41.655998 7.2 c
+41.655998 5.74 l
+41.655998 5.526667 41.742664 5.346667 41.915997 5.2 c
+41.982662 5.133334 42.069328 5.09 42.175995 5.07 c
+42.282661 5.05 42.38266 5.046667 42.475994 5.06 c
+43.649326 5.246667 44.602661 5.646667 45.335995 6.26 c
+46.335995 7.086667 46.869328 8.14 46.935993 9.42 c
+46.949326 9.606667 46.885994 9.776667 46.745995 9.93 c
+46.605995 10.083334 46.435997 10.160001 46.235996 10.16 c
+44.675995 10.16 l
+44.502663 10.16 44.349331 10.099999 44.215996 9.98 c
+44.082661 9.86 44.009327 9.713333 43.995995 9.54 c
+43.942661 9.193334 43.829327 8.906667 43.655994 8.68 c
+43.375996 8.346667 42.942661 8.093333 42.355995 7.92 c
+42.315994 7.92 42.289326 7.913333 42.275993 7.9 c
+42.195992 7.9 l
+42.195999 7.9 l
+h
+39.855999 17.08 m
+40.015999 17.106667 40.149334 17.186666 40.256001 17.32 c
+40.362667 17.453333 40.416 17.599998 40.416 17.76 c
+40.416 19.24 l
+40.416 19.453333 40.335999 19.633333 40.175999 19.780001 c
+40.042664 19.886667 39.889332 19.940001 39.716 19.940001 c
+39.616001 19.940001 l
+38.375999 19.753334 37.355999 19.346666 36.556 18.720001 c
+35.515999 17.893335 34.929333 16.740002 34.796001 15.260001 c
+34.769333 15.046668 34.829334 14.863335 34.976002 14.710001 c
+35.122669 14.556667 35.296001 14.480001 35.496002 14.480001 c
+37.076004 14.480001 l
+37.262669 14.480001 37.422668 14.543335 37.556004 14.670001 c
+37.689339 14.796667 37.762672 14.953334 37.776005 15.140001 c
+37.816006 15.806668 38.142673 16.320002 38.756004 16.68 c
+39.036003 16.84 39.402668 16.973333 39.856003 17.08 c
+39.855999 17.08 l
+h
+60.883999 11.12 m
+61.084 11.12 61.253998 11.19 61.393997 11.33 c
+61.533997 11.47 61.603996 11.64 61.603996 11.84 c
+61.603996 13.32 l
+61.603996 13.506666 61.533997 13.669999 61.393997 13.81 c
+61.253998 13.95 61.084 14.02 60.883999 14.02 c
+54.304001 14.02 l
+54.304001 19.139999 l
+54.304001 19.326666 54.237335 19.49 54.104 19.629999 c
+53.970665 19.769999 53.804001 19.839998 53.604 19.839998 c
+52.084 19.839998 l
+51.897335 19.839998 51.734001 19.769999 51.593998 19.629999 c
+51.453995 19.49 51.383995 19.326666 51.383999 19.139999 c
+51.383999 11.839999 l
+51.383999 11.639999 51.453999 11.469999 51.593998 11.329999 c
+51.733997 11.189999 51.897331 11.119999 52.084 11.119999 c
+60.883999 11.119999 l
+60.883999 11.12 l
+h
+61.784 5 m
+61.970665 5 62.133999 5.07 62.274002 5.21 c
+62.414005 5.35 62.484005 5.513333 62.484001 5.7 c
+62.484001 7.16 l
+62.484001 7.36 62.414001 7.53 62.274002 7.67 c
+62.134003 7.81 61.970669 7.88 61.784 7.88 c
+52.084 7.88 l
+51.897335 7.88 51.734001 7.81 51.593998 7.67 c
+51.453995 7.53 51.383995 7.36 51.383999 7.16 c
+51.383999 5.7 l
+51.383999 5.513333 51.453999 5.35 51.593998 5.21 c
+51.733997 5.07 51.897331 5.000001 52.084 5 c
+61.784 5 l
+h
+79.512001 18.860001 m
+79.605331 19.073334 79.582001 19.290001 79.442001 19.51 c
+79.302002 19.73 79.112 19.84 78.872002 19.84 c
+65.552002 19.84 l
+65.431999 19.84 65.318672 19.809999 65.212006 19.75 c
+65.105339 19.690001 65.025345 19.613333 64.972008 19.52 c
+64.82534 19.306667 64.805344 19.086668 64.91201 18.860001 c
+65.532013 17.400002 l
+65.58535 17.266668 65.672012 17.160002 65.792015 17.080002 c
+65.912018 17.000002 66.038681 16.960003 66.172012 16.960001 c
+75.492012 16.960001 l
+72.212013 9.120001 l
+69.532013 15.520001 l
+69.478676 15.653334 69.395348 15.756667 69.282013 15.830001 c
+69.168678 15.903335 69.038681 15.940002 68.892014 15.940001 c
+67.212013 15.940001 l
+66.958679 15.940001 66.758682 15.833334 66.612015 15.620001 c
+66.558678 15.526668 66.525345 15.420001 66.512016 15.300001 c
+66.498688 15.180001 66.512016 15.066669 66.552017 14.960001 c
+70.612015 5.440001 l
+70.665352 5.306667 70.74868 5.200001 70.862015 5.12 c
+70.975349 5.04 71.105347 5 71.252014 5.000001 c
+73.172012 5.000001 l
+73.31868 5.000001 73.448677 5.04 73.562012 5.12 c
+73.675346 5.2 73.758675 5.306667 73.812012 5.440001 c
+79.512001 18.860001 l
+h
+92 5.52 m
+92.813332 5.826667 93.546669 6.32 94.199997 7 c
+95.599998 8.413333 96.299995 10.216666 96.299995 12.41 c
+96.299995 14.603334 95.599998 16.413334 94.199997 17.84 c
+93.546661 18.52 92.813332 19.013334 92 19.32 c
+91.159996 19.666666 90.299995 19.84 89.419998 19.84 c
+83.759995 19.84 l
+83.573326 19.84 83.409996 19.77 83.269997 19.630001 c
+83.129997 19.490002 83.059998 19.326668 83.059998 19.140001 c
+83.059998 17.700001 l
+83.059998 17.500002 83.129997 17.330002 83.269997 17.190001 c
+83.409996 17.049999 83.573326 16.98 83.759995 16.980001 c
+89.359993 16.980001 l
+90.546661 16.980001 91.509995 16.546669 92.249992 15.680001 c
+92.98999 14.813335 93.359993 13.726667 93.359993 12.420001 c
+93.359993 11.113335 92.98999 10.026668 92.249992 9.160001 c
+91.509995 8.293334 90.546661 7.860001 89.359993 7.860001 c
+83.759995 7.860001 l
+83.573326 7.860001 83.409996 7.79 83.269997 7.650001 c
+83.129997 7.510001 83.059998 7.340001 83.059998 7.14 c
+83.059998 5.7 l
+83.059998 5.513333 83.129997 5.35 83.269997 5.21 c
+83.409996 5.07 83.573326 5 83.759995 5 c
+89.419998 5 l
+90.299995 5 91.159996 5.173333 92 5.52 c
+h
+f
+Q
+Q
+Q
+showpage
+%%PageTrailer
+pdfEndPage
+%%Trailer
+end
+%%DocumentSuppliedResources:
+%%EOF

public/assets/dasfad/Logo Files/For Web/svg/Black logo - no background.svg

@@ -0,0 +1,40 @@
+<svg xmlns="http://www.w3.org/2000/svg" version="1.1" width="3200"
+     height="1355.480324331485" viewBox="0 0 3200 1355.480324331485">
+
+    <g transform="scale(10) translate(10, 10)">
+        <defs id="SvgjsDefs1385">
+            <linearGradient id="SvgjsLinearGradient1390">
+                <stop id="SvgjsStop1391" stop-color="#905e26" offset="0"/>
+                <stop id="SvgjsStop1392" stop-color="#f5ec9b" offset="0.5"/>
+                <stop id="SvgjsStop1393" stop-color="#905e26" offset="1"/>
+            </linearGradient>
+            <linearGradient id="SvgjsLinearGradient1394">
+                <stop id="SvgjsStop1395" stop-color="#905e26" offset="0"/>
+                <stop id="SvgjsStop1396" stop-color="#f5ec9b" offset="0.5"/>
+                <stop id="SvgjsStop1397" stop-color="#905e26" offset="1"/>
+            </linearGradient>
+        </defs>
+        <g id="SvgjsG1386" featureKey="aMgJeN-0"
+           transform="matrix(1.5610770874511997,0,0,1.5610770874511997,71.94613967240352,-53.841545411371435)"
+           fill="#000">
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.399,57.112c0.615,0.308,1.077,0.846,1.077,1.383c0,1.039-1.038,1.961-1.999,1.462l-15.223-7.881  c-0.846-0.499-1.576-0.808-1.576-1.884c0-1.115,0.692-1.385,1.576-1.922l15.223-7.881c1.038-0.346,1.999,0.424,1.999,1.462  c0,0.575-0.461,1.114-1.077,1.423l-13.761,6.918L29.399,57.112z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.033,60.209c-0.208,0-0.413-0.052-0.608-0.152l-15.223-7.881c-0.086-0.05-0.165-0.095-0.242-0.141  c-0.748-0.431-1.395-0.804-1.395-1.843c0-1.057,0.594-1.406,1.346-1.849c0.093-0.054,0.187-0.11,0.284-0.169l15.229-7.885  c0.195-0.066,0.377-0.097,0.558-0.097c0.9,0,1.606,0.728,1.606,1.658c0,0.587-0.437,1.172-1.139,1.522l-13.562,6.818l13.562,6.818  c0.691,0.346,1.139,0.93,1.139,1.484C30.588,59.407,29.861,60.209,29.033,60.209z M28.982,40.419c-0.156,0-0.314,0.026-0.47,0.078  L13.306,48.37c-0.091,0.057-0.188,0.113-0.281,0.167c-0.743,0.439-1.234,0.728-1.234,1.655c0,0.91,0.537,1.219,1.281,1.648  c0.079,0.045,0.158,0.09,0.239,0.139l15.217,7.877c0.162,0.084,0.332,0.127,0.504,0.127c0.697,0,1.33-0.709,1.33-1.488  c0-0.465-0.407-0.98-1.014-1.283l-13.962-7.02l13.962-7.02c0.616-0.308,1.014-0.828,1.014-1.321  C30.363,41.048,29.756,40.419,28.982,40.419z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M46.385,64.416c-0.231,0.691-0.922,1.077-1.614,0.961c-0.769-0.153-1.269-0.885-1.154-1.692  c0-0.076,0.039-0.191,0.077-0.307l9.88-27.831c0.23-0.692,0.922-1.038,1.614-0.923c0.73,0.154,1.269,0.885,1.153,1.652  c0,0.078-0.039,0.193-0.077,0.27L46.385,64.416z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M45.016,65.511c-0.088,0-0.177-0.008-0.263-0.022c-0.837-0.167-1.371-0.949-1.247-1.819  c-0.001-0.076,0.038-0.193,0.079-0.318l9.883-27.842c0.207-0.618,0.778-1.02,1.457-1.02c0.094,0,0.188,0.009,0.281,0.023  c0.812,0.172,1.369,0.97,1.247,1.781c0.001,0.086-0.047,0.22-0.087,0.302l-9.875,27.856C46.281,65.084,45.688,65.511,45.016,65.511z   M54.925,34.715c-0.58,0-1.068,0.34-1.244,0.867l-9.88,27.833c-0.035,0.104-0.07,0.213-0.07,0.27  c-0.108,0.767,0.349,1.439,1.062,1.582c0.071,0.012,0.147,0.018,0.223,0.018c0.575,0,1.083-0.363,1.263-0.904l9.881-27.872  c0.041-0.085,0.07-0.182,0.07-0.231c0.105-0.712-0.373-1.396-1.064-1.543C55.089,34.722,55.007,34.715,54.925,34.715z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M84.362,50.192L70.6,43.274c-0.614-0.309-1.075-0.848-1.075-1.423c0-1.038,1.037-1.962,1.998-1.462l15.223,7.881  c0.885,0.537,1.576,0.807,1.576,1.922c0,1.076-0.73,1.385-1.576,1.884l-15.223,7.881c-0.961,0.499-1.998-0.423-1.998-1.462  c0-0.537,0.461-1.075,1.075-1.383L84.362,50.192z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M70.967,60.209c-0.828,0-1.556-0.802-1.556-1.714c0-0.555,0.447-1.139,1.139-1.484l13.562-6.818L70.55,43.374  c-0.702-0.352-1.139-0.936-1.139-1.522c0-0.913,0.728-1.714,1.556-1.714c0.209,0,0.413,0.051,0.608,0.152l15.223,7.881  c0.104,0.062,0.198,0.119,0.29,0.173c0.753,0.442,1.347,0.792,1.347,1.849c0,1.039-0.646,1.412-1.395,1.843  c-0.078,0.046-0.157,0.091-0.237,0.138l-15.228,7.884C71.38,60.157,71.176,60.209,70.967,60.209z M70.967,40.363  c-0.696,0-1.33,0.709-1.33,1.488c0,0.493,0.397,1.013,1.014,1.321l13.962,7.02l-13.962,7.02c-0.606,0.305-1.014,0.82-1.014,1.283  c0,0.779,0.634,1.488,1.33,1.488c0.172,0,0.342-0.043,0.504-0.127l15.223-7.88c0.075-0.046,0.155-0.091,0.233-0.136  c0.744-0.43,1.282-0.738,1.282-1.648c0-0.928-0.491-1.216-1.235-1.655c-0.093-0.054-0.188-0.11-0.287-0.17l-15.216-7.876  C71.309,40.405,71.139,40.363,70.967,40.363z"/>
+        </g>
+        <g id="SvgjsG1387" featureKey="8L6ael-0"
+           transform="matrix(3.168568052463937,0,0,3.168568052463937,-5.1330821487142195,52.17667742743372)"
+           fill="#000">
+            <path d="M10.56 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z M32.208 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M45.535999999999994 12.42 q0.86 0.54 1.31 1.32 t0.45 1.74 q0 2.26 -1.72 3.46 q-1.16 0.84 -3.14 1.06 l-0.08 0 q-0.28 0 -0.46 -0.18 q-0.24 -0.22 -0.24 -0.52 l0 -1.44 q0 -0.26 0.18 -0.46 t0.44 -0.24 q0.94 -0.1 1.46 -0.44 q0.4 -0.24 0.54 -0.62 q0.08 -0.22 0.08 -0.56 q0 -0.22 -0.08 -0.38 t-0.28 -0.3 q-0.58 -0.4 -1.5 -0.68 l-0.32 -0.1 q-1 -0.28 -1.84 -0.46 q-0.18 -0.04 -0.58 -0.14 l-0.22 -0.06 q-0.72 -0.18 -1.52 -0.5 q-1.18 -0.5 -1.94 -1.26 q-0.88 -0.88 -0.88 -2.32 q0 -1.98 1.52 -3.22 q1.04 -0.88 2.92 -1.12 q0.32 -0.04 0.55 0.18 t0.23 0.52 l0 1.44 q0 0.26 -0.16 0.46 t-0.41 0.23 t-0.51 0.11 q-0.58 0.22 -0.82 0.43 t-0.34 0.43 q-0.1 0.34 -0.1 0.64 q0 0.16 0.18 0.34 q0.28 0.28 0.82 0.5 q0.24 0.1 0.84 0.3 l2.5 0.62 l0.12 0.04 q0.94 0.26 1.36 0.4 q0.94 0.32 1.64 0.78 z M42.196 7.9 q-0.24 -0.06 -0.39 -0.25 t-0.15 -0.45 l0 -1.46 q0 -0.32 0.26 -0.54 q0.1 -0.1 0.26 -0.13 t0.3 -0.01 q1.76 0.28 2.86 1.2 q1.5 1.24 1.6 3.16 q0.02 0.28 -0.19 0.51 t-0.51 0.23 l-1.56 0 q-0.26 0 -0.46 -0.18 t-0.22 -0.44 q-0.08 -0.52 -0.34 -0.86 q-0.42 -0.5 -1.3 -0.76 q-0.06 0 -0.08 -0.02 l-0.08 0 z M39.855999999999995 17.08 q0.24 0.04 0.4 0.24 t0.16 0.44 l0 1.48 q0 0.32 -0.24 0.54 q-0.2 0.16 -0.46 0.16 l-0.1 0 q-1.86 -0.28 -3.06 -1.22 q-1.56 -1.24 -1.76 -3.46 q-0.04 -0.32 0.18 -0.55 t0.52 -0.23 l1.58 0 q0.28 0 0.48 0.19 t0.22 0.47 q0.06 1 0.98 1.54 q0.42 0.24 1.1 0.4 z M60.88399999999999 11.12 q0.3 0 0.51 0.21 t0.21 0.51 l0 1.48 q0 0.28 -0.21 0.49 t-0.51 0.21 l-6.58 0 l0 5.12 q0 0.28 -0.2 0.49 t-0.5 0.21 l-1.52 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -7.3 q0 -0.3 0.21 -0.51 t0.49 -0.21 l8.8 0 z M61.78399999999999 5 q0.28 0 0.49 0.21 t0.21 0.49 l0 1.46 q0 0.3 -0.21 0.51 t-0.49 0.21 l-9.7 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.46 q0 -0.28 0.21 -0.49 t0.49 -0.21 l9.7 0 z M79.512 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M92 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z"/>
+        </g>
+    </g>
+</svg>
+	

public/assets/dasfad/Logo Files/For Web/svg/Color logo - no background.svg

@@ -0,0 +1,40 @@
+<svg xmlns="http://www.w3.org/2000/svg" version="1.1" width="3200"
+     height="1355.480324331485" viewBox="0 0 3200 1355.480324331485">
+
+    <g transform="scale(10) translate(10, 10)">
+        <defs id="SvgjsDefs1385">
+            <linearGradient id="SvgjsLinearGradient1390">
+                <stop id="SvgjsStop1391" stop-color="#905e26" offset="0"></stop>
+                <stop id="SvgjsStop1392" stop-color="#f5ec9b" offset="0.5"></stop>
+                <stop id="SvgjsStop1393" stop-color="#905e26" offset="1"></stop>
+            </linearGradient>
+            <linearGradient id="SvgjsLinearGradient1394">
+                <stop id="SvgjsStop1395" stop-color="#905e26" offset="0"></stop>
+                <stop id="SvgjsStop1396" stop-color="#f5ec9b" offset="0.5"></stop>
+                <stop id="SvgjsStop1397" stop-color="#905e26" offset="1"></stop>
+            </linearGradient>
+        </defs>
+        <g id="SvgjsG1386" featureKey="aMgJeN-0"
+           transform="matrix(1.5610770874511997,0,0,1.5610770874511997,71.94613967240352,-53.841545411371435)"
+           fill="url(#SvgjsLinearGradient1390)">
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.399,57.112c0.615,0.308,1.077,0.846,1.077,1.383c0,1.039-1.038,1.961-1.999,1.462l-15.223-7.881  c-0.846-0.499-1.576-0.808-1.576-1.884c0-1.115,0.692-1.385,1.576-1.922l15.223-7.881c1.038-0.346,1.999,0.424,1.999,1.462  c0,0.575-0.461,1.114-1.077,1.423l-13.761,6.918L29.399,57.112z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.033,60.209c-0.208,0-0.413-0.052-0.608-0.152l-15.223-7.881c-0.086-0.05-0.165-0.095-0.242-0.141  c-0.748-0.431-1.395-0.804-1.395-1.843c0-1.057,0.594-1.406,1.346-1.849c0.093-0.054,0.187-0.11,0.284-0.169l15.229-7.885  c0.195-0.066,0.377-0.097,0.558-0.097c0.9,0,1.606,0.728,1.606,1.658c0,0.587-0.437,1.172-1.139,1.522l-13.562,6.818l13.562,6.818  c0.691,0.346,1.139,0.93,1.139,1.484C30.588,59.407,29.861,60.209,29.033,60.209z M28.982,40.419c-0.156,0-0.314,0.026-0.47,0.078  L13.306,48.37c-0.091,0.057-0.188,0.113-0.281,0.167c-0.743,0.439-1.234,0.728-1.234,1.655c0,0.91,0.537,1.219,1.281,1.648  c0.079,0.045,0.158,0.09,0.239,0.139l15.217,7.877c0.162,0.084,0.332,0.127,0.504,0.127c0.697,0,1.33-0.709,1.33-1.488  c0-0.465-0.407-0.98-1.014-1.283l-13.962-7.02l13.962-7.02c0.616-0.308,1.014-0.828,1.014-1.321  C30.363,41.048,29.756,40.419,28.982,40.419z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M46.385,64.416c-0.231,0.691-0.922,1.077-1.614,0.961c-0.769-0.153-1.269-0.885-1.154-1.692  c0-0.076,0.039-0.191,0.077-0.307l9.88-27.831c0.23-0.692,0.922-1.038,1.614-0.923c0.73,0.154,1.269,0.885,1.153,1.652  c0,0.078-0.039,0.193-0.077,0.27L46.385,64.416z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M45.016,65.511c-0.088,0-0.177-0.008-0.263-0.022c-0.837-0.167-1.371-0.949-1.247-1.819  c-0.001-0.076,0.038-0.193,0.079-0.318l9.883-27.842c0.207-0.618,0.778-1.02,1.457-1.02c0.094,0,0.188,0.009,0.281,0.023  c0.812,0.172,1.369,0.97,1.247,1.781c0.001,0.086-0.047,0.22-0.087,0.302l-9.875,27.856C46.281,65.084,45.688,65.511,45.016,65.511z   M54.925,34.715c-0.58,0-1.068,0.34-1.244,0.867l-9.88,27.833c-0.035,0.104-0.07,0.213-0.07,0.27  c-0.108,0.767,0.349,1.439,1.062,1.582c0.071,0.012,0.147,0.018,0.223,0.018c0.575,0,1.083-0.363,1.263-0.904l9.881-27.872  c0.041-0.085,0.07-0.182,0.07-0.231c0.105-0.712-0.373-1.396-1.064-1.543C55.089,34.722,55.007,34.715,54.925,34.715z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M84.362,50.192L70.6,43.274c-0.614-0.309-1.075-0.848-1.075-1.423c0-1.038,1.037-1.962,1.998-1.462l15.223,7.881  c0.885,0.537,1.576,0.807,1.576,1.922c0,1.076-0.73,1.385-1.576,1.884l-15.223,7.881c-0.961,0.499-1.998-0.423-1.998-1.462  c0-0.537,0.461-1.075,1.075-1.383L84.362,50.192z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M70.967,60.209c-0.828,0-1.556-0.802-1.556-1.714c0-0.555,0.447-1.139,1.139-1.484l13.562-6.818L70.55,43.374  c-0.702-0.352-1.139-0.936-1.139-1.522c0-0.913,0.728-1.714,1.556-1.714c0.209,0,0.413,0.051,0.608,0.152l15.223,7.881  c0.104,0.062,0.198,0.119,0.29,0.173c0.753,0.442,1.347,0.792,1.347,1.849c0,1.039-0.646,1.412-1.395,1.843  c-0.078,0.046-0.157,0.091-0.237,0.138l-15.228,7.884C71.38,60.157,71.176,60.209,70.967,60.209z M70.967,40.363  c-0.696,0-1.33,0.709-1.33,1.488c0,0.493,0.397,1.013,1.014,1.321l13.962,7.02l-13.962,7.02c-0.606,0.305-1.014,0.82-1.014,1.283  c0,0.779,0.634,1.488,1.33,1.488c0.172,0,0.342-0.043,0.504-0.127l15.223-7.88c0.075-0.046,0.155-0.091,0.233-0.136  c0.744-0.43,1.282-0.738,1.282-1.648c0-0.928-0.491-1.216-1.235-1.655c-0.093-0.054-0.188-0.11-0.287-0.17l-15.216-7.876  C71.309,40.405,71.139,40.363,70.967,40.363z"></path>
+        </g>
+        <g id="SvgjsG1387" featureKey="8L6ael-0"
+           transform="matrix(3.168568052463937,0,0,3.168568052463937,-5.1330821487142195,52.17667742743372)"
+           fill="url(#SvgjsLinearGradient1394)">
+            <path d="M10.56 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z M32.208 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M45.535999999999994 12.42 q0.86 0.54 1.31 1.32 t0.45 1.74 q0 2.26 -1.72 3.46 q-1.16 0.84 -3.14 1.06 l-0.08 0 q-0.28 0 -0.46 -0.18 q-0.24 -0.22 -0.24 -0.52 l0 -1.44 q0 -0.26 0.18 -0.46 t0.44 -0.24 q0.94 -0.1 1.46 -0.44 q0.4 -0.24 0.54 -0.62 q0.08 -0.22 0.08 -0.56 q0 -0.22 -0.08 -0.38 t-0.28 -0.3 q-0.58 -0.4 -1.5 -0.68 l-0.32 -0.1 q-1 -0.28 -1.84 -0.46 q-0.18 -0.04 -0.58 -0.14 l-0.22 -0.06 q-0.72 -0.18 -1.52 -0.5 q-1.18 -0.5 -1.94 -1.26 q-0.88 -0.88 -0.88 -2.32 q0 -1.98 1.52 -3.22 q1.04 -0.88 2.92 -1.12 q0.32 -0.04 0.55 0.18 t0.23 0.52 l0 1.44 q0 0.26 -0.16 0.46 t-0.41 0.23 t-0.51 0.11 q-0.58 0.22 -0.82 0.43 t-0.34 0.43 q-0.1 0.34 -0.1 0.64 q0 0.16 0.18 0.34 q0.28 0.28 0.82 0.5 q0.24 0.1 0.84 0.3 l2.5 0.62 l0.12 0.04 q0.94 0.26 1.36 0.4 q0.94 0.32 1.64 0.78 z M42.196 7.9 q-0.24 -0.06 -0.39 -0.25 t-0.15 -0.45 l0 -1.46 q0 -0.32 0.26 -0.54 q0.1 -0.1 0.26 -0.13 t0.3 -0.01 q1.76 0.28 2.86 1.2 q1.5 1.24 1.6 3.16 q0.02 0.28 -0.19 0.51 t-0.51 0.23 l-1.56 0 q-0.26 0 -0.46 -0.18 t-0.22 -0.44 q-0.08 -0.52 -0.34 -0.86 q-0.42 -0.5 -1.3 -0.76 q-0.06 0 -0.08 -0.02 l-0.08 0 z M39.855999999999995 17.08 q0.24 0.04 0.4 0.24 t0.16 0.44 l0 1.48 q0 0.32 -0.24 0.54 q-0.2 0.16 -0.46 0.16 l-0.1 0 q-1.86 -0.28 -3.06 -1.22 q-1.56 -1.24 -1.76 -3.46 q-0.04 -0.32 0.18 -0.55 t0.52 -0.23 l1.58 0 q0.28 0 0.48 0.19 t0.22 0.47 q0.06 1 0.98 1.54 q0.42 0.24 1.1 0.4 z M60.88399999999999 11.12 q0.3 0 0.51 0.21 t0.21 0.51 l0 1.48 q0 0.28 -0.21 0.49 t-0.51 0.21 l-6.58 0 l0 5.12 q0 0.28 -0.2 0.49 t-0.5 0.21 l-1.52 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -7.3 q0 -0.3 0.21 -0.51 t0.49 -0.21 l8.8 0 z M61.78399999999999 5 q0.28 0 0.49 0.21 t0.21 0.49 l0 1.46 q0 0.3 -0.21 0.51 t-0.49 0.21 l-9.7 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.46 q0 -0.28 0.21 -0.49 t0.49 -0.21 l9.7 0 z M79.512 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M92 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z"></path>
+        </g>
+    </g>
+</svg>
+	

public/assets/dasfad/Logo Files/For Web/svg/Color logo with background.svg

@@ -0,0 +1,40 @@
+<svg xmlns="http://www.w3.org/2000/svg" version="1.1" width="3200"
+     height="1355.480324331485" viewBox="0 0 3200 1355.480324331485">
+    <rect fill="#292929" width="3200" height="1355.480324331485"/>
+    <g transform="scale(10) translate(10, 10)">
+        <defs id="SvgjsDefs1385">
+            <linearGradient id="SvgjsLinearGradient1390">
+                <stop id="SvgjsStop1391" stop-color="#905e26" offset="0"></stop>
+                <stop id="SvgjsStop1392" stop-color="#f5ec9b" offset="0.5"></stop>
+                <stop id="SvgjsStop1393" stop-color="#905e26" offset="1"></stop>
+            </linearGradient>
+            <linearGradient id="SvgjsLinearGradient1394">
+                <stop id="SvgjsStop1395" stop-color="#905e26" offset="0"></stop>
+                <stop id="SvgjsStop1396" stop-color="#f5ec9b" offset="0.5"></stop>
+                <stop id="SvgjsStop1397" stop-color="#905e26" offset="1"></stop>
+            </linearGradient>
+        </defs>
+        <g id="SvgjsG1386" featureKey="aMgJeN-0"
+           transform="matrix(1.5610770874511997,0,0,1.5610770874511997,71.94613967240352,-53.841545411371435)"
+           fill="url(#SvgjsLinearGradient1390)">
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.399,57.112c0.615,0.308,1.077,0.846,1.077,1.383c0,1.039-1.038,1.961-1.999,1.462l-15.223-7.881  c-0.846-0.499-1.576-0.808-1.576-1.884c0-1.115,0.692-1.385,1.576-1.922l15.223-7.881c1.038-0.346,1.999,0.424,1.999,1.462  c0,0.575-0.461,1.114-1.077,1.423l-13.761,6.918L29.399,57.112z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.033,60.209c-0.208,0-0.413-0.052-0.608-0.152l-15.223-7.881c-0.086-0.05-0.165-0.095-0.242-0.141  c-0.748-0.431-1.395-0.804-1.395-1.843c0-1.057,0.594-1.406,1.346-1.849c0.093-0.054,0.187-0.11,0.284-0.169l15.229-7.885  c0.195-0.066,0.377-0.097,0.558-0.097c0.9,0,1.606,0.728,1.606,1.658c0,0.587-0.437,1.172-1.139,1.522l-13.562,6.818l13.562,6.818  c0.691,0.346,1.139,0.93,1.139,1.484C30.588,59.407,29.861,60.209,29.033,60.209z M28.982,40.419c-0.156,0-0.314,0.026-0.47,0.078  L13.306,48.37c-0.091,0.057-0.188,0.113-0.281,0.167c-0.743,0.439-1.234,0.728-1.234,1.655c0,0.91,0.537,1.219,1.281,1.648  c0.079,0.045,0.158,0.09,0.239,0.139l15.217,7.877c0.162,0.084,0.332,0.127,0.504,0.127c0.697,0,1.33-0.709,1.33-1.488  c0-0.465-0.407-0.98-1.014-1.283l-13.962-7.02l13.962-7.02c0.616-0.308,1.014-0.828,1.014-1.321  C30.363,41.048,29.756,40.419,28.982,40.419z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M46.385,64.416c-0.231,0.691-0.922,1.077-1.614,0.961c-0.769-0.153-1.269-0.885-1.154-1.692  c0-0.076,0.039-0.191,0.077-0.307l9.88-27.831c0.23-0.692,0.922-1.038,1.614-0.923c0.73,0.154,1.269,0.885,1.153,1.652  c0,0.078-0.039,0.193-0.077,0.27L46.385,64.416z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M45.016,65.511c-0.088,0-0.177-0.008-0.263-0.022c-0.837-0.167-1.371-0.949-1.247-1.819  c-0.001-0.076,0.038-0.193,0.079-0.318l9.883-27.842c0.207-0.618,0.778-1.02,1.457-1.02c0.094,0,0.188,0.009,0.281,0.023  c0.812,0.172,1.369,0.97,1.247,1.781c0.001,0.086-0.047,0.22-0.087,0.302l-9.875,27.856C46.281,65.084,45.688,65.511,45.016,65.511z   M54.925,34.715c-0.58,0-1.068,0.34-1.244,0.867l-9.88,27.833c-0.035,0.104-0.07,0.213-0.07,0.27  c-0.108,0.767,0.349,1.439,1.062,1.582c0.071,0.012,0.147,0.018,0.223,0.018c0.575,0,1.083-0.363,1.263-0.904l9.881-27.872  c0.041-0.085,0.07-0.182,0.07-0.231c0.105-0.712-0.373-1.396-1.064-1.543C55.089,34.722,55.007,34.715,54.925,34.715z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M84.362,50.192L70.6,43.274c-0.614-0.309-1.075-0.848-1.075-1.423c0-1.038,1.037-1.962,1.998-1.462l15.223,7.881  c0.885,0.537,1.576,0.807,1.576,1.922c0,1.076-0.73,1.385-1.576,1.884l-15.223,7.881c-0.961,0.499-1.998-0.423-1.998-1.462  c0-0.537,0.461-1.075,1.075-1.383L84.362,50.192z"></path>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M70.967,60.209c-0.828,0-1.556-0.802-1.556-1.714c0-0.555,0.447-1.139,1.139-1.484l13.562-6.818L70.55,43.374  c-0.702-0.352-1.139-0.936-1.139-1.522c0-0.913,0.728-1.714,1.556-1.714c0.209,0,0.413,0.051,0.608,0.152l15.223,7.881  c0.104,0.062,0.198,0.119,0.29,0.173c0.753,0.442,1.347,0.792,1.347,1.849c0,1.039-0.646,1.412-1.395,1.843  c-0.078,0.046-0.157,0.091-0.237,0.138l-15.228,7.884C71.38,60.157,71.176,60.209,70.967,60.209z M70.967,40.363  c-0.696,0-1.33,0.709-1.33,1.488c0,0.493,0.397,1.013,1.014,1.321l13.962,7.02l-13.962,7.02c-0.606,0.305-1.014,0.82-1.014,1.283  c0,0.779,0.634,1.488,1.33,1.488c0.172,0,0.342-0.043,0.504-0.127l15.223-7.88c0.075-0.046,0.155-0.091,0.233-0.136  c0.744-0.43,1.282-0.738,1.282-1.648c0-0.928-0.491-1.216-1.235-1.655c-0.093-0.054-0.188-0.11-0.287-0.17l-15.216-7.876  C71.309,40.405,71.139,40.363,70.967,40.363z"></path>
+        </g>
+        <g id="SvgjsG1387" featureKey="8L6ael-0"
+           transform="matrix(3.168568052463937,0,0,3.168568052463937,-5.1330821487142195,52.17667742743372)"
+           fill="url(#SvgjsLinearGradient1394)">
+            <path d="M10.56 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z M32.208 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M45.535999999999994 12.42 q0.86 0.54 1.31 1.32 t0.45 1.74 q0 2.26 -1.72 3.46 q-1.16 0.84 -3.14 1.06 l-0.08 0 q-0.28 0 -0.46 -0.18 q-0.24 -0.22 -0.24 -0.52 l0 -1.44 q0 -0.26 0.18 -0.46 t0.44 -0.24 q0.94 -0.1 1.46 -0.44 q0.4 -0.24 0.54 -0.62 q0.08 -0.22 0.08 -0.56 q0 -0.22 -0.08 -0.38 t-0.28 -0.3 q-0.58 -0.4 -1.5 -0.68 l-0.32 -0.1 q-1 -0.28 -1.84 -0.46 q-0.18 -0.04 -0.58 -0.14 l-0.22 -0.06 q-0.72 -0.18 -1.52 -0.5 q-1.18 -0.5 -1.94 -1.26 q-0.88 -0.88 -0.88 -2.32 q0 -1.98 1.52 -3.22 q1.04 -0.88 2.92 -1.12 q0.32 -0.04 0.55 0.18 t0.23 0.52 l0 1.44 q0 0.26 -0.16 0.46 t-0.41 0.23 t-0.51 0.11 q-0.58 0.22 -0.82 0.43 t-0.34 0.43 q-0.1 0.34 -0.1 0.64 q0 0.16 0.18 0.34 q0.28 0.28 0.82 0.5 q0.24 0.1 0.84 0.3 l2.5 0.62 l0.12 0.04 q0.94 0.26 1.36 0.4 q0.94 0.32 1.64 0.78 z M42.196 7.9 q-0.24 -0.06 -0.39 -0.25 t-0.15 -0.45 l0 -1.46 q0 -0.32 0.26 -0.54 q0.1 -0.1 0.26 -0.13 t0.3 -0.01 q1.76 0.28 2.86 1.2 q1.5 1.24 1.6 3.16 q0.02 0.28 -0.19 0.51 t-0.51 0.23 l-1.56 0 q-0.26 0 -0.46 -0.18 t-0.22 -0.44 q-0.08 -0.52 -0.34 -0.86 q-0.42 -0.5 -1.3 -0.76 q-0.06 0 -0.08 -0.02 l-0.08 0 z M39.855999999999995 17.08 q0.24 0.04 0.4 0.24 t0.16 0.44 l0 1.48 q0 0.32 -0.24 0.54 q-0.2 0.16 -0.46 0.16 l-0.1 0 q-1.86 -0.28 -3.06 -1.22 q-1.56 -1.24 -1.76 -3.46 q-0.04 -0.32 0.18 -0.55 t0.52 -0.23 l1.58 0 q0.28 0 0.48 0.19 t0.22 0.47 q0.06 1 0.98 1.54 q0.42 0.24 1.1 0.4 z M60.88399999999999 11.12 q0.3 0 0.51 0.21 t0.21 0.51 l0 1.48 q0 0.28 -0.21 0.49 t-0.51 0.21 l-6.58 0 l0 5.12 q0 0.28 -0.2 0.49 t-0.5 0.21 l-1.52 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -7.3 q0 -0.3 0.21 -0.51 t0.49 -0.21 l8.8 0 z M61.78399999999999 5 q0.28 0 0.49 0.21 t0.21 0.49 l0 1.46 q0 0.3 -0.21 0.51 t-0.49 0.21 l-9.7 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.46 q0 -0.28 0.21 -0.49 t0.49 -0.21 l9.7 0 z M79.512 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M92 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z"></path>
+        </g>
+    </g>
+</svg>
+	

public/assets/dasfad/Logo Files/For Web/svg/White logo - no background.svg

@@ -0,0 +1,40 @@
+<svg xmlns="http://www.w3.org/2000/svg" version="1.1" width="3200"
+     height="1355.480324331485" viewBox="0 0 3200 1355.480324331485">
+
+    <g transform="scale(10) translate(10, 10)">
+        <defs id="SvgjsDefs1385">
+            <linearGradient id="SvgjsLinearGradient1390">
+                <stop id="SvgjsStop1391" stop-color="#905e26" offset="0"/>
+                <stop id="SvgjsStop1392" stop-color="#f5ec9b" offset="0.5"/>
+                <stop id="SvgjsStop1393" stop-color="#905e26" offset="1"/>
+            </linearGradient>
+            <linearGradient id="SvgjsLinearGradient1394">
+                <stop id="SvgjsStop1395" stop-color="#905e26" offset="0"/>
+                <stop id="SvgjsStop1396" stop-color="#f5ec9b" offset="0.5"/>
+                <stop id="SvgjsStop1397" stop-color="#905e26" offset="1"/>
+            </linearGradient>
+        </defs>
+        <g id="SvgjsG1386" featureKey="aMgJeN-0"
+           transform="matrix(1.5610770874511997,0,0,1.5610770874511997,71.94613967240352,-53.841545411371435)"
+           fill="#fff">
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.399,57.112c0.615,0.308,1.077,0.846,1.077,1.383c0,1.039-1.038,1.961-1.999,1.462l-15.223-7.881  c-0.846-0.499-1.576-0.808-1.576-1.884c0-1.115,0.692-1.385,1.576-1.922l15.223-7.881c1.038-0.346,1.999,0.424,1.999,1.462  c0,0.575-0.461,1.114-1.077,1.423l-13.761,6.918L29.399,57.112z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M29.033,60.209c-0.208,0-0.413-0.052-0.608-0.152l-15.223-7.881c-0.086-0.05-0.165-0.095-0.242-0.141  c-0.748-0.431-1.395-0.804-1.395-1.843c0-1.057,0.594-1.406,1.346-1.849c0.093-0.054,0.187-0.11,0.284-0.169l15.229-7.885  c0.195-0.066,0.377-0.097,0.558-0.097c0.9,0,1.606,0.728,1.606,1.658c0,0.587-0.437,1.172-1.139,1.522l-13.562,6.818l13.562,6.818  c0.691,0.346,1.139,0.93,1.139,1.484C30.588,59.407,29.861,60.209,29.033,60.209z M28.982,40.419c-0.156,0-0.314,0.026-0.47,0.078  L13.306,48.37c-0.091,0.057-0.188,0.113-0.281,0.167c-0.743,0.439-1.234,0.728-1.234,1.655c0,0.91,0.537,1.219,1.281,1.648  c0.079,0.045,0.158,0.09,0.239,0.139l15.217,7.877c0.162,0.084,0.332,0.127,0.504,0.127c0.697,0,1.33-0.709,1.33-1.488  c0-0.465-0.407-0.98-1.014-1.283l-13.962-7.02l13.962-7.02c0.616-0.308,1.014-0.828,1.014-1.321  C30.363,41.048,29.756,40.419,28.982,40.419z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M46.385,64.416c-0.231,0.691-0.922,1.077-1.614,0.961c-0.769-0.153-1.269-0.885-1.154-1.692  c0-0.076,0.039-0.191,0.077-0.307l9.88-27.831c0.23-0.692,0.922-1.038,1.614-0.923c0.73,0.154,1.269,0.885,1.153,1.652  c0,0.078-0.039,0.193-0.077,0.27L46.385,64.416z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M45.016,65.511c-0.088,0-0.177-0.008-0.263-0.022c-0.837-0.167-1.371-0.949-1.247-1.819  c-0.001-0.076,0.038-0.193,0.079-0.318l9.883-27.842c0.207-0.618,0.778-1.02,1.457-1.02c0.094,0,0.188,0.009,0.281,0.023  c0.812,0.172,1.369,0.97,1.247,1.781c0.001,0.086-0.047,0.22-0.087,0.302l-9.875,27.856C46.281,65.084,45.688,65.511,45.016,65.511z   M54.925,34.715c-0.58,0-1.068,0.34-1.244,0.867l-9.88,27.833c-0.035,0.104-0.07,0.213-0.07,0.27  c-0.108,0.767,0.349,1.439,1.062,1.582c0.071,0.012,0.147,0.018,0.223,0.018c0.575,0,1.083-0.363,1.263-0.904l9.881-27.872  c0.041-0.085,0.07-0.182,0.07-0.231c0.105-0.712-0.373-1.396-1.064-1.543C55.089,34.722,55.007,34.715,54.925,34.715z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M84.362,50.192L70.6,43.274c-0.614-0.309-1.075-0.848-1.075-1.423c0-1.038,1.037-1.962,1.998-1.462l15.223,7.881  c0.885,0.537,1.576,0.807,1.576,1.922c0,1.076-0.73,1.385-1.576,1.884l-15.223,7.881c-0.961,0.499-1.998-0.423-1.998-1.462  c0-0.537,0.461-1.075,1.075-1.383L84.362,50.192z"/>
+            <path xmlns="http://www.w3.org/2000/svg"
+                  d="M70.967,60.209c-0.828,0-1.556-0.802-1.556-1.714c0-0.555,0.447-1.139,1.139-1.484l13.562-6.818L70.55,43.374  c-0.702-0.352-1.139-0.936-1.139-1.522c0-0.913,0.728-1.714,1.556-1.714c0.209,0,0.413,0.051,0.608,0.152l15.223,7.881  c0.104,0.062,0.198,0.119,0.29,0.173c0.753,0.442,1.347,0.792,1.347,1.849c0,1.039-0.646,1.412-1.395,1.843  c-0.078,0.046-0.157,0.091-0.237,0.138l-15.228,7.884C71.38,60.157,71.176,60.209,70.967,60.209z M70.967,40.363  c-0.696,0-1.33,0.709-1.33,1.488c0,0.493,0.397,1.013,1.014,1.321l13.962,7.02l-13.962,7.02c-0.606,0.305-1.014,0.82-1.014,1.283  c0,0.779,0.634,1.488,1.33,1.488c0.172,0,0.342-0.043,0.504-0.127l15.223-7.88c0.075-0.046,0.155-0.091,0.233-0.136  c0.744-0.43,1.282-0.738,1.282-1.648c0-0.928-0.491-1.216-1.235-1.655c-0.093-0.054-0.188-0.11-0.287-0.17l-15.216-7.876  C71.309,40.405,71.139,40.363,70.967,40.363z"/>
+        </g>
+        <g id="SvgjsG1387" featureKey="8L6ael-0"
+           transform="matrix(3.168568052463937,0,0,3.168568052463937,-5.1330821487142195,52.17667742743372)"
+           fill="#fff">
+            <path d="M10.56 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z M32.208 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M45.535999999999994 12.42 q0.86 0.54 1.31 1.32 t0.45 1.74 q0 2.26 -1.72 3.46 q-1.16 0.84 -3.14 1.06 l-0.08 0 q-0.28 0 -0.46 -0.18 q-0.24 -0.22 -0.24 -0.52 l0 -1.44 q0 -0.26 0.18 -0.46 t0.44 -0.24 q0.94 -0.1 1.46 -0.44 q0.4 -0.24 0.54 -0.62 q0.08 -0.22 0.08 -0.56 q0 -0.22 -0.08 -0.38 t-0.28 -0.3 q-0.58 -0.4 -1.5 -0.68 l-0.32 -0.1 q-1 -0.28 -1.84 -0.46 q-0.18 -0.04 -0.58 -0.14 l-0.22 -0.06 q-0.72 -0.18 -1.52 -0.5 q-1.18 -0.5 -1.94 -1.26 q-0.88 -0.88 -0.88 -2.32 q0 -1.98 1.52 -3.22 q1.04 -0.88 2.92 -1.12 q0.32 -0.04 0.55 0.18 t0.23 0.52 l0 1.44 q0 0.26 -0.16 0.46 t-0.41 0.23 t-0.51 0.11 q-0.58 0.22 -0.82 0.43 t-0.34 0.43 q-0.1 0.34 -0.1 0.64 q0 0.16 0.18 0.34 q0.28 0.28 0.82 0.5 q0.24 0.1 0.84 0.3 l2.5 0.62 l0.12 0.04 q0.94 0.26 1.36 0.4 q0.94 0.32 1.64 0.78 z M42.196 7.9 q-0.24 -0.06 -0.39 -0.25 t-0.15 -0.45 l0 -1.46 q0 -0.32 0.26 -0.54 q0.1 -0.1 0.26 -0.13 t0.3 -0.01 q1.76 0.28 2.86 1.2 q1.5 1.24 1.6 3.16 q0.02 0.28 -0.19 0.51 t-0.51 0.23 l-1.56 0 q-0.26 0 -0.46 -0.18 t-0.22 -0.44 q-0.08 -0.52 -0.34 -0.86 q-0.42 -0.5 -1.3 -0.76 q-0.06 0 -0.08 -0.02 l-0.08 0 z M39.855999999999995 17.08 q0.24 0.04 0.4 0.24 t0.16 0.44 l0 1.48 q0 0.32 -0.24 0.54 q-0.2 0.16 -0.46 0.16 l-0.1 0 q-1.86 -0.28 -3.06 -1.22 q-1.56 -1.24 -1.76 -3.46 q-0.04 -0.32 0.18 -0.55 t0.52 -0.23 l1.58 0 q0.28 0 0.48 0.19 t0.22 0.47 q0.06 1 0.98 1.54 q0.42 0.24 1.1 0.4 z M60.88399999999999 11.12 q0.3 0 0.51 0.21 t0.21 0.51 l0 1.48 q0 0.28 -0.21 0.49 t-0.51 0.21 l-6.58 0 l0 5.12 q0 0.28 -0.2 0.49 t-0.5 0.21 l-1.52 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -7.3 q0 -0.3 0.21 -0.51 t0.49 -0.21 l8.8 0 z M61.78399999999999 5 q0.28 0 0.49 0.21 t0.21 0.49 l0 1.46 q0 0.3 -0.21 0.51 t-0.49 0.21 l-9.7 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.46 q0 -0.28 0.21 -0.49 t0.49 -0.21 l9.7 0 z M79.512 18.86 q0.14 0.32 -0.07 0.65 t-0.57 0.33 l-13.32 0 q-0.18 0 -0.34 -0.09 t-0.24 -0.23 q-0.22 -0.32 -0.06 -0.66 l0.62 -1.46 q0.08 -0.2 0.26 -0.32 t0.38 -0.12 l9.32 0 l-3.28 -7.84 l-2.68 6.4 q-0.08 0.2 -0.25 0.31 t-0.39 0.11 l-1.68 0 q-0.38 0 -0.6 -0.32 q-0.08 -0.14 -0.1 -0.32 t0.04 -0.34 l4.06 -9.52 q0.08 -0.2 0.25 -0.32 t0.39 -0.12 l1.92 0 q0.22 0 0.39 0.12 t0.25 0.32 z M92 5.52 q1.22 0.46 2.2 1.48 q2.1 2.12 2.1 5.41 t-2.1 5.43 q-0.98 1.02 -2.2 1.48 q-1.26 0.52 -2.58 0.52 l-5.66 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.49 l0 -1.44 q0 -0.3 0.21 -0.51 t0.49 -0.21 l5.6 0 q1.78 0 2.89 -1.3 t1.11 -3.26 t-1.11 -3.26 t-2.89 -1.3 l-5.6 0 q-0.28 0 -0.49 -0.21 t-0.21 -0.51 l0 -1.44 q0 -0.28 0.21 -0.49 t0.49 -0.21 l5.66 0 q1.32 0 2.58 0.52 z"/>
+        </g>
+    </g>
+</svg>
+	

public/assets/icons/video.svg

@@ -0,0 +1,8 @@
+<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24">
+    <g data-name="Layer 2">
+        <g data-name="video">
+            <rect width="24" height="24" opacity="0"/>
+            <path d="M21 7.15a1.7 1.7 0 0 0-1.85.3l-2.15 2V8a3 3 0 0 0-3-3H5a3 3 0 0 0-3 3v8a3 3 0 0 0 3 3h9a3 3 0 0 0 3-3v-1.45l2.16 2a1.74 1.74 0 0 0 1.16.45 1.68 1.68 0 0 0 .69-.15 1.6 1.6 0 0 0 1-1.48V8.63A1.6 1.6 0 0 0 21 7.15z"/>
+        </g>
+    </g>
+</svg>

public/assets/models/tinker.obj

@@ -0,0 +1,300 @@
+# Object Export From Tinkercad Server 2015
+
+mtllib obj.mtl
+
+o obj_0
+v 4 		3.5 		4
+v 4 		3.568 		3.482
+v 4 		3.768 		3
+v 4 		4.086 		2.586
+v 4 		4.5 		2.268
+v 4 		4.982 		2.068
+v 4 		5.5 		2
+v 4 		6.018 		2.068
+v 4 		6.5 		2.268
+v 4 		6.914 		2.586
+v 4 		7.232 		3
+v 4 		7.432 		3.482
+v 4 		7.5 		4
+v 4 		7.432 		4.518
+v 4 		7.232 		5
+v 4 		6.914 		5.414
+v 4 		6.5 		5.732
+v 4 		6.018 		5.932
+v 4 		5.5 		6
+v 4 		4.982 		5.932
+v 4 		4.5 		5.732
+v 4 		4.086 		5.414
+v 4 		3.768 		5
+v 4 		3.568 		4.518
+v -8.308 		4.5 		7.952
+v 1 		4.7272 		4.2072
+v -8.587 		4.5 		7.81
+v 1 		4.7 		4
+v -8.81 		4.5 		7.587
+v 1 		4.8072 		4.4
+v -8.952 		4.5 		7.308
+v 1 		4.9344 		4.5656
+v -9 		4.5 		7.0043
+v 0.952 		6.5 		7.308
+v 1 		5.1 		4.6928
+v 1 		6.5 		7.0043
+v 0.81 		6.5 		7.587
+v 1 		5.2928 		4.7728
+v 0.587 		6.5 		7.81
+v 0.308 		6.5 		7.952
+v 1 		5.5 		4.8
+v 0.0033 		6.5 		8
+v 1 		5.7072 		4.7728
+v 1 		5.9 		4.6928
+v 1 		6.0656 		4.5656
+v 1 		6.1928 		4.4
+v 1 		4.5 		7.0043
+v 0.952 		4.5 		7.308
+v 0.81 		4.5 		7.587
+v 0.587 		4.5 		7.81
+v 0.308 		4.5 		7.952
+v 1 		6.2728 		4.2072
+v 0.0033 		4.5 		8
+v 1 		6.3 		4
+v -8.0043 		4.5 		0
+v -8.952 		4.5 		0.692
+v -9 		4.5 		0.9967
+v 1 		6.2728 		3.7928
+v -8.81 		4.5 		0.413
+v -8.587 		4.5 		0.19
+v 1 		6.1928 		3.6
+v -8.308 		4.5 		0.048
+v 1 		6.0656 		3.4344
+v 1 		5.9 		3.3072
+v -8.0043 		6.5 		8
+v -8.308 		6.5 		7.952
+v 1 		5.7072 		3.2272
+v -8.587 		6.5 		7.81
+v 1 		5.5 		3.2
+v -8.81 		6.5 		7.587
+v -8.952 		6.5 		7.308
+v 1 		5.2928 		3.2272
+v -9 		6.5 		7.0043
+v 1 		5.1 		3.3072
+v 1 		4.9344 		3.4344
+v 1 		4.8072 		3.6
+v 1 		4.7272 		3.7928
+v -9 		6.5 		0.9967
+v -8.0043 		4.5 		8
+v 0.81 		6.5 		0.413
+v 0.587 		6.5 		0.19
+v 0.952 		6.5 		0.692
+v 1 		6.5 		0.9967
+v 0.0033 		6.5 		0
+v 0.0033 		4.5 		0
+v 0.308 		4.5 		0.048
+v -8.0043 		6.5 		0
+v 0.587 		4.5 		0.19
+v 0.81 		4.5 		0.413
+v 0.952 		4.5 		0.692
+v 1 		4.5 		0.9967
+v -8.952 		6.5 		0.692
+v -8.81 		6.5 		0.413
+v -8.587 		6.5 		0.19
+v -8.308 		6.5 		0.048
+v 0.308 		6.5 		0.048
+# 96 vertices
+
+g group_0_8273816
+
+usemtl color_8273816
+s 0
+
+f 1 	2 	3
+f 1 	3 	4
+f 1 	4 	5
+f 1 	5 	6
+f 1 	6 	7
+f 1 	7 	8
+f 1 	8 	9
+f 1 	9 	10
+f 1 	10 	11
+f 1 	11 	12
+f 1 	12 	13
+f 1 	13 	14
+f 1 	14 	15
+f 1 	15 	16
+f 1 	16 	17
+f 1 	17 	18
+f 1 	18 	19
+f 1 	19 	20
+f 1 	20 	21
+f 1 	21 	22
+f 1 	22 	23
+f 1 	23 	24
+f 28 	1 	26
+f 24 	26 	1
+f 23 	30 	26
+f 23 	26 	24
+f 22 	32 	30
+f 22 	30 	23
+f 32 	22 	35
+f 21 	35 	22
+f 49 	48 	37
+f 35 	21 	38
+f 20 	38 	21
+f 19 	41 	38
+f 19 	38 	20
+f 41 	19 	43
+f 18 	43 	19
+f 34 	48 	36
+f 17 	44 	43
+f 17 	43 	18
+f 34 	37 	48
+f 16 	45 	44
+f 16 	44 	17
+f 49 	37 	39
+f 45 	16 	46
+f 15 	46 	16
+f 53 	40 	42
+f 36 	48 	47
+f 49 	39 	50
+f 51 	50 	40
+f 39 	40 	50
+f 46 	15 	52
+f 14 	52 	15
+f 40 	53 	51
+f 52 	54 	36
+f 83 	36 	54
+f 54 	58 	83
+f 58 	61 	83
+f 61 	63 	83
+f 93 	60 	59
+f 64 	83 	63
+f 69 	72 	91
+f 72 	74 	91
+f 73 	33 	71
+f 74 	75 	91
+f 75 	76 	91
+f 25 	65 	66
+f 66 	68 	27
+f 66 	27 	25
+f 29 	27 	70
+f 68 	70 	27
+f 91 	76 	77
+f 91 	77 	28
+f 70 	71 	31
+f 70 	31 	29
+f 71 	33 	31
+f 65 	25 	79
+f 57 	33 	78
+f 73 	78 	33
+f 42 	65 	53
+f 53 	65 	79
+f 81 	88 	86
+f 80 	89 	88
+f 80 	88 	81
+f 89 	80 	90
+f 82 	90 	80
+f 82 	83 	90
+f 91 	90 	83
+f 84 	86 	85
+f 55 	87 	85
+f 84 	85 	87
+f 95 	87 	55
+f 86 	91 	85
+f 88 	91 	86
+f 89 	90 	88
+f 91 	88 	90
+f 92 	56 	78
+f 93 	56 	92
+f 94 	60 	93
+f 94 	95 	60
+f 62 	60 	95
+f 56 	55 	57
+f 91 	57 	85
+f 62 	95 	55
+f 55 	85 	57
+f 59 	55 	56
+f 60 	62 	59
+f 55 	59 	62
+f 78 	56 	57
+f 93 	59 	56
+f 29 	31 	27
+f 33 	27 	31
+f 27 	33 	25
+f 13 	54 	52
+f 13 	52 	14
+f 54 	13 	58
+f 12 	58 	13
+f 49 	50 	57
+f 51 	57 	50
+f 53 	57 	51
+f 79 	33 	53
+f 61 	58 	11
+f 12 	11 	58
+f 63 	61 	10
+f 11 	10 	61
+f 10 	9 	64
+f 10 	64 	63
+f 49 	57 	48
+f 91 	47 	57
+f 25 	33 	79
+f 57 	53 	33
+f 47 	48 	57
+f 9 	8 	67
+f 9 	67 	64
+f 96 	73 	81
+f 84 	73 	96
+f 69 	67 	7
+f 8 	7 	67
+f 80 	81 	73
+f 7 	6 	72
+f 7 	72 	69
+f 74 	72 	5
+f 6 	5 	72
+f 93 	92 	94
+f 78 	94 	92
+f 95 	78 	87
+f 65 	42 	83
+f 75 	74 	4
+f 5 	4 	74
+f 66 	83 	68
+f 70 	68 	83
+f 4 	3 	76
+f 4 	76 	75
+f 39 	37 	40
+f 42 	40 	37
+f 42 	37 	34
+f 3 	2 	77
+f 3 	77 	76
+f 34 	36 	42
+f 28 	77 	1
+f 2 	1 	77
+f 36 	83 	42
+f 65 	83 	66
+f 71 	70 	83
+f 73 	71 	83
+f 82 	80 	73
+f 83 	82 	73
+f 87 	78 	84
+f 94 	78 	95
+f 73 	84 	78
+f 96 	86 	84
+f 81 	86 	96
+f 67 	69 	83
+f 64 	67 	83
+f 69 	91 	83
+f 91 	28 	47
+f 28 	26 	47
+f 26 	30 	47
+f 30 	32 	47
+f 38 	41 	47
+f 32 	35 	47
+f 35 	38 	47
+f 41 	36 	47
+f 41 	43 	36
+f 43 	44 	36
+f 44 	45 	36
+f 45 	46 	36
+f 46 	52 	36
+# 188 faces
+
+ #end of obj_0
+

public/assets/objects.json

@@ -0,0 +1,10 @@
+{
+  "objects": [
+    {
+      "name": "Server",
+      "id": "server",
+      "type": "glb",
+      "path": "models/server_racking_system.glb"
+    }
+  ]
+}

public/b2b2c.csv

@@ -0,0 +1,3 @@
+"ID","NAME","POSITION-X","POSITION-Y","POSITION-Z", "ROTATION-X","ROTATION-Y","ROTATION-Z", "SCALE-X","SCALE-Y","SCALE-Z"
+"id2533e7b6-118a-46d0-bad9-11e73462798b","Commerce",1,0,0,0,0,0,.1,.1,.1,
+,Platform,1.3,0,0,0,0,0,.1,.1,.1,

public/manifest.webmanifest

@@ -1,16 +1,17 @@
 {
   "name": "Deep Diagram",
   "display": "standalone",
-  "start_url": "https://deepdiagram.com",
+  "start_url": "https://www.deepdiagram.com",
-  "scope": "https://deepdiagram.com",
+  "id": "com.deepdiagram",
+  "scope": "https://www.deepdiagram.com",
   "short_name": "Deep Diagram",
   "theme_color": "#000000",
   "background_color": "#000000",
-  "description": "Immersive diagraming tool to dig into deeper meaning behind your ideas",
+  "description": "An immersive mind mapping and diagramming tool that lets you create, share, and visualize data on the Oculus Quest and desktop browsers.",
   "icons": [
     {
-      "src": "/assets/android-icon-192x192.png",
+      "src": "/assets/Android.png",
-      "sizes": "192x192",
+      "sizes": "196x196",
       "type": "image/png",
       "purpose": "any"
     },
@@ -28,22 +29,22 @@
   ],
   "screenshots": [
     {
-      "src": "/assets/com.oculus.browser-20230121-110512.jpg",
+      "src": "/assets/screenshot1.png",
       "sizes": "1024x1024",
-      "type": "image/jpeg",
+      "type": "image/png",
-      "label": "Example 1"
+      "label": "Example of a few boxes on the web"
     },
     {
-      "src": "/assets/com.oculus.browser-20230121-110746.jpg",
+      "src": "/assets/screenshot2.png",
       "sizes": "1024x1024",
-      "type": "image/jpeg",
+      "type": "image/png",
-      "label": "Example 2"
+      "label": "Example of menus on the web"
     },
     {
-      "src": "/assets/com.oculus.browser-20230121-111323.jpg",
+      "src": "/assets/screenshot3.png",
       "sizes": "1024x1024",
-      "type": "image/jpeg",
+      "type": "image/png",
-      "label": "Complex Architecture Diagram"
+      "label": "Example showing the web app on the Oculus Quest"
     }
   ]
 }

public/pages/privacy.html

@@ -0,0 +1,141 @@
+<html lang="">
+<head>
+    <title>Deep Diagram Privacy Policy</title>
+    <meta charset="UTF-8">
+    <meta content="width=device-width, initial-scale=1" name="viewport"/>
+    <meta content="width=device-width, initial-scale=1, height=device-height" name="viewport">
+    <link href="/styles.css" rel="stylesheet">
+    <link href="/assets/favicon-32x32.png" rel="icon" sizes="32x32" type="image/png">
+    <link href="/assets/favicon-16x16.png" rel="icon" sizes="16x16" type="image/png">
+    <link href="/assets/favicon-96x96.png" rel="icon" sizes="96x96" type="image/png">
+    <link as="script" href="/newRelic.js" rel="preload">
+    <script src="/newRelic.js"></script>
+    <style>
+        body * {
+            color: #FFFFFF;
+        }
+
+        div#privacyPolicy {
+            z-index: 1;
+            position: absolute;
+            width: 80%;
+            height: 80%;
+            top: 9%;
+            left: 9%;
+            overflow-y: scroll;
+            background-color: rgba(0, 0, .2, 0.6);
+            padding: 40px;
+            border-radius: 30px;
+            border-color: #FFD700;
+            border-style: solid;
+        }
+
+        h1 {
+            color: #FFf0d0;
+            text-align: left;
+        }
+
+        li {
+            font-size: smaller;
+        }
+    </style>
+</head>
+<body>
+
+<img alt="background grid" id="loadingGrid" src="/assets/grid3.jpg"/>
+<div id="privacyPolicy">
+    <p>
+        This privacy policy ("policy") will help you understand how Immersive Idea LLC. ("us", "we",
+        "our") uses and protects the data you provide to us when you visit and use https://www.deepdiagram.com
+        website.
+    </p>
+    We reserve the right to change this policy at any given time, of which you will be
+    promptly updated. If you want to make sure that you are up to date with the latest
+    changes, we advise you to frequently visit this page.
+    <p>
+    <h1>What User Data We Collect</h1>
+    <p>
+        When you visit the website, we may collect the following data:
+    <ul>
+        <li>Your IP address.</li>
+        <li>Your contact information and email address.</li>
+        <li>Other information such as interests and preferences.</li>
+        <li>Data profile regarding your online behavior on our website.</li>
+    </ul>
+    <h1>Why We Collect Your Data</h1>
+    <p>
+        We are collecting your data for several reasons:
+    </p>
+    <ul>
+        <li>To better understand your needs.</li>
+        <li>To improve our services and products.</li>
+        <li>To send you promotional emails containing the information we think you will find interesting.</li>
+        <li>To contact you to fill out surveys and participate in other types of market
+            research.
+        </li>
+        <li>To customize our website according to your online behavior and personal
+            preferences.
+        </li>
+    </ul>
+    <h1>
+        Safeguarding and Securing the Data
+    </h1>
+    <p>Immersive Idea LLC is committed to securing your data and keeping it confidential.</p>
+    <p>Immersive Idea LLC has done all in its power to prevent data theft, unauthorized access,
+        and disclosure by implementing the latest technologies and software, which help us
+        safeguard all the information we collect online.
+    </p>
+    <h1>Our Cookie Policy</h1>
+    <p>
+        Once you agree to allow our website to use cookies, you also agree to use the data it
+        collects regarding your online behavior (analyze web traffic, web pages you visit and
+        spend the most time on).
+    </p>
+    <p>
+        The data we collect by using cookies is used to customize our website to your needs.
+        After we use the data for statistical analysis, the data is completely removed from our
+        systems.
+    </p>
+    <p>
+        Please note that cookies don't allow us to gain control of your computer in any way.
+        They are strictly used to monitor which pages you find useful and which you do not so
+        that we can provide a better experience for you.
+    </p>
+    <p>
+
+
+        If you want to disable cookies, you can do it by accessing the settings of your internet
+        browser. You can visit https://www.internetcookies.com, which contains comprehensive
+        information on how to do this on a wide variety of browsers and devices.
+    </p>
+    <h1>Links to Other Websites</h1>
+    <p>
+        Our website may contain links that lead to other websites. If you click on these links
+        Immersive Idea LLC is not held responsible for your data and privacy protection. Visiting
+        those websites is not governed by this privacy policy agreement. Make sure to read the
+        privacy policy documentation of the website you go to from our website.
+    </p>
+    <h1>
+        Restricting the Collection of your Personal Data
+    </h1>
+    <p>
+
+
+        At some point, you might wish to restrict the use and collection of your personal data.
+        You can achieve this by doing the following:</p>
+    <p>
+        When you are filling the forms on the website, make sure to check if there is a box
+        which you can leave unchecked, if you don't want to disclose your personal information.
+        If you have already agreed to share your information with us, feel free to contact us via
+        email (support@immersiveidea.com) and we will be more than happy to change this for you.</p>
+    <p>
+        Immersive Idea LLC will not lease, sell or distribute your personal information to any third
+        parties, unless we have your permission. We might do so if the law forces us. Your
+        personal information will be used when we need to send you promotional materials if
+        you agree to this privacy policy.
+    </p>
+    <a href="https://www.deepdiagram.com">Home</a>
+</div>
+</body>
+</html>
+

public/styles.css

@@ -0,0 +1,35 @@
+body {
+    width: 100vw;
+    height: 100vh;
+    margin: 0;
+    padding: 0;
+    background-color: #000;
+    background-image: url("/assets/grid6.jpg");
+    aspect-ratio: auto;
+    font-family: Roboto, sans-serif;
+    font-size: large;
+    color: #4444ee;
+}
+
+
+.scene {
+    width: 100vw;
+    height: 100vh;
+    overflow: hidden;
+}
+
+#gameCanvas {
+    width: 100%;
+    height: 100%;
+    margin: 0;
+    padding: 0;
+    background: transparent;
+}
+
+
+#loadingGrid {
+    position: relative;
+    z-index: -1;
+    width: 100%;
+    height: 100%;
+}

public/sw.js

@@ -1,12 +1,25 @@
-const VERSION = '0';
+importScripts('https://storage.googleapis.com/workbox-cdn/releases/7.1.0/workbox-sw.js');
-const CACHE = "pwabuilder-offline";
+const VERSION = '0.0.8-19';
-const PRECACHE_ASSETS = [
+const CACHE = "deepdiagram";
-    '/grass1.jpeg',
+const IMAGEDELIVERY_CACHE = "deepdiagram-images";
-    '/loading-loading-forever.gif',
+const MAPTILE_CACHE = 'maptiler';
-    '/outdoor_field2.jpeg'
-]
-importScripts('https://storage.googleapis.com/workbox-cdn/releases/6.4.1/workbox-sw.js');
 
+// TODO: replace the following with the correct offline fallback page i.e.: const offlineFallbackPage = "offline.html";
+const offlineFallbackPage = "/";
+/*self.addEventListener('install', async (event) => {
+   self.skipWaiting();
+});
+self.addEventListener('activate', async (event) => {
+    self.skipWaiting();
+    self.clients.matchAll({
+        type: 'window'
+    }).then(windowClients => {
+        windowClients.forEach((windowClient) => {
+            windowClient.navigate(windowClient.url);
+        });
+    });
+});
+*/
 self.addEventListener("message", (event) => {
     if (event.data && event.data.type === "SKIP_WAITING") {
         self.skipWaiting();
@@ -14,33 +27,74 @@ self.addEventListener("message", (event) => {
 });
 
 
+/*self.addEventListener('install', async (event) => {
+    event.waitUntil(
+        caches.open(CACHE)
+            .then((cache) => cache.add(offlineFallbackPage))
+    );
+});
+*/
+/*if (workbox.navigationPreload.isSupported()) {
+    workbox.navigationPreload.enable();
+}*/
+
 workbox.routing.registerRoute(
-    new RegExp('/.*\\.png'),
+    new RegExp('/.*\\.wasm'),
     new workbox.strategies.StaleWhileRevalidate({
         cacheName: CACHE
     })
 );
+
 workbox.routing.registerRoute(
-    new RegExp('/.*\\.jpeg'),
+    new RegExp('.*api.maptiler.com/.*'),
+    new workbox.strategies.CacheFirst({
+        plugins: [
+            new workbox.expiration.ExpirationPlugin({
+                maxEntries: 256,
+                maxAgeSeconds: 60 * 60 * 24 * 30,
+                purgeOnQuotaError: true,
+                matchOptions: {
+                    ignoreVary: true
+                }
+            }),
+            new workbox.cacheableResponse.CacheableResponsePlugin({
+                statuses: [0, 200]
+            })
+        ],
+        cacheName: MAPTILE_CACHE
+
+    })
+);
+
+/*workbox.routing.registerRoute(
+    new RegExp('/assets/.*'),
     new workbox.strategies.StaleWhileRevalidate({
         cacheName: CACHE
     })
 );
-workbox.routing.registerRoute(
+*/
-    new RegExp('/.*\\.jpg'),
+
+/*workbox.routing.registerRoute(
+    new RegExp('/db/.*'),
     new workbox.strategies.StaleWhileRevalidate({
         cacheName: CACHE
     })
 );
+
+ */
+
 workbox.routing.registerRoute(
     new RegExp('/.*\\.glb'),
     new workbox.strategies.StaleWhileRevalidate({
         cacheName: CACHE
     })
 );
-
+/*
-
 workbox.routing.registerRoute(
-    new RegExp('/login'),
+    new RegExp('/.*\\.css'),
-    new workbox.strategies.NetworkFirst()
+    new workbox.strategies.StaleWhileRevalidate({
-)
+        cacheName: CACHE
+    })
+);
+*/
+

public/templates/demo.json

@@ -0,0 +1,245 @@
+{
+  "name": "demo",
+  "dbName": "demo",
+  "exportDate": "2025-11-20T14:32:58.031Z",
+  "version": "1.0",
+  "entities": [
+    {
+      "id": "id0c8fd8ad-7dc8-41fa-b61f-b22c2d2b3eb8",
+      "position": {
+        "x": 0.4000000059604645,
+        "y": 1,
+        "z": 2.9000000953674316
+      },
+      "rotation": {
+        "x": 0,
+        "y": 3.141592653589793,
+        "z": 0
+      },
+      "last_seen": "2025-11-20T14:30:54.865Z",
+      "template": "#cylinder-template",
+      "scale": {
+        "x": 0.1,
+        "y": 0.1,
+        "z": 0.1
+      },
+      "color": "#FF00FF",
+      "text": "db",
+      "_id": "id0c8fd8ad-7dc8-41fa-b61f-b22c2d2b3eb8"
+    },
+    {
+      "from": "ide476ec05-9aac-42c9-87f1-ba7f18141767",
+      "to": "idb75dff6c-e056-4a15-b179-adfb2bec793a",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id18bf9938-a0b7-4e65-bf91-38697064698a",
+      "_id": "id18bf9938-a0b7-4e65-bf91-38697064698a"
+    },
+    {
+      "from": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "to": "idb75dff6c-e056-4a15-b179-adfb2bec793a",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id47bf19b7-6263-44fa-b289-1f9f63aa6aff",
+      "_id": "id47bf19b7-6263-44fa-b289-1f9f63aa6aff"
+    },
+    {
+      "from": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "to": "idac543949-c285-4f4b-ab07-d6fd2bbf7bb5",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id50594820-ace6-44c7-be5c-2b0747549c75",
+      "_id": "id50594820-ace6-44c7-be5c-2b0747549c75"
+    },
+    {
+      "from": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "to": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id562bf787-0d11-413c-bc2d-194bf05275fd",
+      "_id": "id562bf787-0d11-413c-bc2d-194bf05275fd"
+    },
+    {
+      "from": "idb75dff6c-e056-4a15-b179-adfb2bec793a",
+      "to": "id0c8fd8ad-7dc8-41fa-b61f-b22c2d2b3eb8",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id5b622c06-95f1-4d04-b023-b1a6851d2107",
+      "_id": "id5b622c06-95f1-4d04-b023-b1a6851d2107"
+    },
+    {
+      "id": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "position": {
+        "x": 0.4000000059604645,
+        "y": 1.7000000476837158,
+        "z": 2.9000000953674316
+      },
+      "rotation": {
+        "x": 0,
+        "y": 3.141592653589793,
+        "z": 0
+      },
+      "last_seen": "2025-11-20T14:28:52.061Z",
+      "template": "#sphere-template",
+      "text": "browser",
+      "scale": {
+        "x": 0.1,
+        "y": 0.1,
+        "z": 0.1
+      },
+      "color": "#8B4513",
+      "_id": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9"
+    },
+    {
+      "from": "idac543949-c285-4f4b-ab07-d6fd2bbf7bb5",
+      "to": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id6f4208a8-9b17-45a8-b030-83a80d7e09bf",
+      "_id": "id6f4208a8-9b17-45a8-b030-83a80d7e09bf"
+    },
+    {
+      "from": "idf1cf90c7-cc2f-4ccc-9bd6-274752f5b66f",
+      "to": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id7205d022-db34-4705-8e3b-930ae0351376",
+      "_id": "id7205d022-db34-4705-8e3b-930ae0351376"
+    },
+    {
+      "from": "idb75dff6c-e056-4a15-b179-adfb2bec793a",
+      "to": "ide476ec05-9aac-42c9-87f1-ba7f18141767",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id74b9b638-8148-4d98-a715-981f7aebd3bb",
+      "_id": "id74b9b638-8148-4d98-a715-981f7aebd3bb"
+    },
+    {
+      "from": "id0c8fd8ad-7dc8-41fa-b61f-b22c2d2b3eb8",
+      "to": "idb75dff6c-e056-4a15-b179-adfb2bec793a",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id7af34b2d-f790-45c9-9fce-6c627de1410e",
+      "_id": "id7af34b2d-f790-45c9-9fce-6c627de1410e"
+    },
+    {
+      "from": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "to": "idf1cf90c7-cc2f-4ccc-9bd6-274752f5b66f",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "id8bdd38de-6ac9-44c1-95e9-015ed85c0b7a",
+      "_id": "id8bdd38de-6ac9-44c1-95e9-015ed85c0b7a"
+    },
+    {
+      "id": "idac543949-c285-4f4b-ab07-d6fd2bbf7bb5",
+      "position": {
+        "x": -0.6000000238418579,
+        "y": 1.7000000476837158,
+        "z": 2.799999952316284
+      },
+      "rotation": {
+        "x": -2.4492937051703357e-16,
+        "y": 3.141592653589793,
+        "z": -2.4492937051703357e-16
+      },
+      "last_seen": "2025-11-20T14:32:19.261Z",
+      "template": "#box-template",
+      "text": "api",
+      "scale": {
+        "x": 0.1,
+        "y": 0.1,
+        "z": 0.1
+      },
+      "color": "#0000FF",
+      "_id": "idac543949-c285-4f4b-ab07-d6fd2bbf7bb5"
+    },
+    {
+      "id": "idb75dff6c-e056-4a15-b179-adfb2bec793a",
+      "position": {
+        "x": 0.4000000059604645,
+        "y": 1.2999999523162842,
+        "z": 2.9000000953674316
+      },
+      "rotation": {
+        "x": 0,
+        "y": 3.141592653589793,
+        "z": 0
+      },
+      "last_seen": "2025-11-20T14:28:36.027Z",
+      "template": "#box-template",
+      "text": "server",
+      "scale": {
+        "x": 0.1,
+        "y": 0.1,
+        "z": 0.1
+      },
+      "color": "#006400",
+      "_id": "idb75dff6c-e056-4a15-b179-adfb2bec793a"
+    },
+    {
+      "from": "idb75dff6c-e056-4a15-b179-adfb2bec793a",
+      "to": "id5c0dab44-2ef8-406e-b0ca-3aeea5b820b9",
+      "type": "entity",
+      "template": "#connection-template",
+      "color": "#000000",
+      "id": "idd6098a95-f534-4126-9aad-9948fdc724c6",
+      "_id": "idd6098a95-f534-4126-9aad-9948fdc724c6"
+    },
+    {
+      "id": "ide476ec05-9aac-42c9-87f1-ba7f18141767",
+      "position": {
+        "x": -0.6000000238418579,
+        "y": 1.2999999523162842,
+        "z": 2.799999952316284
+      },
+      "rotation": {
+        "x": -2.4492931757747437e-16,
+        "y": 3.141592653589793,
+        "z": -6.429647808784774e-40
+      },
+      "last_seen": "2025-11-20T14:30:59.486Z",
+      "template": "#box-template",
+      "scale": {
+        "x": 0.1,
+        "y": 0.1,
+        "z": 0.1
+      },
+      "color": "#0000FF",
+      "text": "api",
+      "_id": "ide476ec05-9aac-42c9-87f1-ba7f18141767"
+    },
+    {
+      "id": "idf1cf90c7-cc2f-4ccc-9bd6-274752f5b66f",
+      "position": {
+        "x": 0.4000000059604645,
+        "y": 2.200000047683716,
+        "z": 3
+      },
+      "rotation": {
+        "x": -2.4492937051703357e-16,
+        "y": 3.141592653589793,
+        "z": -2.4492937051703357e-16
+      },
+      "last_seen": "2025-11-20T14:28:58.876Z",
+      "template": "#person-template",
+      "text": "user",
+      "scale": {
+        "x": 0.1,
+        "y": 0.1,
+        "z": 0.1
+      },
+      "color": "#FFE4B5",
+      "_id": "idf1cf90c7-cc2f-4ccc-9bd6-274752f5b66f"
+    }
+  ]
+}

server.js

@@ -1,15 +1,133 @@
 import express from "express";
 import ViteExpress from "vite-express";
+import cors from "cors";
 import dotenv from "dotenv";
-import expressProxy from "express-http-proxy";
+import newrelic from "newrelic";
+import apiRoutes from "./server/api/index.js";
+import { pouchApp, PouchDB } from "./server/services/databaseService.js";
+import { dbAuthMiddleware } from "./server/middleware/dbAuth.js";
+
+// Load .env.local first, then fall back to .env
+dotenv.config({ path: '.env.local' });
 dotenv.config();
 
+// Console shim to forward logs to New Relic while preserving local output
+const originalConsole = {
+  log: console.log.bind(console),
+  error: console.error.bind(console),
+  warn: console.warn.bind(console),
+  info: console.info.bind(console)
+};
 
+function forwardToNewRelic(level, args) {
+  const message = args.map(arg =>
+    typeof arg === 'object' ? JSON.stringify(arg) : String(arg)
+  ).join(' ');
+
+  newrelic.recordLogEvent({
+    message,
+    level,
+    timestamp: Date.now()
+  });
+}
+
+console.log = (...args) => {
+  forwardToNewRelic('info', args);
+  originalConsole.log(...args);
+};
+
+console.error = (...args) => {
+  forwardToNewRelic('error', args);
+  originalConsole.error(...args);
+};
+
+console.warn = (...args) => {
+  forwardToNewRelic('warn', args);
+  originalConsole.warn(...args);
+};
+
+console.info = (...args) => {
+  forwardToNewRelic('info', args);
+  originalConsole.info(...args);
+};
 
 const app = express();
 
-app.use("/api", expressProxy("local.immersiveidea.com"));
+// CORS configuration for split deployment
+// In combined mode, same-origin requests don't need CORS
+const allowedOrigins = process.env.ALLOWED_ORIGINS?.split(",") || [];
+if (allowedOrigins.length > 0) {
+  app.use(cors({
+    origin: allowedOrigins,
+    credentials: true,
+  }));
+}
 
+// Parse JSON for all routes EXCEPT /pouchdb (express-pouchdb handles its own body parsing)
+app.use((req, res, next) => {
+  if (req.path.startsWith('/pouchdb')) {
+    return next();
+  }
+  express.json()(req, res, next);
+});
 
+// API routes
+app.use("/api", apiRoutes);
 
-ViteExpress.listen(app, process.env.PORT || 3001, () => console.log("Server is listening..."));
+// Test endpoint to verify PouchDB is working
+app.get("/pouchdb-test/:dbname", async (req, res) => {
+  try {
+    const dbName = req.params.dbname;
+    console.log(`[Test] Creating database: ${dbName}`);
+    const db = new PouchDB(dbName);
+    const info = await db.info();
+    console.log(`[Test] Database info:`, info);
+
+    // Try to add a test doc
+    const result = await db.put({ _id: 'test-doc', hello: 'world' });
+    console.log(`[Test] Added doc:`, result);
+
+    // Read it back
+    const doc = await db.get('test-doc');
+    console.log(`[Test] Got doc:`, doc);
+
+    res.json({ success: true, info, doc });
+  } catch (err) {
+    console.error(`[Test] Error:`, err);
+    res.status(500).json({ error: err.message, stack: err.stack });
+  }
+});
+
+// PouchDB database sync endpoint with auth middleware
+// Public databases (/pouchdb/public-*) are accessible without auth
+// Private databases (/pouchdb/private-*) require authentication
+// Patch req.query for Express 5 compatibility with express-pouchdb
+app.use("/pouchdb", dbAuthMiddleware, (req, res, next) => {
+  // Express 5 makes req.query read-only, but express-pouchdb needs to write to it
+  // Redefine as writable property
+  Object.defineProperty(req, 'query', {
+    value: { ...req.query },
+    writable: true,
+    configurable: true
+  });
+  next();
+}, pouchApp, (err, req, res, next) => {
+
+  console.error('[PouchDB Error]', err);
+  res.status(500).json({ error: err.message, stack: err.stack });
+});
+
+// Check if running in API-only mode (split deployment)
+const apiOnly = process.env.API_ONLY === "true";
+
+if (apiOnly) {
+  // API-only mode: no static file serving
+  app.listen(process.env.PORT || 3000, () => {
+    console.log(`API server running on port ${process.env.PORT || 3000}`);
+  });
+} else {
+  // Combined mode: Vite handles static files + SPA
+  ViteExpress.listen(app, process.env.PORT || 3001, () => {
+    console.log(`Server running on port ${process.env.PORT || 3001}`);
+  });
+}

server/api/claude.js

@@ -0,0 +1,178 @@
+import { Router } from "express";
+import { getSession, addMessage, getConversationForAPI } from "../services/sessionStore.js";
+import { trackUsage, getUsageSummary, formatCost, getSessionUsage } from "../services/usageTracker.js";
+
+const router = Router();
+const ANTHROPIC_API_URL = "https://api.anthropic.com";
+
+/**
+ * Build entity context string for the system prompt
+ */
+function buildEntityContext(entities) {
+  if (!entities || entities.length === 0) {
+    return "\n\nThe diagram is currently empty.";
+  }
+
+  const entityList = entities.map(e => {
+    const shape = e.template?.replace('#', '').replace('-template', '') || 'unknown';
+    const pos = e.position || { x: 0, y: 0, z: 0 };
+    return `- ${e.text || '(no label)'} (${shape}, ${e.color || 'unknown'}) at (${pos.x?.toFixed(1)}, ${pos.y?.toFixed(1)}, ${pos.z?.toFixed(1)})`;
+  }).join('\n');
+
+  return `\n\n## Current Diagram State\nThe diagram currently contains ${entities.length} entities:\n${entityList}`;
+}
+
+// Express 5 uses named parameters for wildcards
+router.post("/*path", async (req, res) => {
+  const requestStart = Date.now();
+  console.log(`[Claude API] ========== REQUEST START ==========`);
+
+  const apiKey = process.env.ANTHROPIC_API_KEY;
+
+  if (!apiKey) {
+    console.error(`[Claude API] ERROR: API key not configured`);
+    return res.status(500).json({ error: "API key not configured" });
+  }
+
+  // Get the path after /api/claude (e.g., /v1/messages)
+  // Express 5 returns path segments as an array
+  const pathParam = req.params.path;
+  const path = "/" + (Array.isArray(pathParam) ? pathParam.join("/") : pathParam || "");
+  console.log(`[Claude API] Path: ${path}`);
+
+  // Check for session-based request
+  const { sessionId, ...requestBody } = req.body;
+  let modifiedBody = requestBody;
+  console.log(`[Claude API] Session ID: ${sessionId || 'none'}`);
+  console.log(`[Claude API] Model: ${requestBody.model}`);
+  console.log(`[Claude API] Messages count: ${requestBody.messages?.length || 0}`);
+
+  if (sessionId) {
+    const session = getSession(sessionId);
+    if (session) {
+      console.log(`[Claude API] Session found: ${session.entities.length} entities, ${session.conversationHistory.length} messages in history`);
+
+      // Inject entity context into system prompt
+      if (modifiedBody.system) {
+        const entityContext = buildEntityContext(session.entities);
+        console.log(`[Claude API] Entity context added (${entityContext.length} chars)`);
+        modifiedBody.system += entityContext;
+      }
+
+      // Get conversation history and merge with current messages
+      const historyMessages = getConversationForAPI(sessionId);
+      if (historyMessages.length > 0 && modifiedBody.messages) {
+        // Filter out any duplicate messages (in case client sent history too)
+        const currentContent = modifiedBody.messages[modifiedBody.messages.length - 1]?.content;
+        const filteredHistory = historyMessages.filter(msg => msg.content !== currentContent);
+        modifiedBody.messages = [...filteredHistory, ...modifiedBody.messages];
+        console.log(`[Claude API] Merged ${filteredHistory.length} history + ${modifiedBody.messages.length - filteredHistory.length} new = ${modifiedBody.messages.length} total messages`);
+      }
+    } else {
+      console.log(`[Claude API] WARNING: Session ${sessionId} not found`);
+    }
+  }
+
+  try {
+    console.log(`[Claude API] Sending request to Anthropic API...`);
+    const fetchStart = Date.now();
+
+    const response = await fetch(`${ANTHROPIC_API_URL}${path}`, {
+      method: "POST",
+      headers: {
+        "Content-Type": "application/json",
+        "x-api-key": apiKey,
+        "anthropic-version": "2023-06-01",
+      },
+      body: JSON.stringify(modifiedBody),
+    });
+
+    const fetchDuration = Date.now() - fetchStart;
+    console.log(`[Claude API] Response received in ${fetchDuration}ms, status: ${response.status}`);
+
+    console.log(`[Claude API] Parsing response JSON...`);
+    const data = await response.json();
+    console.log(`[Claude API] Response parsed. Stop reason: ${data.stop_reason}, content blocks: ${data.content?.length || 0}`);
+
+    // Track and log token usage
+    if (data.usage) {
+      // Extract content for detailed tracking
+      const userMessage = requestBody.messages?.[requestBody.messages.length - 1];
+      const inputText = typeof userMessage?.content === 'string' ? userMessage.content : null;
+
+      const outputText = data.content
+        ?.filter(c => c.type === 'text')
+        .map(c => c.text)
+        .join('\n') || null;
+
+      const toolCalls = data.content
+        ?.filter(c => c.type === 'tool_use')
+        .map(c => ({ name: c.name, input: c.input })) || [];
+
+      const usageRecord = trackUsage(sessionId, modifiedBody.model, data.usage, {
+        inputText,
+        outputText,
+        toolCalls
+      });
+      console.log(`[Claude API] REQUEST USAGE: ${getUsageSummary(usageRecord)}`);
+
+      // Log cumulative session usage if session exists
+      if (sessionId) {
+        const sessionStats = getSessionUsage(sessionId);
+        if (sessionStats) {
+          console.log(`[Claude API] SESSION TOTALS (${sessionStats.requestCount} requests):`);
+          console.log(`[Claude API]   Total input:  ${sessionStats.totalInputTokens} tokens`);
+          console.log(`[Claude API]   Total output: ${sessionStats.totalOutputTokens} tokens`);
+          console.log(`[Claude API]   Total cost:   ${formatCost(sessionStats.totalCost)}`);
+        }
+      }
+    }
+
+    if (data.error) {
+      console.error(`[Claude API] API returned error:`, data.error);
+    }
+
+    // If session exists and response is successful, store messages
+    if (sessionId && response.ok && data.content) {
+      const session = getSession(sessionId);
+      if (session) {
+        // Store the user message if it was new (only if it's a string, not tool results)
+        const userMessage = requestBody.messages?.[requestBody.messages.length - 1];
+        if (userMessage && userMessage.role === 'user' && typeof userMessage.content === 'string') {
+          addMessage(sessionId, {
+            role: 'user',
+            content: userMessage.content
+          });
+          console.log(`[Claude API] Stored user message to session`);
+        }
+
+        // Store the assistant response (text only, not tool use blocks)
+        const assistantContent = data.content
+          .filter(c => c.type === 'text')
+          .map(c => c.text)
+          .join('\n');
+
+        if (assistantContent) {
+          addMessage(sessionId, {
+            role: 'assistant',
+            content: assistantContent
+          });
+          console.log(`[Claude API] Stored assistant response to session (${assistantContent.length} chars)`);
+        }
+      }
+    }
+
+    const totalDuration = Date.now() - requestStart;
+    console.log(`[Claude API] ========== REQUEST COMPLETE (${totalDuration}ms) ==========`);
+    res.status(response.status).json(data);
+  } catch (error) {
+    const totalDuration = Date.now() - requestStart;
+    console.error(`[Claude API] ========== REQUEST FAILED (${totalDuration}ms) ==========`);
+    console.error(`[Claude API] Error:`, error);
+    console.error(`[Claude API] Error message:`, error.message);
+    console.error(`[Claude API] Error stack:`, error.stack);
+    res.status(500).json({ error: "Failed to proxy request to Claude API", details: error.message });
+  }
+});
+
+export default router;

server/api/cloudflare.js

@@ -0,0 +1,213 @@
+import { Router } from "express";
+import { getSession, addMessage, getConversationForAPI } from "../services/sessionStore.js";
+import { trackUsage, getUsageSummary, formatCost, getSessionUsage } from "../services/usageTracker.js";
+import { getCloudflareAccountId, getCloudflareApiToken } from "../services/providerConfig.js";
+import {
+  claudeToolsToCloudflare,
+  claudeMessagesToCloudflare,
+  cloudflareResponseToClaude
+} from "../services/toolConverter.js";
+
+const router = Router();
+
+/**
+ * Build entity context string for the system prompt
+ */
+function buildEntityContext(entities) {
+  if (!entities || entities.length === 0) {
+    return "\n\nThe diagram is currently empty.";
+  }
+
+  const entityList = entities.map(e => {
+    const shape = e.template?.replace('#', '').replace('-template', '') || 'unknown';
+    const pos = e.position || { x: 0, y: 0, z: 0 };
+    return `- ${e.text || '(no label)'} (${shape}, ${e.color || 'unknown'}) at (${pos.x?.toFixed(1)}, ${pos.y?.toFixed(1)}, ${pos.z?.toFixed(1)})`;
+  }).join('\n');
+
+  return `\n\n## Current Diagram State\nThe diagram currently contains ${entities.length} entities:\n${entityList}`;
+}
+
+// Express 5 uses named parameters for wildcards
+router.post("/*path", async (req, res) => {
+  const requestStart = Date.now();
+  console.log(`[Cloudflare API] ========== REQUEST START ==========`);
+
+  const accountId = getCloudflareAccountId();
+  const apiToken = getCloudflareApiToken();
+
+  if (!accountId) {
+    console.error(`[Cloudflare API] ERROR: Account ID not configured`);
+    return res.status(500).json({ error: "Cloudflare account ID not configured" });
+  }
+
+  if (!apiToken) {
+    console.error(`[Cloudflare API] ERROR: API token not configured`);
+    return res.status(500).json({ error: "Cloudflare API token not configured" });
+  }
+
+  // Check for session-based request
+  const { sessionId, ...requestBody } = req.body;
+  let modifiedBody = { ...requestBody };
+  const model = requestBody.model;
+
+  console.log(`[Cloudflare API] Session ID: ${sessionId || 'none'}`);
+  console.log(`[Cloudflare API] Model: ${model}`);
+  console.log(`[Cloudflare API] Messages count: ${requestBody.messages?.length || 0}`);
+
+  // Build system prompt with entity context
+  let systemPrompt = modifiedBody.system || '';
+
+  if (sessionId) {
+    const session = getSession(sessionId);
+    if (session) {
+      console.log(`[Cloudflare API] Session found: ${session.entities.length} entities, ${session.conversationHistory.length} messages in history`);
+
+      // Inject entity context into system prompt
+      const entityContext = buildEntityContext(session.entities);
+      console.log(`[Cloudflare API] Entity context added (${entityContext.length} chars)`);
+      systemPrompt += entityContext;
+
+      // Get conversation history and merge with current messages
+      const historyMessages = getConversationForAPI(sessionId);
+      if (historyMessages.length > 0 && modifiedBody.messages) {
+        const currentContent = modifiedBody.messages[modifiedBody.messages.length - 1]?.content;
+        const filteredHistory = historyMessages.filter(msg => msg.content !== currentContent);
+        modifiedBody.messages = [...filteredHistory, ...modifiedBody.messages];
+        console.log(`[Cloudflare API] Merged ${filteredHistory.length} history + ${modifiedBody.messages.length - filteredHistory.length} new = ${modifiedBody.messages.length} total messages`);
+      }
+    } else {
+      console.log(`[Cloudflare API] WARNING: Session ${sessionId} not found`);
+    }
+  }
+
+  try {
+    // Convert to Cloudflare format
+    const cfMessages = claudeMessagesToCloudflare(modifiedBody.messages || [], systemPrompt);
+    const cfTools = modifiedBody.tools ? claudeToolsToCloudflare(modifiedBody.tools) : undefined;
+
+    // Build Cloudflare request body
+    const cfRequestBody = {
+      messages: cfMessages,
+      max_tokens: modifiedBody.max_tokens || 1024
+    };
+
+    // Only include tools if the model supports them
+    if (cfTools && cfTools.length > 0) {
+      cfRequestBody.tools = cfTools;
+    }
+
+    // Cloudflare endpoint: https://api.cloudflare.com/client/v4/accounts/{account_id}/ai/run/{model}
+    const endpoint = `https://api.cloudflare.com/client/v4/accounts/${accountId}/ai/run/${model}`;
+
+    console.log(`[Cloudflare API] Sending request to: ${endpoint}`);
+    console.log(`[Cloudflare API] Request body messages: ${cfMessages.length}, tools: ${cfTools?.length || 0}`);
+    const requestBodyJson = JSON.stringify(cfRequestBody);
+    console.log(`[Cloudflare API] Full request body (${requestBodyJson.length} bytes):`);
+    console.log(requestBodyJson);
+    const fetchStart = Date.now();
+
+    const response = await fetch(endpoint, {
+      method: "POST",
+      headers: {
+        "Content-Type": "application/json",
+        "Authorization": `Bearer ${apiToken}`,
+      },
+      body: JSON.stringify(cfRequestBody),
+    });
+
+    const fetchDuration = Date.now() - fetchStart;
+    console.log(`[Cloudflare API] Response received in ${fetchDuration}ms, status: ${response.status}`);
+
+    console.log(`[Cloudflare API] Parsing response JSON...`);
+    const cfData = await response.json();
+
+    if (!cfData.success) {
+      console.error(`[Cloudflare API] API returned error:`, cfData.errors);
+      return res.status(response.status).json({
+        error: cfData.errors?.[0]?.message || "Cloudflare API error",
+        details: cfData.errors
+      });
+    }
+
+    // Convert Cloudflare response to Claude format
+    const data = cloudflareResponseToClaude(cfData, model);
+    console.log(`[Cloudflare API] Response converted. Stop reason: ${data.stop_reason}, content blocks: ${data.content?.length || 0}`);
+
+    // Track and log token usage
+    if (data.usage) {
+      // Extract content for detailed tracking
+      const userMessage = requestBody.messages?.[requestBody.messages.length - 1];
+      const inputText = typeof userMessage?.content === 'string' ? userMessage.content : null;
+
+      const outputText = data.content
+        ?.filter(c => c.type === 'text')
+        .map(c => c.text)
+        .join('\n') || null;
+
+      const toolCalls = data.content
+        ?.filter(c => c.type === 'tool_use')
+        .map(c => ({ name: c.name, input: c.input })) || [];
+
+      const usageRecord = trackUsage(sessionId, model, data.usage, {
+        inputText,
+        outputText,
+        toolCalls
+      });
+      console.log(`[Cloudflare API] REQUEST USAGE: ${getUsageSummary(usageRecord)}`);
+
+      // Log cumulative session usage if session exists
+      if (sessionId) {
+        const sessionStats = getSessionUsage(sessionId);
+        if (sessionStats) {
+          console.log(`[Cloudflare API] SESSION TOTALS (${sessionStats.requestCount} requests):`);
+          console.log(`[Cloudflare API]   Total input:  ${sessionStats.totalInputTokens} tokens`);
+          console.log(`[Cloudflare API]   Total output: ${sessionStats.totalOutputTokens} tokens`);
+          console.log(`[Cloudflare API]   Total cost:   ${formatCost(sessionStats.totalCost)}`);
+        }
+      }
+    }
+
+    // If session exists and response is successful, store messages
+    if (sessionId && response.ok && data.content) {
+      const session = getSession(sessionId);
+      if (session) {
+        // Store the user message if it was new (only if it's a string, not tool results)
+        const userMessage = requestBody.messages?.[requestBody.messages.length - 1];
+        if (userMessage && userMessage.role === 'user' && typeof userMessage.content === 'string') {
+          addMessage(sessionId, {
+            role: 'user',
+            content: userMessage.content
+          });
+          console.log(`[Cloudflare API] Stored user message to session`);
+        }
+
+        // Store the assistant response (text only, not tool use blocks)
+        const assistantContent = data.content
+          .filter(c => c.type === 'text')
+          .map(c => c.text)
+          .join('\n');
+
+        if (assistantContent) {
+          addMessage(sessionId, {
+            role: 'assistant',
+            content: assistantContent
+          });
+          console.log(`[Cloudflare API] Stored assistant response to session (${assistantContent.length} chars)`);
+        }
+      }
+    }
+
+    const totalDuration = Date.now() - requestStart;
+    console.log(`[Cloudflare API] ========== REQUEST COMPLETE (${totalDuration}ms) ==========`);
+    res.status(response.status).json(data);
+  } catch (error) {
+    const totalDuration = Date.now() - requestStart;
+    console.error(`[Cloudflare API] ========== REQUEST FAILED (${totalDuration}ms) ==========`);
+    console.error(`[Cloudflare API] Error:`, error);
+    console.error(`[Cloudflare API] Error message:`, error.message);
+    console.error(`[Cloudflare API] Error stack:`, error.stack);
+    res.status(500).json({ error: "Failed to proxy request to Cloudflare API", details: error.message });
+  }
+});
+
+export default router;

server/api/index.js

@@ -0,0 +1,30 @@
+import { Router } from "express";
+import claudeRouter from "./claude.js";
+import ollamaRouter from "./ollama.js";
+import cloudflareRouter from "./cloudflare.js";
+import sessionRouter from "./session.js";
+import userRouter from "./user.js";
+
+const router = Router();
+
+// Session management
+router.use("/session", sessionRouter);
+
+// User features
+router.use("/user", userRouter);
+
+// Claude API proxy
+router.use("/claude", claudeRouter);
+
+// Ollama API proxy
+router.use("/ollama", ollamaRouter);
+
+// Cloudflare Workers AI proxy
+router.use("/cloudflare", cloudflareRouter);
+
+// Health check
+router.get("/health", (req, res) => {
+  res.json({ status: "ok" });
+});
+
+export default router;